Fentin Hydroxide
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Fentin Hydroxide(F05731) |
| 2D Structure | |
| FRCD ID | F05731 |
| CAS Number | 76-87-9 |
| PubChem CID | 6327657 |
| Formula | C18H17OSn |
| IUPAC Name | triphenyltin;hydrate |
| InChI Key | NRHFWOJROOQKBK-UHFFFAOYSA-N |
| InChI | InChI=1S/3C6H5.H2O.Sn/c3*1-2-4-6-5-3-1;;/h3*1-5H;1H2; |
| Canonical SMILES | C1=CC=C(C=C1)[Sn](C2=CC=CC=C2)C3=CC=CC=C3.O |
| Isomeric SMILES | C1=CC=C(C=C1)[Sn](C2=CC=CC=C2)C3=CC=CC=C3.O |
| Synonyms |
Triphenyltin hydroxide
FENTIN HYDROXIDE
Triphenylstannanol
76-87-9
Vancide ks
Hydroxytriphenyltin
Hydroxytriphenylstannane
Erithane
Fenolovo
Tenhide
|
| Classifies |
Pollutant
Pesticide
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzene and substituted derivatives |
| Alternative Parents | |
| Molecular Framework | Not available |
| Substituents | Monocyclic benzene moiety - Aromatic hydrocarbon - Organic oxygen compound - Unsaturated hydrocarbon - Organic oxide - Hydrocarbon derivative - Hydrocarbon - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as benzene and substituted derivatives. These are aromatic compounds containing one monocyclic ring system consisting of benzene. |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 368.043 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 3 |
| Complexity | 207 |
| Monoisotopic Mass | 369.03 |
| Exact Mass | 369.03 |
| Formal Charge | 0 |
| Heavy Atom Count | 20 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 2 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9695 |
| Human Intestinal Absorption | HIA+ | 0.9802 |
| Caco-2 Permeability | Caco2+ | 0.8776 |
| P-glycoprotein Substrate | Non-substrate | 0.7898 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.9571 |
| Non-inhibitor | 0.9775 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8144 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.5963 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7584 |
| CYP450 2D6 Substrate | Non-substrate | 0.9300 |
| CYP450 3A4 Substrate | Non-substrate | 0.7933 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.5201 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.8661 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9221 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.7415 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.9304 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.6194 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9193 |
| Non-inhibitor | 0.9246 | |
| AMES Toxicity | Non AMES toxic | 0.9337 |
| Carcinogens | Non-carcinogens | 0.5449 |
| Fish Toxicity | High FHMT | 0.7782 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9960 |
| Honey Bee Toxicity | High HBT | 0.6143 |
| Biodegradation | Not ready biodegradable | 0.8791 |
| Acute Oral Toxicity | III | 0.6085 |
| Carcinogenicity (Three-class) | Non-required | 0.5507 |
| Model | Value | Unit |
|---|---|---|
| Absorption | ||
| Aqueous solubility | -3.6461 | LogS |
| Caco-2 Permeability | 1.7566 | LogPapp, cm/s |
| Distribution | ||
| Metabolism | ||
| Excretion | ||
| Toxicity | ||
| Rat Acute Toxicity | 2.2125 | LD50, mol/kg |
| Fish Toxicity | 1.2320 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.7066 | pIGC50, ug/L |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Carrots | Australia | 0. 2mg/kg | |||
| Peanuts | Australia | 0.05mg/kg | |||
| Coffee Bean | Australia | 0.1mg/kg | |||
| Cacao Bean | Australia | 0.1mg/kg | |||
| Celeriac | Australia | 0.1mg/kg | |||
| Potato | Australia | 0.1mg/kg | |||
| Pecan | Australia | 0.05mg/kg | |||
| Celery | Australia | 1mg/kg |