Benzobicyclon
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Benzobicyclon(F05706) |
| 2D Structure | |
| FRCD ID | F05706 |
| CAS Number | 156963-66-5 |
| PubChem CID | 11236201 |
| Formula | C22H19ClO4S2 |
| IUPAC Name | 3-(2-chloro-4-methylsulfonylbenzoyl)-2-phenylsulfanylbicyclo[3.2.1]oct-2-en-4-one |
| InChI Key | VIXCLRUCUMWJFF-UHFFFAOYSA-N |
| InChI | InChI=1S/C22H19ClO4S2/c1-29(26,27)16-9-10-17(18(23)12-16)21(25)19-20(24)13-7-8-14(11-13)22(19)28-15-5-3-2-4-6-15/h2-6,9-10,12-14H,7-8,11H2,1H3 |
| Canonical SMILES | CS(=O)(=O)C1=CC(=C(C=C1)C(=O)C2=C(C3CCC(C3)C2=O)SC4=CC=CC=C4)Cl |
| Isomeric SMILES | CS(=O)(=O)C1=CC(=C(C=C1)C(=O)C2=C(C3CCC(C3)C2=O)SC4=CC=CC=C4)Cl |
| Synonyms |
Bicyclo[3.2.1]oct-3-en-2-one,3-[2-chloro-4-(methylsulfonyl)benzoyl]-4-(phenylthio)-
Benzobicyclon
156963-66-5
Benzobicyclon [ISO]
SB 500
SCHEMBL117919
DTXSID3057987
CTK4C9226
CHEBI:136658
VIXCLRUCUMWJFF-UHFFFAOYSA-N
|
| Classifies |
Pesticide
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzenesulfonyl compounds |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzenesulfonyl compounds |
| Alternative Parents | |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | Benzenesulfonyl group - Aryl thioether - Benzoyl - Aryl ketone - Chlorobenzene - Cyclohexenone - Halobenzene - Aryl chloride - Aryl halide - Vinylogous thioester - Sulfonyl - Sulfone - Vinylogous halide - Thioenolether - Ketone - Sulfenyl compound - Organosulfur compound - Organooxygen compound - Organochloride - Organohalogen compound - Hydrocarbon derivative - Organic oxide - Carbonyl group - Organic oxygen compound - Aromatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as benzenesulfonyl compounds. These are aromatic compounds containing a benzenesulfonyl group, which consists of a monocyclic benzene moiety that carries a sulfonyl group. |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 446.96 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 5 |
| Complexity | 807 |
| Monoisotopic Mass | 446.041 |
| Exact Mass | 446.041 |
| XLogP | 4.4 |
| Formal Charge | 0 |
| Heavy Atom Count | 29 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 2 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.7234 |
| Human Intestinal Absorption | HIA+ | 0.9768 |
| Caco-2 Permeability | Caco2- | 0.5647 |
| P-glycoprotein Substrate | Non-substrate | 0.5566 |
| P-glycoprotein Inhibitor | Inhibitor | 0.5113 |
| Non-inhibitor | 0.9851 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.7373 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.4506 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.6134 |
| CYP450 2D6 Substrate | Non-substrate | 0.8151 |
| CYP450 3A4 Substrate | Substrate | 0.5251 |
| CYP450 1A2 Inhibitor | Inhibitor | 0.5830 |
| CYP450 2C9 Inhibitor | Inhibitor | 0.5751 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8668 |
| CYP450 2C19 Inhibitor | Inhibitor | 0.5986 |
| CYP450 3A4 Inhibitor | Inhibitor | 0.5499 |
| CYP Inhibitory Promiscuity | High CYP Inhibitory Promiscuity | 0.7711 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9118 |
| Non-inhibitor | 0.8136 | |
| AMES Toxicity | Non AMES toxic | 0.6126 |
| Carcinogens | Non-carcinogens | 0.6786 |
| Fish Toxicity | High FHMT | 0.9913 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9386 |
| Honey Bee Toxicity | High HBT | 0.6631 |
| Biodegradation | Not ready biodegradable | 0.8606 |
| Acute Oral Toxicity | III | 0.4607 |
| Carcinogenicity (Three-class) | Non-required | 0.6171 |
| Model | Value | Unit |
|---|---|---|
| Absorption | ||
| Aqueous solubility | -3.8547 | LogS |
| Caco-2 Permeability | 1.1184 | LogPapp, cm/s |
| Distribution | ||
| Metabolism | ||
| Excretion | ||
| Toxicity | ||
| Rat Acute Toxicity | 2.7170 | LD50, mol/kg |
| Fish Toxicity | 0.8830 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.9792 | pIGC50, ug/L |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Rice(Brown Rice) | Japan | 0.1ppm |