Cyanophos
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Cyanophos(F05732) |
| 2D Structure | |
| FRCD ID | F05732 |
| CAS Number | 2636-26-2 |
| PubChem CID | 17522 |
| Formula | C9H10NO3PS |
| IUPAC Name | 4-dimethoxyphosphinothioyloxybenzonitrile |
| InChI Key | SCKHCCSZFPSHGR-UHFFFAOYSA-N |
| InChI | InChI=1S/C9H10NO3PS/c1-11-14(15,12-2)13-9-5-3-8(7-10)4-6-9/h3-6H,1-2H3 |
| Canonical SMILES | COP(=S)(OC)OC1=CC=C(C=C1)C#N |
| Isomeric SMILES | COP(=S)(OC)OC1=CC=C(C=C1)C#N |
| Synonyms |
Sumitomo S 4084
Phosphorothioic acid, O-(4-cyanophenyl) O,O-dimethyl ester
CYANOPHOS
Ciafos
Cyanox
2636-26-2
CYAP
Cynock
Bayer 34727
May & baker S-4084
|
| Classifies |
Pesticide
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Organic acids and derivatives |
| Class | Organic thiophosphoric acids and derivatives |
| Subclass | Thiophosphoric acid esters |
| Intermediate Tree Nodes | Aryl thiophosphates |
| Direct Parent | Phenyl thiophosphates |
| Alternative Parents | |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenyl thiophosphate - Phenoxy compound - Thiophosphate triester - Benzonitrile - Benzenoid - Monocyclic benzene moiety - Nitrile - Carbonitrile - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenyl thiophosphates. These are organothiophosphorus compounds that contain a thiophosphoric acid O-esterified with a phenyl group. |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 243.217 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 4 |
| Complexity | 285 |
| Monoisotopic Mass | 243.012 |
| Exact Mass | 243.012 |
| XLogP | 2.7 |
| Formal Charge | 0 |
| Heavy Atom Count | 15 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Guava | Japan | 0.2ppm | |||
| Pineapple | Japan | 0.2ppm | |||
| Mango | Japan | 0.2ppm | |||
| Chestnut | Japan | 0.2ppm | |||
| Sesame Seeds | Japan | 0.2ppm | |||
| Other Fruits | Japan | 0.2ppm | |||
| Date | Japan | 0.2ppm | |||
| Passion Fruit | Japan | 0.2ppm | |||
| Avocado | Japan | 0.2ppm | |||
| Papaya | Japan | 0.2ppm | |||
| Kiwifruit | Japan | 0.2ppm | |||
| Banana | Japan | 0.2ppm | |||
| Japanese Persimmon | Japan | 0.2ppm | |||
| Grape | Japan | 0.2ppm | |||
| Other Berries | Japan | 0.2ppm | |||
| Huckleberry | Japan | 0.2ppm | |||
| Cranberry | Japan | 0.2ppm | |||
| Blueberry | Japan | 0.2ppm | |||
| Blackberry | Japan | 0.2ppm | |||
| Raspberry | Japan | 0.2ppm |