Difenzoquat
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Difenzoquat(F05887) |
| 2D Structure | |
| FRCD ID | F05887 |
| CAS Number | 49866-87-7 |
| PubChem CID | 39425 |
| Formula | C17H17N2+ |
| IUPAC Name | 1,2-dimethyl-3,5-diphenylpyrazol-1-ium |
| InChI Key | LBGPXIPGGRQBJW-UHFFFAOYSA-N |
| InChI | InChI=1S/C17H17N2/c1-18-16(14-9-5-3-6-10-14)13-17(19(18)2)15-11-7-4-8-12-15/h3-13H,1-2H3/q+1 |
| Canonical SMILES | CN1C(=CC(=[N+]1C)C2=CC=CC=C2)C3=CC=CC=C3 |
| Isomeric SMILES | CN1C(=CC(=[N+]1C)C2=CC=CC=C2)C3=CC=CC=C3 |
| Synonyms |
1H-Pyrazolium, (1,2-dimethyl-3,5-diphenyl)-
DIFENZOQUAT
49866-87-7
UNII-54NE792QN5
Difenzoquat [ANSI:BSI:ISO]
1H-Pyrazolium, 1,2-dimethyl-3,5-diphenyl-
EINECS 256-505-3
1,2-Dimethyl-3,5-diphenylpyrazolium ion
CHEBI:81910
54NE792QN5
|
| Classifies |
Pesticide
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Organoheterocyclic compounds |
| Class | Azoles |
| Subclass | Pyrazoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylpyrazoles |
| Alternative Parents | |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Phenylpyrazole - Benzenoid - Monocyclic benzene moiety - Heteroaromatic compound - Azacycle - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organonitrogen compound - Organic cation - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenylpyrazoles. These are compounds containing a phenylpyrazole skeleton, which consists of a pyrazole bound to a phenyl group. |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 249.337 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 2 |
| Complexity | 251 |
| Monoisotopic Mass | 249.139 |
| Exact Mass | 249.139 |
| XLogP | 4.3 |
| Formal Charge | 1 |
| Heavy Atom Count | 19 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Other Terrestrial Mammals,Edible Offal | Japan | 0.05ppm | |||
| Other Nuts | Japan | 0.05ppm | |||
| Lettuce(Including Cos Lettuce And Leaf Lettuce) | Japan | 0.05ppm | |||
| Turnip,Leaves | Japan | 0.05ppm | |||
| Other Poultry Animals,Edible Offal | Japan | 0.05ppm | |||
| Chicken,Edible Offal | Japan | 0.05ppm | |||
| Other Poultry Animals,Kidney | Japan | 0.05ppm | |||
| Chicken,Kidney | Japan | 0.05ppm | |||
| Other Poultry Animals,Liver | Japan | 0.05ppm | |||
| Chicken,Liver | Japan | 0.05ppm | |||
| Other Poultry Animals,Fat | Japan | 0.05ppm | |||
| Chicken,Fat | Japan | 0.05ppm | |||
| Other Poultry Animals,Muscle | Japan | 0.05ppm | |||
| Chicken,Muscle | Japan | 0.05ppm | |||
| Pig,Edible Offal | Japan | 0.05ppm | |||
| Cattle,Edible Offal | Japan | 0.05ppm | |||
| Other Terrestrial Mammals,Kidney | Japan | 0.05ppm | |||
| Pig,Kidney | Japan | 0.05ppm | |||
| Cattle,Kidney | Japan | 0.05ppm | |||
| Other Terrestrial Mammals,Liver | Japan | 0.05ppm |