Chlorfenvinphos
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Chlorfenvinphos(F05899) |
| 2D Structure | |
| FRCD ID | F05899 |
| CAS Number | |
| PubChem CID | 5377784 |
| Formula | C12H14Cl3O4P |
| IUPAC Name | [(Z)-2-chloro-1-(2,4-dichlorophenyl)ethenyl] diethyl phosphate |
| InChI Key | FSAVDKDHPDSCTO-WQLSENKSSA-N |
| InChI | InChI=1S/C12H14Cl3O4P/c1-3-17-20(16,18-4-2)19-12(8-13)10-6-5-9(14)7-11(10)15/h5-8H,3-4H2,1-2H3/b12-8- |
| Canonical SMILES | CCOP(=O)(OCC)OC(=CCl)C1=C(C=C(C=C1)Cl)Cl |
| Isomeric SMILES | CCOP(=O)(OCC)O/C(=C\Cl)/C1=C(C=C(C=C1)Cl)Cl |
| Synonyms |
Chlorfenvinphos
Chlorphenvinphos
Clofenvinfos
cis-Chlorfenvinphos
Clorfenvinfos
Enolofos
Haptarax
Haptasol
Sapecron
Tarene
|
| Classifies |
Pollutant
Pesticide
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Halobenzenes |
| Intermediate Tree Nodes | Chlorobenzenes |
| Direct Parent | Dichlorobenzenes |
| Alternative Parents | |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | 1,3-dichlorobenzene - Styrene - Dialkyl phosphate - Alkyl phosphate - Phosphoric acid ester - Organic phosphoric acid derivative - Aryl halide - Aryl chloride - Chloroalkene - Haloalkene - Vinyl halide - Vinyl chloride - Organic oxide - Organooxygen compound - Organochloride - Organohalogen compound - Organic oxygen compound - Hydrocarbon derivative - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as dichlorobenzenes. These are compounds containing a benzene with exactly two chlorine atoms attached to it. |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 359.564 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 7 |
| Complexity | 368 |
| Monoisotopic Mass | 357.97 |
| Exact Mass | 357.97 |
| XLogP | 3.1 |
| Formal Charge | 0 |
| Heavy Atom Count | 20 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 1 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9412 |
| Human Intestinal Absorption | HIA+ | 0.9937 |
| Caco-2 Permeability | Caco2+ | 0.5352 |
| P-glycoprotein Substrate | Non-substrate | 0.6659 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.5362 |
| Non-inhibitor | 0.9121 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8602 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.8810 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8663 |
| CYP450 2D6 Substrate | Non-substrate | 0.7937 |
| CYP450 3A4 Substrate | Substrate | 0.5301 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.5697 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.6738 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8983 |
| CYP450 2C19 Inhibitor | Inhibitor | 0.5295 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8579 |
| CYP Inhibitory Promiscuity | High CYP Inhibitory Promiscuity | 0.7090 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.5000 |
| Non-inhibitor | 0.8348 | |
| AMES Toxicity | Non AMES toxic | 0.7574 |
| Carcinogens | Carcinogens | 0.5961 |
| Fish Toxicity | High FHMT | 0.9668 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9998 |
| Honey Bee Toxicity | High HBT | 0.8770 |
| Biodegradation | Not ready biodegradable | 0.8957 |
| Acute Oral Toxicity | I | 0.7886 |
| Carcinogenicity (Three-class) | Non-required | 0.5721 |
| Model | Value | Unit |
|---|---|---|
| Absorption | ||
| Aqueous solubility | -4.5694 | LogS |
| Caco-2 Permeability | 0.8146 | LogPapp, cm/s |
| Distribution | ||
| Metabolism | ||
| Excretion | ||
| Toxicity | ||
| Rat Acute Toxicity | 4.0432 | LD50, mol/kg |
| Fish Toxicity | 0.8117 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 1.0371 | pIGC50, ug/L |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Blueberries (Aronia berries/chokeberries (black, purple and red), Aronia berries/chokeberries (black, purple and red), Aronia berries/chokeberries (black, purple and red), Bearberries, Bilberries/E... | 0154010 | European Union | 0.01* | 06/06/2014 | |
| Durians | 0163100 | European Union | 0.01* | 06/06/2014 | |
| Cassava roots/manioc (Blue taros/blue tannias, Canna, Chayotes/christophines roots, Dasheen taros, Eddoe taros, Konjac roots, Tannias/arrowleaf elephant ears/tajer,) | 0212010 | European Union | 0.01* | 06/06/2014 | |
| (b) head brassica | 0242000 | European Union | 0.01* | 06/06/2014 | |
| Head cabbages (Pointed head cabbages, Red cabbages, Savoy cabbages, White cabbage,) | 0242020 | European Union | 0.01* | 06/06/2014 | |
| Cresses and other sprouts and shoots (Alfalfa/lucerne sprouts, Chinese chives/oriental garlic/garlic chives sprouts, Broccoli sprouts, Daikon/Japanese radish sprouts, Ginger shoots, Mung bean sprou... | 0251040 | European Union | 0.01* | 06/06/2014 | |
| Beans (with pods) (Azuki beans, Black eyed peas/cowpeas, Broad beans/fava beans/horse beans/tic beans, Borlotti beans/cannelini beans/common beans/flageolets/French beans/slicing beans/snap beans, ... | 0260010 | European Union | 0.01* | 06/06/2014 | |
| Cultivated fungi (Common mushrooms/button mushrooms/champignons mushrooms, Corn smuts/ Mexican truffles, Enokitake/winter mushrooms, Fusarium venenatum, Horse mushrooms, Jew's ears/hirneola, Nameko... | 0280010 | European Union | 0.01* | 06/06/2014 | |
| Olives for oil production | 0402010 | European Union | 0.02* | 06/06/2014 | |
| Oil palms kernels (Argan nuts, Babassu palm nuts, Jojoba nuts, Shea nuts,) | 0402020 | European Union | 0.02* | 06/06/2014 | |
| Rose (Almond, Bee balm, Bitter orange/sour orange, Black locust, Cat’s foot, Chrysanthemum, Cinnamon, Clary sage, Cornflower, Cowslip/primrose, Daisy, Dyer’s broom, Elder, Field poppy, Great mullei... | 0631030 | European Union | 0.05* | 06/06/2014 | |
| Konjac | Japan | 0.5ppm | |||
| Citrus fruits | 0110000 | European Union | 0.01* | 06/06/2014 | |
| Grapefruits (Natsudaidais, Shaddocks/pomelos, Sweeties/oroblancos, Tangelolos, Tangelos (except minneolas)/Ugli®, Other hybrids of Citrus paradisi, not elsewhere mentioned,) | 0110010 | European Union | 0.01* | 06/06/2014 | |
| Oranges (Bergamots, Bitter oranges/sour oranges, Blood oranges, Cara caras, Chinottos, Trifoliate oranges, Other hybrids of Citrus sinensis, not elsewhere mentioned,) | 0110020 | European Union | 0.01* | 06/06/2014 | |
| Lemons (Buddha's hands/Buddha's fingers, Citrons,) | 0110030 | European Union | 0.01* | 06/06/2014 | |
| Limes (Indian sweet limes/Palestine sweet limes, Kaffir limes, Sweet limes/mosambis, Tahiti limes, Limequats,) | 0110040 | European Union | 0.01* | 06/06/2014 | |
| Mandarins (Calamondins, Clementines, Cleopatra mandarins, Minneolas, Satsumas/clausellinas, Tangerines/dancy mandarins, Tangors, Other hybrids of Citrus reticulata, not elsewhere mentioned,) | 0110050 | European Union | 0.01* | 06/06/2014 | |
| Others (2) | 0110990 | European Union | 0.01* | 06/06/2014 | |
| Tree nuts | 0120000 | European Union | 0.02* | 06/06/2014 |