Iprovalicarb
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Iprovalicarb(F05859) | 
| 2D Structure | |
| FRCD ID | F05859 | 
| CAS Number | 140923-17-7 | 
| PubChem CID | 10958189 | 
| Formula | C18H28N2O3 | 
| IUPAC Name | propan-2-yl N-[(2S)-3-methyl-1-[1-(4-methylphenyl)ethylamino]-1-oxobutan-2-yl]carbamate  | 
| InChI Key | NWUWYYSKZYIQAE-WMCAAGNKSA-N  | 
| InChI | InChI=1S/C18H28N2O3/c1-11(2)16(20-18(22)23-12(3)4)17(21)19-14(6)15-9-7-13(5)8-10-15/h7-12,14,16H,1-6H3,(H,19,21)(H,20,22)/t14?,16-/m0/s1  | 
| Canonical SMILES | CC1=CC=C(C=C1)C(C)NC(=O)C(C(C)C)NC(=O)OC(C)C  | 
| Isomeric SMILES | CC1=CC=C(C=C1)C(C)NC(=O)[C@H](C(C)C)NC(=O)OC(C)C  | 
| Synonyms | 
        
            propan-2-yl N-[(2S)-3-methyl-1-[1-(4-methylphenyl)ethylamino]-1-oxobutan-2-yl]carbamate
        
            Iprovalicarb
        
            140923-17-7
        
            Fencaramid
        
            SZX 0722
        
            Melody
        
            CHEBI:82023
        
            Iprovalicarb [ISO:BSI]
        
            Nanogen code IPV, NIUS
        
            Carbamic acid, (1S)-2-methyl-1-1-(4-methylphenyl)ethylaminocarbonylpropyl-, 1-methylethyl ester
         | 
| Classifies | 
                
                  
                    Pesticide
                  
                
         | 
| Update Date | Nov 13, 2018 17:07 | 
Chemical Taxonomy
| Kingdom | Organic compounds | 
| Superclass | Benzenoids | 
| Class | Benzene and substituted derivatives | 
| Subclass | Toluenes | 
| Intermediate Tree Nodes | Not available | 
| Direct Parent | Toluenes | 
| Alternative Parents | |
| Molecular Framework | Aromatic homomonocyclic compounds | 
| Substituents | Toluene - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Carboximidic acid derivative - Carboximidic acid - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Aromatic homomonocyclic compound | 
| Description | This compound belongs to the class of organic compounds known as toluenes. These are compounds containing a benzene ring which bears a methane group. | 
Properties
| Property Name | Property Value | 
|---|---|
| Molecular Weight | 320.433 | 
| Hydrogen Bond Donor Count | 2 | 
| Hydrogen Bond Acceptor Count | 3 | 
| Rotatable Bond Count | 7 | 
| Complexity | 388 | 
| Monoisotopic Mass | 320.21 | 
| Exact Mass | 320.21 | 
| XLogP | 3.7 | 
| Formal Charge | 0 | 
| Heavy Atom Count | 23 | 
| Defined Atom Stereocenter Count | 1 | 
| Undefined Atom Stereocenter Count | 1 | 
| Defined Bond Stereocenter Count | 0 | 
| Undefined Bond Stereocenter Count | 0 | 
| Isotope Atom Count | 0 | 
| Covalently-Bonded Unit Count | 1 | 
ADMET
| Model | Result | Probability | 
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.8428 | 
| Human Intestinal Absorption | HIA+ | 0.9878 | 
| Caco-2 Permeability | Caco2- | 0.5369 | 
| P-glycoprotein Substrate | Non-substrate | 0.6228 | 
| P-glycoprotein Inhibitor | Non-inhibitor | 0.6858 | 
| Non-inhibitor | 0.9346 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9671 | 
| Distribution | ||
| Subcellular localization | Mitochondria | 0.8747 | 
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8254 | 
| CYP450 2D6 Substrate | Non-substrate | 0.8059 | 
| CYP450 3A4 Substrate | Non-substrate | 0.6010 | 
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.7799 | 
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.7837 | 
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9515 | 
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.8303 | 
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.7254 | 
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.7544 | 
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9891 | 
| Non-inhibitor | 0.9678 | |
| AMES Toxicity | Non AMES toxic | 0.8244 | 
| Carcinogens | Non-carcinogens | 0.7029 | 
| Fish Toxicity | High FHMT | 0.9296 | 
| Tetrahymena Pyriformis Toxicity | High TPT | 0.8041 | 
| Honey Bee Toxicity | Low HBT | 0.5000 | 
| Biodegradation | Not ready biodegradable | 0.8737 | 
| Acute Oral Toxicity | III | 0.6875 | 
| Carcinogenicity (Three-class) | Non-required | 0.7016 | 
| Model | Value | Unit | 
|---|---|---|
| Absorption | ||
| Aqueous solubility | -2.8168 | LogS | 
| Caco-2 Permeability | 1.1731 | LogPapp, cm/s | 
| Distribution | ||
| Metabolism | ||
| Excretion | ||
| Toxicity | ||
| Rat Acute Toxicity | 2.3435 | LD50, mol/kg | 
| Fish Toxicity | 1.3288 | pLC50, mg/L | 
| Tetrahymena Pyriformis Toxicity | -0.2064 | pIGC50, ug/L | 
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes | 
|---|---|---|---|---|---|
| Citrus fruits | 0110000 | European Union | 0.01* | 06/03/2014 | |
| Grapefruits (Natsudaidais, Shaddocks/pomelos, Sweeties/oroblancos, Tangelolos, Tangelos (except minneolas)/Ugli®, Other hybrids of Citrus paradisi, not elsewhere mentioned,) | 0110010 | European Union | 0.01* | 06/03/2014 | |
| Oranges (Bergamots, Bitter oranges/sour oranges, Blood oranges, Cara caras, Chinottos, Trifoliate oranges, Other hybrids of Citrus sinensis, not elsewhere mentioned,) | 0110020 | European Union | 0.01* | 06/03/2014 | |
| Lemons (Buddha's hands/Buddha's fingers, Citrons,) | 0110030 | European Union | 0.01* | 06/03/2014 | |
| Limes (Indian sweet limes/Palestine sweet limes, Kaffir limes, Sweet limes/mosambis, Tahiti limes, Limequats,) | 0110040 | European Union | 0.01* | 06/03/2014 | |
| Mandarins (Calamondins, Clementines, Cleopatra mandarins, Minneolas, Satsumas/clausellinas, Tangerines/dancy mandarins, Tangors, Other hybrids of Citrus reticulata, not elsewhere mentioned,) | 0110050 | European Union | 0.01* | 06/03/2014 | |
| Others (2) | 0110990 | European Union | 0.01* | 06/03/2014 | |
| Tree nuts | 0120000 | European Union | 0.02* | 06/03/2014 | |
| Almonds (Apricot kernels, Bitter almonds, Canarium nuts/galip nuts, Pili nuts, Okari nuts,) | 0120010 | European Union | 0.02* | 06/03/2014 | |
| Brazil nuts | 0120020 | European Union | 0.02* | 06/03/2014 | |
| Cashew nuts | 0120030 | European Union | 0.02* | 06/03/2014 | |
| Chestnuts | 0120040 | European Union | 0.02* | 06/03/2014 | |
| Coconuts (Areca nuts/betel nuts,) | 0120050 | European Union | 0.02* | 06/03/2014 | |
| Hazelnuts/cobnuts (Acorns, Filberts,) | 0120060 | European Union | 0.02* | 06/03/2014 | |
| Macadamias | 0120070 | European Union | 0.02* | 06/03/2014 | |
| Pecans (Hickory nuts,) | 0120080 | European Union | 0.02* | 06/03/2014 | |
| Pistachios | 0120100 | European Union | 0.02* | 06/03/2014 | |
| Walnuts | 0120110 | European Union | 0.02* | 06/03/2014 | |
| Others (2) | 0120990 | European Union | 0.02* | 06/03/2014 | |
| Pome fruits | 0130000 | European Union | 0.01* | 06/03/2014 |