Mesosulfuron-Methyl
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Mesosulfuron-Methyl(F05100) | 
| 2D Structure | |
| Description | Metsulfuron-methyl is a residual sulfonylurea herbicide that kills broadleaf weeds and some annual grasses. It is a systemic compound with foliar and soil activity, that inhibits cell division in shoots and roots. It has very low toxicity to mammals, birds, fish, and insects, but is a moderate eye irritant.  | 
| FRCD ID | F05100 | 
| CAS Number | 208465-21-8 | 
| PubChem CID | 11409499 | 
| Formula | C17H21N5O9S2 | 
| IUPAC Name | methyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-4-(methanesulfonamidomethyl)benzoate  | 
| InChI Key | NIFKBBMCXCMCAO-UHFFFAOYSA-N  | 
| InChI | InChI=1S/C17H21N5O9S2/c1-29-13-8-14(30-2)20-16(19-13)21-17(24)22-33(27,28)12-7-10(9-18-32(4,25)26)5-6-11(12)15(23)31-3/h5-8,18H,9H2,1-4H3,(H2,19,20,21,22,24)  | 
| Canonical SMILES | COC1=CC(=NC(=N1)NC(=O)NS(=O)(=O)C2=C(C=CC(=C2)CNS(=O)(=O)C)C(=O)OC)OC  | 
| Isomeric SMILES | COC1=CC(=NC(=N1)NC(=O)NS(=O)(=O)C2=C(C=CC(=C2)CNS(=O)(=O)C)C(=O)OC)OC  | 
| Synonyms | 
        
            methyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-4-(methanesulfonamidomethyl)benzoate
        
            Mesosulfuron-methyl
        
            208465-21-8
        
            Mesomaxx
        
            Mesosulfuron-methyl [ISO]
        
            UNII-22L00R79A6
        
            22L00R79A6
        
            Benzoic acid, 2-(4,6-dimethoxy-2-pyrimidinyl)aminocarbonylaminosulfonyl-4-(methylsulfonyl)amin
        
            Benzoic acid, 2-(((((4,6-dimethoxy-2-pyrimidinyl)amino)carbonyl)amino)sulfonyl)-4-(((methylsulfonyl)amino)methyl)-, methyl ester
        
            SCHEMBL116828
         | 
| Classifies | 
                
                  
                    Pesticide
                  
                
         | 
| Update Date | Nov 13, 2018 17:07 | 
Chemical Taxonomy
| Kingdom | Organic compounds | 
| Superclass | Organic nitrogen compounds | 
| Class | Organonitrogen compounds | 
| Subclass | Sulfonylureas | 
| Intermediate Tree Nodes | Not available | 
| Direct Parent | Pyrimidinyl-2-sulfonylureas | 
| Alternative Parents | 
  | 
| Molecular Framework | Aromatic heteromonocyclic compounds | 
| Substituents | Pyrimidinyl-2-sulfonylurea - Benzenesulfonamide - Benzoate ester - Benzenesulfonyl group - Benzoic acid or derivatives - Benzoyl - Alkyl aryl ether - Pyrimidine - Organic sulfonic acid amide - Organosulfonic acid amide - Benzenoid - Monocyclic benzene moiety - Sulfonyl - Organosulfonic acid or derivatives - Aminosulfonyl compound - Methyl ester - Organic sulfonic acid or derivatives - Heteroaromatic compound - Carbonic acid derivative - Carboxylic acid ester - Azacycle - Organoheterocyclic compound - Carboxylic acid derivative - Ether - Monocarboxylic acid or derivatives - Carbonyl group - Organic oxygen compound - Organopnictogen compound - Organosulfur compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Aromatic heteromonocyclic compound | 
| Description | This compound belongs to the class of organic compounds known as pyrimidinyl-2-sulfonylureas. These are aromatic heterocyclic compounds containing a pyrimidine ring which is substituted with a sulfonylurea at the ring 2-position. | 
Properties
| Property Name | Property Value | 
|---|---|
| Molecular Weight | 503.501 | 
| Hydrogen Bond Donor Count | 3 | 
| Hydrogen Bond Acceptor Count | 12 | 
| Rotatable Bond Count | 10 | 
| Complexity | 876 | 
| Monoisotopic Mass | 503.078 | 
| Exact Mass | 503.078 | 
| XLogP | 0.6 | 
| Formal Charge | 0 | 
| Heavy Atom Count | 33 | 
| Defined Atom Stereocenter Count | 0 | 
| Undefined Atom Stereocenter Count | 0 | 
| Defined Bond Stereocenter Count | 0 | 
| Undefined Bond Stereocenter Count | 0 | 
| Isotope Atom Count | 0 | 
| Covalently-Bonded Unit Count | 1 | 
ADMET
| Model | Result | Probability | 
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.5621 | 
| Human Intestinal Absorption | HIA+ | 0.8318 | 
| Caco-2 Permeability | Caco2- | 0.6677 | 
| P-glycoprotein Substrate | Non-substrate | 0.7010 | 
| P-glycoprotein Inhibitor | Non-inhibitor | 0.7965 | 
| Non-inhibitor | 0.8699 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8649 | 
| Distribution | ||
| Subcellular localization | Mitochondria | 0.5961 | 
| Metabolism | ||
| CYP450 2C9 Substrate | Substrate | 0.5122 | 
| CYP450 2D6 Substrate | Non-substrate | 0.8587 | 
| CYP450 3A4 Substrate | Non-substrate | 0.6404 | 
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.7735 | 
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.6007 | 
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8734 | 
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.6804 | 
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.6857 | 
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.7609 | 
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9816 | 
| Non-inhibitor | 0.8342 | |
| AMES Toxicity | Non AMES toxic | 0.6986 | 
| Carcinogens | Non-carcinogens | 0.7546 | 
| Fish Toxicity | High FHMT | 0.9441 | 
| Tetrahymena Pyriformis Toxicity | High TPT | 0.6896 | 
| Honey Bee Toxicity | Low HBT | 0.7945 | 
| Biodegradation | Not ready biodegradable | 0.9964 | 
| Acute Oral Toxicity | III | 0.7438 | 
| Carcinogenicity (Three-class) | Non-required | 0.5822 | 
| Model | Value | Unit | 
|---|---|---|
| Absorption | ||
| Aqueous solubility | -3.7007 | LogS | 
| Caco-2 Permeability | 0.1408 | LogPapp, cm/s | 
| Distribution | ||
| Metabolism | ||
| Excretion | ||
| Toxicity | ||
| Rat Acute Toxicity | 1.9424 | LD50, mol/kg | 
| Fish Toxicity | 1.6291 | pLC50, mg/L | 
| Tetrahymena Pyriformis Toxicity | 0.4332 | pIGC50, ug/L | 
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes | 
|---|---|---|---|---|---|
| Other Cereals Do Not Include Rice | Britain | 0.01mg/kg | |||
| Other Small Fruit & Berries (Other Than Wild) | Britain | 0.01mg/kg | |||
| Other Terrestrial Mammals,Edible Offal | Japan | 0.01ppm | |||
| Plums | Britain | 0.01mg/kg | |||
| Rice | Britain | 0.01mg/kg | |||
| Millet | Britain | 0.01mg/kg | |||
| Buckwheat | Britain | 0.01mg/kg | |||
| Maize | Britain | 0.01mg/kg | |||
| Triticale | Britain | 0.01mg/kg | |||
| Oats | Britain | 0.01mg/kg | |||
| Sorghum | Britain | 0.01mg/kg | |||
| Barley | Britain | 0.01mg/kg | |||
| Rye | Britain | 0.01mg/kg | |||
| Wheat | Britain | 0.01mg/kg | |||
| Hop | Britain | 0.02mg/kg | |||
| Tea | Britain | 0.02mg/kg | |||
| Ware Potatoes | Britain | 0.01mg/kg | |||
| Early Potatoes | Britain | 0.01mg/kg | |||
| Other Oilseeds | Britain | 0.02mg/kg | |||
| Hemp Seed | Britain | 0.02mg/kg |