Bromophos-Ethyl
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Bromophos-Ethyl(F05768) | 
| 2D Structure | |
| FRCD ID | F05768 | 
| CAS Number | 4824-78-6 | 
| PubChem CID | 20965 | 
| Formula | C10H12BrCl2O3PS | 
| IUPAC Name | (4-bromo-2,5-dichlorophenoxy)-diethoxy-sulfanylidene-$l^{5}-phosphane  | 
| InChI Key | KWGUFOITWDSNQY-UHFFFAOYSA-N  | 
| InChI | InChI=1S/C10H12BrCl2O3PS/c1-3-14-17(18,15-4-2)16-10-6-8(12)7(11)5-9(10)13/h5-6H,3-4H2,1-2H3  | 
| Canonical SMILES | CCOP(=S)(OCC)OC1=CC(=C(C=C1Cl)Br)Cl  | 
| Isomeric SMILES | CCOP(=S)(OCC)OC1=CC(=C(C=C1Cl)Br)Cl  | 
| Synonyms | 
        
            BROMOPHOS-ETHYL
        
            Ethyl bromophos
        
            Filariol
        
            4824-78-6
        
            Bromofos-ethyl
        
            Nexagan G
        
            Caswell No. 114D
        
            UNII-CVT4KYL79N
        
            Cela S 2225
        
            Enkt 27258
         | 
| Classifies | 
                
                  
                    Pesticide
                  
                
         | 
| Update Date | Nov 13, 2018 17:07 | 
Chemical Taxonomy
| Kingdom | Organic compounds | 
| Superclass | Organic acids and derivatives | 
| Class | Organic thiophosphoric acids and derivatives | 
| Subclass | Thiophosphoric acid esters | 
| Intermediate Tree Nodes | Aryl thiophosphates | 
| Direct Parent | Phenyl thiophosphates | 
| Alternative Parents | |
| Molecular Framework | Aromatic homomonocyclic compounds | 
| Substituents | Phenyl thiophosphate - Phenoxy compound - 1,4-dichlorobenzene - Thiophosphate triester - Bromobenzene - Chlorobenzene - Halobenzene - Aryl bromide - Aryl chloride - Aryl halide - Monocyclic benzene moiety - Benzenoid - Hydrocarbon derivative - Organic oxygen compound - Organooxygen compound - Organohalogen compound - Organobromide - Organochloride - Aromatic homomonocyclic compound | 
| Description | This compound belongs to the class of organic compounds known as phenyl thiophosphates. These are organothiophosphorus compounds that contain a thiophosphoric acid O-esterified with a phenyl group. | 
Properties
| Property Name | Property Value | 
|---|---|
| Molecular Weight | 394.041 | 
| Hydrogen Bond Donor Count | 0 | 
| Hydrogen Bond Acceptor Count | 4 | 
| Rotatable Bond Count | 6 | 
| Complexity | 301 | 
| Monoisotopic Mass | 391.881 | 
| Exact Mass | 391.881 | 
| XLogP | 6.1 | 
| Formal Charge | 0 | 
| Heavy Atom Count | 18 | 
| Defined Atom Stereocenter Count | 0 | 
| Undefined Atom Stereocenter Count | 0 | 
| Defined Bond Stereocenter Count | 0 | 
| Undefined Bond Stereocenter Count | 0 | 
| Isotope Atom Count | 0 | 
| Covalently-Bonded Unit Count | 1 | 
ADMET
| Model | Result | Probability | 
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9299 | 
| Human Intestinal Absorption | HIA+ | 1.0000 | 
| Caco-2 Permeability | Caco2+ | 0.5000 | 
| P-glycoprotein Substrate | Non-substrate | 0.7762 | 
| P-glycoprotein Inhibitor | Inhibitor | 0.5775 | 
| Non-inhibitor | 0.9702 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8529 | 
| Distribution | ||
| Subcellular localization | Mitochondria | 0.7665 | 
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7931 | 
| CYP450 2D6 Substrate | Non-substrate | 0.6165 | 
| CYP450 3A4 Substrate | Substrate | 0.5363 | 
| CYP450 1A2 Inhibitor | Inhibitor | 0.6018 | 
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.5936 | 
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8978 | 
| CYP450 2C19 Inhibitor | Inhibitor | 0.5437 | 
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.5148 | 
| CYP Inhibitory Promiscuity | High CYP Inhibitory Promiscuity | 0.7104 | 
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.5820 | 
| Non-inhibitor | 0.7896 | |
| AMES Toxicity | Non AMES toxic | 0.8901 | 
| Carcinogens | Carcinogens | 0.5475 | 
| Fish Toxicity | High FHMT | 0.9864 | 
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9958 | 
| Honey Bee Toxicity | High HBT | 0.9402 | 
| Biodegradation | Not ready biodegradable | 0.9843 | 
| Acute Oral Toxicity | II | 0.7618 | 
| Carcinogenicity (Three-class) | Non-required | 0.6457 | 
| Model | Value | Unit | 
|---|---|---|
| Absorption | ||
| Aqueous solubility | -5.8472 | LogS | 
| Caco-2 Permeability | 1.0285 | LogPapp, cm/s | 
| Distribution | ||
| Metabolism | ||
| Excretion | ||
| Toxicity | ||
| Rat Acute Toxicity | 3.8026 | LD50, mol/kg | 
| Fish Toxicity | 1.1096 | pLC50, mg/L | 
| Tetrahymena Pyriformis Toxicity | 0.8685 | pIGC50, ug/L | 
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes | 
|---|---|---|---|---|---|
| Quinces (Chinese quinces, Japanese quinces,) | 0130030 | European Union | 0.01* | 30/12/2015 | |
| Cherries (sweet) (Black cherries, Capulins, Chokecherries, Cornelian cherries/European corniols, Nanking cherries, Sour cherries/morello cherries,) | 0140020 | European Union | 0.01* | 30/12/2015 | |
| Blueberries (Aronia berries/chokeberries (black, purple and red), Aronia berries/chokeberries (black, purple and red), Aronia berries/chokeberries (black, purple and red), Bearberries, Bilberries/E... | 0154010 | European Union | 0.01* | 30/12/2015 | |
| American persimmons/Virginia kaki (Black sapotes, Green sapotes, White sapotes, Yellow sapotes/canistels,) | 0162060 | European Union | 0.01* | 30/12/2015 | |
| Bananas (Cavendishes/grand nains, Cavendishes/grand nains, Cavendishes/grand nains, Dwarf bananas/lady fingers bananas, Plantains, Plantains, Plantains,) | 0163020 | European Union | 0.01* | 30/12/2015 | |
| Linseeds | 0401010 | European Union | 0.02* | 30/12/2015 | |
| (b) head brassica | 0242000 | European Union | 0.01* | 30/12/2015 | |
| Citrus fruits | 0110000 | European Union | 0.01* | 30/12/2015 | |
| Grapefruits (Natsudaidais, Shaddocks/pomelos, Sweeties/oroblancos, Tangelolos, Tangelos (except minneolas)/Ugli®, Other hybrids of Citrus paradisi, not elsewhere mentioned,) | 0110010 | European Union | 0.01* | 30/12/2015 | |
| Oranges (Bergamots, Bitter oranges/sour oranges, Blood oranges, Cara caras, Chinottos, Trifoliate oranges, Other hybrids of Citrus sinensis, not elsewhere mentioned,) | 0110020 | European Union | 0.01* | 30/12/2015 | |
| Lemons (Buddha's hands/Buddha's fingers, Citrons,) | 0110030 | European Union | 0.01* | 30/12/2015 | |
| Limes (Indian sweet limes/Palestine sweet limes, Kaffir limes, Sweet limes/mosambis, Tahiti limes, Limequats,) | 0110040 | European Union | 0.01* | 30/12/2015 | |
| Mandarins (Calamondins, Clementines, Cleopatra mandarins, Minneolas, Satsumas/clausellinas, Tangerines/dancy mandarins, Tangors, Other hybrids of Citrus reticulata, not elsewhere mentioned,) | 0110050 | European Union | 0.01* | 30/12/2015 | |
| Others (2) | 0110990 | European Union | 0.01* | 30/12/2015 | |
| Tree nuts | 0120000 | European Union | 0.02* | 30/12/2015 | |
| Almonds (Apricot kernels, Bitter almonds, Canarium nuts/galip nuts, Pili nuts, Okari nuts,) | 0120010 | European Union | 0.02* | 30/12/2015 | |
| Brazil nuts | 0120020 | European Union | 0.02* | 30/12/2015 | |
| Cashew nuts | 0120030 | European Union | 0.02* | 30/12/2015 | |
| Chestnuts | 0120040 | European Union | 0.02* | 30/12/2015 | |
| Coconuts (Areca nuts/betel nuts,) | 0120050 | European Union | 0.02* | 30/12/2015 |