Dinocton 6
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Dinocton 6(F11209) |
| 2D Structure | |
| FRCD ID | F11209 |
| CAS Number | 32534-96-6 |
| PubChem CID | 169442 |
| Formula | C16H22N2O7 |
| IUPAC Name | methyl [2-(6-methylheptyl)-4,6-dinitrophenyl] carbonate |
| InChI Key | ODOSVAWLEGXOPB-UHFFFAOYSA-N |
| InChI | InChI=1S/C16H22N2O7/c1-11(2)7-5-4-6-8-12-9-13(17(20)21)10-14(18(22)23)15(12)25-16(19)24-3/h9-11H,4-8H2,1-3H3 |
| Canonical SMILES | CC(C)CCCCCC1=CC(=CC(=C1OC(=O)OC)[N+](=O)[O-])[N+](=O)[O-] |
| Isomeric SMILES | CC(C)CCCCCC1=CC(=CC(=C1OC(=O)OC)[N+](=O)[O-])[N+](=O)[O-] |
| Synonyms |
Dinocton
32534-96-6
Dinocton-6
Dinocton [ISO]
AC1L53RI
AC1Q60KI
SCHEMBL5933992
CHEBI:82064
Dinocton 6
methyl-2-(6-methylheptyl)-4,6-dinitrophenylcarbonat
|
| Classifies |
Pesticide
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Nitrobenzenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Nitrobenzenes |
| Alternative Parents | |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Nitrobenzene - Phenoxy compound - Nitroaromatic compound - Carbonic acid diester - C-nitro compound - Carbonic acid derivative - Organic nitro compound - Organic oxoazanium - Allyl-type 1,3-dipolar organic compound - Propargyl-type 1,3-dipolar organic compound - Organic 1,3-dipolar compound - Organooxygen compound - Organonitrogen compound - Organic oxide - Organopnictogen compound - Organic nitrogen compound - Carbonyl group - Organic oxygen compound - Hydrocarbon derivative - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as nitrobenzenes. These are compounds containing a nitrobenzene moiety, which consists of a benzene ring with a carbon bearing a nitro group. |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 354.359 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 9 |
| Complexity | 458 |
| Monoisotopic Mass | 354.143 |
| Exact Mass | 354.143 |
| XLogP | 5.5 |
| Formal Charge | 0 |
| Heavy Atom Count | 25 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |