Oxadiargyl
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Oxadiargyl(F05658) |
| 2D Structure | |
| FRCD ID | F05658 |
| CAS Number | 39807-15-3 |
| PubChem CID | 94498 |
| Formula | C15H14Cl2N2O3 |
| IUPAC Name | 5-tert-butyl-3-(2,4-dichloro-5-prop-2-ynoxyphenyl)-1,3,4-oxadiazol-2-one |
| InChI Key | DVOODWOZJVJKQR-UHFFFAOYSA-N |
| InChI | InChI=1S/C15H14Cl2N2O3/c1-5-6-21-12-8-11(9(16)7-10(12)17)19-14(20)22-13(18-19)15(2,3)4/h1,7-8H,6H2,2-4H3 |
| Canonical SMILES | CC(C)(C)C1=NN(C(=O)O1)C2=CC(=C(C=C2Cl)Cl)OCC#C |
| Isomeric SMILES | CC(C)(C)C1=NN(C(=O)O1)C2=CC(=C(C=C2Cl)Cl)OCC#C |
| Synonyms |
Topstar
5-(tert-Butyl)-3-(2,4-dichloro-5-(prop-2-yn-1-yloxy)phenyl)-1,3,4-oxadiazol-2(3H)-one
Oxadiargyl
39807-15-3
UNII-F33159G4WG
RP 020630
EINECS 254-637-6
5-tert-Butyl-3-(2,4-dichloro-5-propargyloxyphenyl)-1,3,4-oxadiazol-2(3H)-one
F33159G4WG
1,3,4-Oxadiazol-2(3H)-one, 3-(2,4-dichloro-5-(2-propynyloxy)phenyl)-5-(1,1-dimethylethyl)-
|
| Classifies |
Pesticide
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Halobenzenes |
| Intermediate Tree Nodes | Chlorobenzenes |
| Direct Parent | Dichlorobenzenes |
| Alternative Parents | |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Phenoxy compound - 1,3-dichlorobenzene - Phenol ether - Alkyl aryl ether - Aryl chloride - Aryl halide - 1,3,4-oxadiazole - Azole - Oxadiazole - Heteroaromatic compound - Organoheterocyclic compound - Ether - Acetylide - Azacycle - Oxacycle - Organic oxide - Organooxygen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Organic nitrogen compound - Organopnictogen compound - Organic oxygen compound - Hydrocarbon derivative - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as dichlorobenzenes. These are compounds containing a benzene with exactly two chlorine atoms attached to it. |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 341.188 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 4 |
| Complexity | 521 |
| Monoisotopic Mass | 340.038 |
| Exact Mass | 340.038 |
| XLogP | 4.1 |
| Formal Charge | 0 |
| Heavy Atom Count | 22 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Rice | Britain | 0.01mg/kg | |||
| Millet | Britain | 0.01mg/kg | |||
| Buckwheat | Britain | 0.01mg/kg | |||
| Maize | Britain | 0.01mg/kg | |||
| Triticale | Britain | 0.01mg/kg | |||
| Oats | Britain | 0.01mg/kg | |||
| Sorghum | Britain | 0.01mg/kg | |||
| Barley | Britain | 0.01mg/kg | |||
| Rye | Britain | 0.01mg/kg | |||
| Wheat | Britain | 0.01mg/kg | |||
| Hop | Britain | 0.05mg/kg | |||
| Tea | Britain | 0.05mg/kg | |||
| Ware Potatoes | Britain | 0.01mg/kg | |||
| Early Potatoes | Britain | 0.01mg/kg | |||
| Other Oilseeds | Britain | 0.01mg/kg | |||
| Hemp Seed | Britain | 0.01mg/kg | |||
| Cotton Seed | Britain | 0.01mg/kg | |||
| Mustard Seed | Britain | 0.01mg/kg | |||
| Soya Bean | Britain | 0.01mg/kg | |||
| Rape Seed | Britain | 0.01mg/kg |