Iprobenfos
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Iprobenfos(F05743) |
| 2D Structure | |
| FRCD ID | F05743 |
| CAS Number | 26087-47-8 |
| PubChem CID | 33294 |
| Formula | C13H21O3PS |
| IUPAC Name | di(propan-2-yloxy)phosphorylsulfanylmethylbenzene |
| InChI Key | FCOAHACKGGIURQ-UHFFFAOYSA-N |
| InChI | InChI=1S/C13H21O3PS/c1-11(2)15-17(14,16-12(3)4)18-10-13-8-6-5-7-9-13/h5-9,11-12H,10H2,1-4H3 |
| Canonical SMILES | CC(C)OP(=O)(OC(C)C)SCC1=CC=CC=C1 |
| Isomeric SMILES | CC(C)OP(=O)(OC(C)C)SCC1=CC=CC=C1 |
| Synonyms |
S-BENZYL O,O-DIISOPROPYL PHOSPHOROTHIOATE
Iprobenfos
Kitazin P
26087-47-8
Ricid II
Iprofenfos
Kitazin L
Ricid P
Iprobenfos [BSI:ISO]
O,O-Diisopropyl S-benzyl thiophosphate
|
| Classifies |
Pesticide
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzene and substituted derivatives |
| Alternative Parents | |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Monocyclic benzene moiety - Sulfenyl compound - Organothiophosphorus compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organosulfur compound - Organooxygen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as benzene and substituted derivatives. These are aromatic compounds containing one monocyclic ring system consisting of benzene. |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 288.342 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 7 |
| Complexity | 261 |
| Monoisotopic Mass | 288.095 |
| Exact Mass | 288.095 |
| XLogP | 3.2 |
| Formal Charge | 0 |
| Heavy Atom Count | 18 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9639 |
| Human Intestinal Absorption | HIA+ | 1.0000 |
| Caco-2 Permeability | Caco2+ | 0.5491 |
| P-glycoprotein Substrate | Non-substrate | 0.7793 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.6468 |
| Non-inhibitor | 0.9574 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8927 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.8506 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7652 |
| CYP450 2D6 Substrate | Non-substrate | 0.8021 |
| CYP450 3A4 Substrate | Non-substrate | 0.5343 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.7478 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.7112 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9262 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.6492 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.6747 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.5259 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.8792 |
| Non-inhibitor | 0.8906 | |
| AMES Toxicity | Non AMES toxic | 0.8845 |
| Carcinogens | Carcinogens | 0.6852 |
| Fish Toxicity | High FHMT | 0.8614 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9061 |
| Honey Bee Toxicity | High HBT | 0.9568 |
| Biodegradation | Not ready biodegradable | 0.7401 |
| Acute Oral Toxicity | III | 0.8172 |
| Carcinogenicity (Three-class) | Non-required | 0.6171 |
| Model | Value | Unit |
|---|---|---|
| Absorption | ||
| Aqueous solubility | -4.6538 | LogS |
| Caco-2 Permeability | 1.0773 | LogPapp, cm/s |
| Distribution | ||
| Metabolism | ||
| Excretion | ||
| Toxicity | ||
| Rat Acute Toxicity | 2.7516 | LD50, mol/kg |
| Fish Toxicity | 1.2025 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.1213 | pIGC50, ug/L |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Rice(Brown Rice) | Japan | 0.2ppm | |||
| Rice | Korea | 0.2ppm |