Dimethametryn
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Dimethametryn(F06001) |
| 2D Structure | |
| FRCD ID | F06001 |
| CAS Number | 22936-75-0 |
| PubChem CID | 31573 |
| Formula | C11H21N5S |
| IUPAC Name | 4-N-ethyl-2-N-(3-methylbutan-2-yl)-6-methylsulfanyl-1,3,5-triazine-2,4-diamine |
| InChI Key | IKYICRRUVNIHPP-UHFFFAOYSA-N |
| InChI | InChI=1S/C11H21N5S/c1-6-12-9-14-10(13-8(4)7(2)3)16-11(15-9)17-5/h7-8H,6H2,1-5H3,(H2,12,13,14,15,16) |
| Canonical SMILES | CCNC1=NC(=NC(=N1)SC)NC(C)C(C)C |
| Isomeric SMILES | CCNC1=NC(=NC(=N1)SC)NC(C)C(C)C |
| Synonyms |
DIMETHAMETRYN
Caswell No. 578AB
Dimethametorin
Dimethametryne
22936-75-0
Belclene 310
Caswell No. 380C
Dimethametryn [BSI:ISO]
Dimethametryne [ISO-French]
CG 7103
|
| Classifies |
Pesticide
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Organoheterocyclic compounds |
| Class | Triazines |
| Subclass | 1,3,5-triazines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Methylthio-s-triazines |
| Alternative Parents | |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Methylthio-s-triazine - Alkyl-2-thio-s-triazine - Aryl thioether - Alkylarylthioether - Heteroaromatic compound - Azacycle - Sulfenyl compound - Thioether - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organosulfur compound - Organonitrogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as methylthio-s-triazines. These are aromatic compounds containing a 1,3,5-triazine ring that is substituted at the 2-position with a methylthio group. |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 255.384 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 6 |
| Complexity | 214 |
| Monoisotopic Mass | 255.152 |
| Exact Mass | 255.152 |
| XLogP | 3.9 |
| Formal Charge | 0 |
| Heavy Atom Count | 17 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.8018 |
| Human Intestinal Absorption | HIA+ | 0.8794 |
| Caco-2 Permeability | Caco2- | 0.5175 |
| P-glycoprotein Substrate | Non-substrate | 0.6744 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.7869 |
| Non-inhibitor | 0.8166 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.7862 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.5251 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8601 |
| CYP450 2D6 Substrate | Non-substrate | 0.7535 |
| CYP450 3A4 Substrate | Non-substrate | 0.6841 |
| CYP450 1A2 Inhibitor | Inhibitor | 0.7864 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.6403 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8580 |
| CYP450 2C19 Inhibitor | Inhibitor | 0.7931 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8740 |
| CYP Inhibitory Promiscuity | High CYP Inhibitory Promiscuity | 0.5058 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9631 |
| Non-inhibitor | 0.8124 | |
| AMES Toxicity | Non AMES toxic | 0.8415 |
| Carcinogens | Non-carcinogens | 0.8907 |
| Fish Toxicity | Low FHMT | 0.6509 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9004 |
| Honey Bee Toxicity | Low HBT | 0.6349 |
| Biodegradation | Not ready biodegradable | 0.9921 |
| Acute Oral Toxicity | III | 0.8378 |
| Carcinogenicity (Three-class) | Warning | 0.3969 |
| Model | Value | Unit |
|---|---|---|
| Absorption | ||
| Aqueous solubility | -3.2648 | LogS |
| Caco-2 Permeability | 1.4173 | LogPapp, cm/s |
| Distribution | ||
| Metabolism | ||
| Excretion | ||
| Toxicity | ||
| Rat Acute Toxicity | 2.1872 | LD50, mol/kg |
| Fish Toxicity | 2.1951 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.3723 | pIGC50, ug/L |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Rice(Brown Rice) | Japan | 0.1ppm |