Bupirimate
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Bupirimate(F05916) |
| 2D Structure | |
| FRCD ID | F05916 |
| CAS Number | 41483-43-6 |
| PubChem CID | 38884 |
| Formula | C13H24N4O3S |
| IUPAC Name | [5-butyl-2-(ethylamino)-6-methylpyrimidin-4-yl] N,N-dimethylsulfamate |
| InChI Key | DSKJPMWIHSOYEA-UHFFFAOYSA-N |
| InChI | InChI=1S/C13H24N4O3S/c1-6-8-9-11-10(3)15-13(14-7-2)16-12(11)20-21(18,19)17(4)5/h6-9H2,1-5H3,(H,14,15,16) |
| Canonical SMILES | CCCCC1=C(N=C(N=C1OS(=O)(=O)N(C)C)NCC)C |
| Isomeric SMILES | CCCCC1=C(N=C(N=C1OS(=O)(=O)N(C)C)NCC)C |
| Synonyms |
EINECS 255-391-2
Bupirimate
Nimrod
41483-43-6
Nimrod T
Bupirimate [ANSI:BSI:ISO]
UNII-MCJ121RIOI
PP588
Nanogen Index Code BPT (1-011)
BRN 0758056
|
| Classifies |
Pesticide
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Organoheterocyclic compounds |
| Class | Diazines |
| Subclass | Pyrimidines and pyrimidine derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Aminopyrimidines and derivatives |
| Alternative Parents | |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Secondary aliphatic/aromatic amine - Aminopyrimidine - Heteroaromatic compound - Organic sulfuric acid or derivatives - Azacycle - Secondary amine - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Amine - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as aminopyrimidines and derivatives. These are organic compounds containing an amino group attached to a pyrimidine ring. Pyrimidine is a 6-membered ring consisting of four carbon atoms and two nitrogen centers at the 1- and 3- ring positions. |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 316.42 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 8 |
| Complexity | 397 |
| Monoisotopic Mass | 316.157 |
| Exact Mass | 316.157 |
| XLogP | 2.7 |
| Formal Charge | 0 |
| Heavy Atom Count | 21 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9418 |
| Human Intestinal Absorption | HIA+ | 1.0000 |
| Caco-2 Permeability | Caco2- | 0.5750 |
| P-glycoprotein Substrate | Non-substrate | 0.6466 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.6437 |
| Non-inhibitor | 0.9491 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8800 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.4661 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7508 |
| CYP450 2D6 Substrate | Non-substrate | 0.7978 |
| CYP450 3A4 Substrate | Substrate | 0.5066 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.5589 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.7454 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8629 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.5898 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.9630 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.9238 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.8030 |
| Non-inhibitor | 0.6120 | |
| AMES Toxicity | Non AMES toxic | 0.5618 |
| Carcinogens | Non-carcinogens | 0.6021 |
| Fish Toxicity | High FHMT | 0.6840 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.6420 |
| Honey Bee Toxicity | Low HBT | 0.5906 |
| Biodegradation | Not ready biodegradable | 0.6022 |
| Acute Oral Toxicity | III | 0.7754 |
| Carcinogenicity (Three-class) | Non-required | 0.6069 |
| Model | Value | Unit |
|---|---|---|
| Absorption | ||
| Aqueous solubility | -4.0974 | LogS |
| Caco-2 Permeability | 1.0652 | LogPapp, cm/s |
| Distribution | ||
| Metabolism | ||
| Excretion | ||
| Toxicity | ||
| Rat Acute Toxicity | 1.9294 | LD50, mol/kg |
| Fish Toxicity | 1.4947 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.3787 | pIGC50, ug/L |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Palm hearts | 0270090 | European Union | 0.05* | 25/06/2015 | |
| Others (2) | 0270990 | European Union | 0.05* | 25/06/2015 | |
| Celeriacs/turnip rooted celeries | 0213030 | European Union | 0.05* | 25/06/2015 | |
| Jerusalem artichokes (Crosnes/Chinese artichokes, Mashua, Oca, Pale-leaf sunflower, Tuberous peas,) | 0213050 | European Union | 0.05* | 25/06/2015 | |
| Parsnips | 0213060 | European Union | 0.05* | 25/06/2015 | |
| Parsley roots/Hamburg roots parsley (Angelica roots, Burnet saxifrage roots, Lovage roots, Nettle roots, Other species of the genus Urtica, not elsewhere mentioned, Turnip-rooted chervils,) | 0213070 | European Union | 0.05* | 25/06/2015 | |
| Radishes (Black radishes/winter radishes/ 'Gros noir d'hiver', Daikon/japanese radishes, Maca roots, Small radishes, Tigernuts,) | 0213080 | European Union | 0.05* | 25/06/2015 | |
| Salsifies (Burdocks, Rampion roots, Scorzonera/black salsifies, Skirrets, Spanish salsifies,) | 0213090 | European Union | 0.05* | 25/06/2015 | |
| Swedes/rutabagas | 0213100 | European Union | 0.05* | 25/06/2015 | |
| Turnips (Tuberous-rooted mustards,) | 0213110 | European Union | 0.05* | 25/06/2015 | |
| Others (2) | 0213990 | European Union | 0.05* | 25/06/2015 | |
| Bulb vegetables | 0220000 | European Union | 0.05* | 25/06/2015 | |
| Garlic (Twistedleaf garlic,) | 0220010 | European Union | 0.05* | 25/06/2015 | |
| Onions ('Cipollotto Nocerino PDO', Pearl onions, Rakkyo/Chinese onions, Silverskin onions/pickled onions,) | 0220020 | European Union | 0.05* | 25/06/2015 | |
| Shallots (French grey shallots, Persian shallots,) | 0220030 | European Union | 0.05* | 25/06/2015 | |
| Spring onions/green onions and Welsh onions (Tree onions/Egyptian walking onions, Green garlic,) | 0220040 | European Union | 0.05* | 25/06/2015 | |
| Others (2) | 0220990 | European Union | 0.05* | 25/06/2015 | |
| Tomatoes (Alkekengi/Chinese lanterns/ground cherries, Cape gooseberries, Cherry tomatoes, Dwarf Cape gooseberries/strawberry tomatoes, Gojiberries/wolfberries, Gojiberries/wolfberries, Litchi tomat... | 0231010 | European Union | 2 | 25/06/2015 | |
| Sweet peppers/bell peppers (Chili peppers,) | 0231020 | European Union | 2 | 25/06/2015 | |
| Aubergines/eggplants (Antroewas/African eggplants/gboma, Ethiopian eggplants/gilo', Pepinos, Thorn apples, Turkey berries/devil's figs/pea eggplants/pea aubergines, Kangaroo apples/poroporo,) | 0231030 | European Union | 2 | 25/06/2015 |