Fenprostalene
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Fenprostalene(F05685) |
| 2D Structure | |
| FRCD ID | F05685 |
| CAS Number | |
| PubChem CID | 6435068 |
| Formula | C23H30O6 |
| IUPAC Name | methyl 7-[(1R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-phenoxybut-1-enyl]cyclopentyl]hepta-4,5-dienoate |
| InChI Key | BYNHBQROLKAEDQ-PASQQFGNSA-N |
| InChI | InChI=1S/C23H30O6/c1-28-23(27)12-8-3-2-7-11-19-20(22(26)15-21(19)25)14-13-17(24)16-29-18-9-5-4-6-10-18/h3-7,9-10,13-14,17,19-22,24-26H,8,11-12,15-16H2,1H3/b14-13+/t2?,17-,19-,20?,21+,22-/m1/s1 |
| Canonical SMILES | COC(=O)CCC=C=CCC1C(CC(C1C=CC(COC2=CC=CC=C2)O)O)O |
| Isomeric SMILES | COC(=O)CCC=C=CC[C@H]1[C@H](C[C@H](C1/C=C/[C@H](COC2=CC=CC=C2)O)O)O |
| Synonyms |
Fenprostalene [USAN:BAN:INN]
Methyl (+-)-7-((1R*,2R*,3R*,5S*)-3,5-dihydroxy-2-((E)-(3R*)-3-hydroxy-4-phenoxy-1-butenyl)cyclopentyl)-4,5-heptadienoate
FENPROSTALENE
Synchrocept B
Synchrocept B (Veterinary)
Fenprostalenum [INN-Latin]
Fenprostaleno [INN-Spanish]
EINECS 273-982-3
AC1O5J1Y
4,5-Heptadienoic acid, 7-(3,5-dihydroxy-2-(3-hydroxy-4-phenoxy-1-butenyl)cyclopentyl)-, methyl ester
|
| Classifies |
Predicted: Animal Toxin
|
| Update Date | Nov 13, 2018 17:07 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 402.487 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 11 |
| Complexity | 574 |
| Monoisotopic Mass | 402.204 |
| Exact Mass | 402.204 |
| XLogP | 1.6 |
| Formal Charge | 0 |
| Heavy Atom Count | 29 |
| Defined Atom Stereocenter Count | 4 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 1 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.5234 |
| Human Intestinal Absorption | HIA+ | 0.9147 |
| Caco-2 Permeability | Caco2- | 0.5108 |
| P-glycoprotein Substrate | Substrate | 0.6361 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8624 |
| Non-inhibitor | 0.6520 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.7853 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.8852 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7740 |
| CYP450 2D6 Substrate | Non-substrate | 0.8500 |
| CYP450 3A4 Substrate | Substrate | 0.5752 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.6624 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.8626 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9086 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.7885 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8255 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.8343 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9183 |
| Non-inhibitor | 0.7206 | |
| AMES Toxicity | Non AMES toxic | 0.7513 |
| Carcinogens | Non-carcinogens | 0.9613 |
| Fish Toxicity | High FHMT | 0.9862 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9998 |
| Honey Bee Toxicity | High HBT | 0.7218 |
| Biodegradation | Ready biodegradable | 0.6927 |
| Acute Oral Toxicity | I | 0.5849 |
| Carcinogenicity (Three-class) | Non-required | 0.7600 |
| Model | Value | Unit |
|---|---|---|
| Absorption | ||
| Aqueous solubility | -2.5519 | LogS |
| Caco-2 Permeability | 0.3861 | LogPapp, cm/s |
| Distribution | ||
| Metabolism | ||
| Excretion | ||
| Toxicity | ||
| Rat Acute Toxicity | 3.2470 | LD50, mol/kg |
| Fish Toxicity | 1.3210 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 1.5008 | pIGC50, ug/L |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Fat Of Cattle | United States | 0.ppb(safe concentrations) | |||
| Kidney Of Cattle | United States | 30ppb(safe concentrations) | |||
| Muscle Of Cattle | United States | 10ppb(safe concentrations) | |||
| Cattle | United States | 0.t needed | |||
| Cattle,Edible Offal | Japan | 0.02ppm | |||
| Cattle,Kidney | Japan | 0.03ppm | |||
| Cattle,Liver | Japan | 0.02ppm | |||
| Cattle,Fat | Japan | 0.04ppm | |||
| Cattle,Muscle | Japan | 0.01ppm | |||
| Liver Of Cattle | United States | 20ppb(safe concentrations) |