Didecyldimethylammonium Chloride
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Didecyldimethylammonium Chloride(F05821) |
| 2D Structure | |
| FRCD ID | F05821 |
| CAS Number | 7173-51-5 |
| PubChem CID | 23558 |
| Formula | C22H48ClN |
| IUPAC Name | didecyl(dimethyl)azanium;chloride |
| InChI Key | RUPBZQFQVRMKDG-UHFFFAOYSA-M |
| InChI | InChI=1S/C22H48N.ClH/c1-5-7-9-11-13-15-17-19-21-23(3,4)22-20-18-16-14-12-10-8-6-2;/h5-22H2,1-4H3;1H/q+1;/p-1 |
| Canonical SMILES | CCCCCCCCCC[N+](C)(C)CCCCCCCCCC.[Cl-] |
| Isomeric SMILES | CCCCCCCCCC[N+](C)(C)CCCCCCCCCC.[Cl-] |
| Synonyms |
Didecyl dimethyl ammonium chloride
7173-51-5
Didecyldimethylammonium chloride
Astop
Quaternium 12
Arquad 10
Bardac 22
DDAC
N-decyl-N,N-dimethyldecan-1-aminium chloride
Britewood Q
|
| Classifies |
Pesticide
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Organic nitrogen compounds |
| Class | Organonitrogen compounds |
| Subclass | Quaternary ammonium salts |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Tetraalkylammonium salts |
| Alternative Parents | |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Tetraalkylammonium salt - Organopnictogen compound - Hydrocarbon derivative - Organic chloride salt - Organic salt - Amine - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as tetraalkylammonium salts. These are organonitrogen compounds containing a quaternary ammonium substituted with four alkyl chains. |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 362.083 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 18 |
| Complexity | 200 |
| Monoisotopic Mass | 361.348 |
| Exact Mass | 361.348 |
| Formal Charge | 0 |
| Heavy Atom Count | 24 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 2 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Chamomile | 0631010 | European Union | 0.1 | 12/11/2014 | |
| FRUITS, FRESH or FROZEN; TREE NUTS | 0100000 | European Union | 0.1 | 12/11/2014 | |
| Citrus fruits | 0110000 | European Union | 0.1 | 12/11/2014 | |
| Grapefruits (Natsudaidais, Shaddocks/pomelos, Sweeties/oroblancos, Tangelolos, Tangelos (except minneolas)/Ugli®, Other hybrids of Citrus paradisi, not elsewhere mentioned,) | 0110010 | European Union | 0.1 | 12/11/2014 | |
| Roman rocket/rucola (Wall rocket,) | 0251060 | European Union | 0.1 | 12/11/2014 | |
| Lemons (Buddha's hands/Buddha's fingers, Citrons,) | 0110030 | European Union | 0.1 | 12/11/2014 | |
| Limes (Indian sweet limes/Palestine sweet limes, Kaffir limes, Sweet limes/mosambis, Tahiti limes, Limequats,) | 0110040 | European Union | 0.1 | 12/11/2014 | |
| Mandarins (Calamondins, Clementines, Cleopatra mandarins, Minneolas, Satsumas/clausellinas, Tangerines/dancy mandarins, Tangors, Other hybrids of Citrus reticulata, not elsewhere mentioned,) | 0110050 | European Union | 0.1 | 12/11/2014 | |
| Others (2) | 0110990 | European Union | 0.1 | 12/11/2014 | |
| Tree nuts | 0120000 | European Union | 0.1 | 12/11/2014 | |
| Almonds (Apricot kernels, Bitter almonds, Canarium nuts/galip nuts, Pili nuts, Okari nuts,) | 0120010 | European Union | 0.1 | 12/11/2014 | |
| Brazil nuts | 0120020 | European Union | 0.1 | 12/11/2014 | |
| Cashew nuts | 0120030 | European Union | 0.1 | 12/11/2014 | |
| Chestnuts | 0120040 | European Union | 0.1 | 12/11/2014 | |
| Coconuts (Areca nuts/betel nuts,) | 0120050 | European Union | 0.1 | 12/11/2014 | |
| Hazelnuts/cobnuts (Acorns, Filberts,) | 0120060 | European Union | 0.1 | 12/11/2014 | |
| Macadamias | 0120070 | European Union | 0.1 | 12/11/2014 | |
| Pecans (Hickory nuts,) | 0120080 | European Union | 0.1 | 12/11/2014 | |
| Pistachios | 0120100 | European Union | 0.1 | 12/11/2014 | |
| Walnuts | 0120110 | European Union | 0.1 | 12/11/2014 |
References
| Title | Journal | Date | Pubmed ID |
|---|---|---|---|
| Susceptibility to disinfectants in antimicrobial-resistant and -susceptibleisolates of Escherichia coli, Enterococcus faecalis and Enterococcus faecium frompoultry-ESBL/AmpC-phenotype of E. coli is not associated with resistance to aquaternary ammonium compound, DDAC. | J Appl Microbiol | 2017 Jun | 28261951 |
| Reduced susceptibilities to biocides and resistance to antibiotics infood-associated bacteria following exposure to quaternary ammonium compounds. | J Appl Microbiol | 2016 Nov | 27481186 |
| Insusceptibility to disinfectants in bacteria from animals, food and humans-isthere a link to antimicrobial resistance? | Front Microbiol | 2014 Mar 18 | 24672513 |
| First detection of the antiseptic resistance gene qacA/B in Enterococcusfaecalis. | Microb Drug Resist | 2012 Feb | 22017402 |
| Synergistic bactericidal effects of a sublethal concentration ofdidecyldimethylammonium chloride (DDAC) and low concentrations of nonionicsurfactants against Staphylococcus aureus. | Biocontrol Sci | 2012 | 23269219 |
| Intrinsic and acquired resistance to quaternary ammonium compounds infood-related Pseudomonas spp. | J Appl Microbiol | 2003 | 12969304 |