Dichlone
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Dichlone(F05760) |
| 2D Structure | |
| FRCD ID | F05760 |
| CAS Number | 117-80-6 |
| PubChem CID | 8342 |
| Formula | C10H4Cl2O2 |
| IUPAC Name | 2,3-dichloronaphthalene-1,4-dione |
| InChI Key | SVPKNMBRVBMTLB-UHFFFAOYSA-N |
| InChI | InChI=1S/C10H4Cl2O2/c11-7-8(12)10(14)6-4-2-1-3-5(6)9(7)13/h1-4H |
| Canonical SMILES | C1=CC=C2C(=C1)C(=O)C(=C(C2=O)Cl)Cl |
| Isomeric SMILES | C1=CC=C2C(=C1)C(=O)C(=C(C2=O)Cl)Cl |
| Synonyms |
2,3-Dichloro-1,4-naphthoquinone
117-80-6
DICHLONE
Diclone
2,3-dichloronaphthalene-1,4-dione
2,3-Dichloronaphthoquinone
Phygon
Algistat
Sanquinon
Uniroyal
|
| Classifies |
Pesticide
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Benzenoids |
| Class | Naphthalenes |
| Subclass | Naphthoquinones |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Naphthoquinones |
| Alternative Parents | |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | Naphthoquinone - Quinone - Aryl ketone - Alpha-haloketone - Alpha-chloroketone - Vinylogous halide - Ketone - Chloroalkene - Haloalkene - Vinyl halide - Vinyl chloride - Organic oxygen compound - Hydrocarbon derivative - Organooxygen compound - Organochloride - Organohalogen compound - Organic oxide - Aromatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as naphthoquinones. These are compounds containing a naphthohydroquinone moiety, which consists of a benzene ring linearly fused to a bezene-1,4-dione (quinone). |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 227.04 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Complexity | 301 |
| Monoisotopic Mass | 225.959 |
| Exact Mass | 225.959 |
| XLogP | 3.4 |
| Formal Charge | 0 |
| Heavy Atom Count | 14 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9369 |
| Human Intestinal Absorption | HIA+ | 1.0000 |
| Caco-2 Permeability | Caco2+ | 0.8107 |
| P-glycoprotein Substrate | Non-substrate | 0.6662 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.5789 |
| Non-inhibitor | 0.9568 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8167 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.7615 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7988 |
| CYP450 2D6 Substrate | Non-substrate | 0.9007 |
| CYP450 3A4 Substrate | Non-substrate | 0.5900 |
| CYP450 1A2 Inhibitor | Inhibitor | 0.9264 |
| CYP450 2C9 Inhibitor | Inhibitor | 0.8650 |
| CYP450 2D6 Inhibitor | Inhibitor | 0.5538 |
| CYP450 2C19 Inhibitor | Inhibitor | 0.8341 |
| CYP450 3A4 Inhibitor | Inhibitor | 0.5542 |
| CYP Inhibitory Promiscuity | High CYP Inhibitory Promiscuity | 0.7735 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.7714 |
| Non-inhibitor | 0.9257 | |
| AMES Toxicity | AMES toxic | 0.9107 |
| Carcinogens | Non-carcinogens | 0.8811 |
| Fish Toxicity | High FHMT | 0.9802 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9998 |
| Honey Bee Toxicity | High HBT | 0.7897 |
| Biodegradation | Not ready biodegradable | 0.9724 |
| Acute Oral Toxicity | II | 0.7318 |
| Carcinogenicity (Three-class) | Non-required | 0.5699 |
| Model | Value | Unit |
|---|---|---|
| Absorption | ||
| Aqueous solubility | -5.5170 | LogS |
| Caco-2 Permeability | 1.9956 | LogPapp, cm/s |
| Distribution | ||
| Metabolism | ||
| Excretion | ||
| Toxicity | ||
| Rat Acute Toxicity | 2.7041 | LD50, mol/kg |
| Fish Toxicity | -0.9167 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 2.2286 | pIGC50, ug/L |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Strawberry | Japan | 20ppm | |||
| Cherry | Japan | 3ppm | |||
| Japanese Plum(Including Prune) | Japan | 3ppm | |||
| Nectarine | Japan | 3ppm | |||
| Peach | Japan | 3ppm | |||
| Apple | Japan | 3ppm |