Orysastrobin
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Orysastrobin(F05837) |
| 2D Structure | |
| FRCD ID | F05837 |
| CAS Number | 248593-16-0 |
| PubChem CID | 11486133 |
| Formula | C18H25N5O5 |
| IUPAC Name | (2E)-2-[2-[[(E)-[(3E,4E)-3,4-bis(methoxyimino)pentan-2-ylidene]amino]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide |
| InChI Key | JHIPUJPTQJYEQK-ZLHHXESBSA-N |
| InChI | InChI=1S/C18H25N5O5/c1-12(20-25-4)16(22-26-5)13(2)21-28-11-14-9-7-8-10-15(14)17(23-27-6)18(24)19-3/h7-10H,11H2,1-6H3,(H,19,24)/b20-12+,21-13+,22-16+,23-17+ |
| Canonical SMILES | CC(=NOC)C(=NOC)C(=NOCC1=CC=CC=C1C(=NOC)C(=O)NC)C |
| Isomeric SMILES | C/C(=N\OC)/C(=N\OC)/C(=N/OCC1=CC=CC=C1/C(=N\OC)/C(=O)NC)/C |
| Synonyms |
UU1TM1224D
C18560
Orysastrobin
UNII-UU1TM1224D
248593-16-0
Orysastrobin [ISO]
SCHEMBL18688
DTXSID3058036
CHEBI:81832
AKOS027257417
|
| Classifies |
Pesticide
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzene and substituted derivatives |
| Alternative Parents | |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Monocyclic benzene moiety - Oxime ether - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Carboximidic acid derivative - Carboximidic acid - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as benzene and substituted derivatives. These are aromatic compounds containing one monocyclic ring system consisting of benzene. |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 391.428 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 9 |
| Rotatable Bond Count | 10 |
| Complexity | 630 |
| Monoisotopic Mass | 391.186 |
| Exact Mass | 391.186 |
| XLogP | 2.5 |
| Formal Charge | 0 |
| Heavy Atom Count | 28 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 4 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.8688 |
| Human Intestinal Absorption | HIA+ | 0.9802 |
| Caco-2 Permeability | Caco2+ | 0.5084 |
| P-glycoprotein Substrate | Non-substrate | 0.6860 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8084 |
| Non-inhibitor | 0.8378 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8097 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.8260 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7652 |
| CYP450 2D6 Substrate | Non-substrate | 0.8093 |
| CYP450 3A4 Substrate | Substrate | 0.5312 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.6590 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.7156 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8869 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.5209 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.7851 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.8240 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9890 |
| Non-inhibitor | 0.9414 | |
| AMES Toxicity | AMES toxic | 0.5226 |
| Carcinogens | Non-carcinogens | 0.5208 |
| Fish Toxicity | Low FHMT | 0.6279 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9488 |
| Honey Bee Toxicity | Low HBT | 0.6709 |
| Biodegradation | Not ready biodegradable | 0.9701 |
| Acute Oral Toxicity | III | 0.6299 |
| Carcinogenicity (Three-class) | Non-required | 0.6432 |
| Model | Value | Unit |
|---|---|---|
| Absorption | ||
| Aqueous solubility | -2.3865 | LogS |
| Caco-2 Permeability | 1.3304 | LogPapp, cm/s |
| Distribution | ||
| Metabolism | ||
| Excretion | ||
| Toxicity | ||
| Rat Acute Toxicity | 2.6093 | LD50, mol/kg |
| Fish Toxicity | 1.1925 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.5571 | pIGC50, ug/L |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Rice(Brown Rice) | Japan | 0.2ppm |