Destomycin A
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Destomycin A(F06029) |
| 2D Structure | |
| FRCD ID | F06029 |
| CAS Number | 14918-35-5 |
| PubChem CID | 502206 |
| Formula | C20H37N3O13 |
| IUPAC Name | (3'R,3aS,4S,4'S,5'R,6R,6'R,7S,7aS)-4-[(1S,2R,3S,5R,6S)-3-amino-2,6-dihydroxy-5-(methylamino)cyclohexyl]oxy-6'-[(1S)-1-amino-2-hydroxyethyl]-6-(hydroxymethyl)spiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,2'-oxane]-3',4',5',7-tetrol |
| InChI Key | GRRNUXAQVGOGFE-SVNOMHMPSA-N |
| InChI | InChI=1S/C20H37N3O13/c1-23-7-2-5(21)9(26)15(10(7)27)33-19-17-16(11(28)8(4-25)32-19)35-20(36-17)18(31)13(30)12(29)14(34-20)6(22)3-24/h5-19,23-31H,2-4,21-22H2,1H3/t5-,6-,7+,8+,9+,10-,11-,12+,13-,14+,15-,16-,17-,18+,19-,20?/m0/s1 |
| Canonical SMILES | CNC1CC(C(C(C1O)OC2C3C(C(C(O2)CO)O)OC4(O3)C(C(C(C(O4)C(CO)N)O)O)O)O)N |
| Isomeric SMILES | CN[C@@H]1C[C@@H]([C@H]([C@@H]([C@H]1O)O[C@H]2[C@@H]3[C@H]([C@H]([C@H](O2)CO)O)OC4(O3)[C@@H]([C@H]([C@H]([C@H](O4)[C@H](CO)N)O)O)O)O)N |
| Synonyms |
(3'R,3aS,4S,4'S,5'R,6R,6'R,7S,7aS)-4-[(1S,2R,3S,5R,6S)-3-amino-2,6-dihydroxy-5-(methylamino)cyclohexoxy]-6'-[(1S)-1-amino-2-hydroxy-ethyl]-6-(hydroxymethyl)spiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,2'-tetrahydropyran]-3',4',5',7-tetrol
Destomycin A
Destomysin
14918-35-5
Destonate 20
AC1L9W0F
NSC96877
C01688
NSC 96877
2,3-O-(6-(1-Amino-2-hydroxyethyl)-3,4,5-trihydroxytetrahydropyran-2-yliden)-(3-amino-5-methylamino-3,4,5-tridesoxy-mesoinosit-1-yl)-beta-D-talopyranosid
|
| Classifies |
Predicted: Pesticide
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Intermediate Tree Nodes | Aminosaccharides - Aminoglycosides - Aminocyclitol glycosides |
| Direct Parent | 2-deoxystreptamine aminoglycosides |
| Alternative Parents |
|
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Substituents | 2-deoxystreptamine aminoglycoside - Disaccharide - Glycosyl compound - O-glycosyl compound - Dioxolopyran - Aminocyclitol or derivatives - Cyclohexanol - Cyclohexylamine - Carboxylic acid orthoester - Ortho ester - Cyclitol or derivatives - Oxane - Cyclic alcohol - Meta-dioxolane - Orthocarboxylic acid derivative - 1,2-aminoalcohol - Secondary alcohol - Secondary amine - Organoheterocyclic compound - Oxacycle - Acetal - Secondary aliphatic amine - Polyol - Organic nitrogen compound - Primary aliphatic amine - Organonitrogen compound - Primary alcohol - Primary amine - Amine - Alcohol - Hydrocarbon derivative - Organopnictogen compound - Aliphatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as 2-deoxystreptamine aminoglycosides. These are aminoglycosides containing the 2-deoxystreptamine (1,3-diaminocyclohexane-4,5,6-triol) core. |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 527.524 |
| Hydrogen Bond Donor Count | 11 |
| Hydrogen Bond Acceptor Count | 16 |
| Rotatable Bond Count | 6 |
| Complexity | 756 |
| Monoisotopic Mass | 527.233 |
| Exact Mass | 527.233 |
| XLogP | -6.6 |
| Formal Charge | 0 |
| Heavy Atom Count | 36 |
| Defined Atom Stereocenter Count | 15 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.9783 |
| Human Intestinal Absorption | HIA- | 0.5442 |
| Caco-2 Permeability | Caco2- | 0.7045 |
| P-glycoprotein Substrate | Substrate | 0.6604 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.7855 |
| Non-inhibitor | 0.9781 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8392 |
| Distribution | ||
| Subcellular localization | Lysosome | 0.6336 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7694 |
| CYP450 2D6 Substrate | Non-substrate | 0.7885 |
| CYP450 3A4 Substrate | Non-substrate | 0.5122 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.8822 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9023 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8976 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.8641 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.9267 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.8175 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9744 |
| Non-inhibitor | 0.8257 | |
| AMES Toxicity | Non AMES toxic | 0.5424 |
| Carcinogens | Non-carcinogens | 0.9612 |
| Fish Toxicity | High FHMT | 0.6484 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.7302 |
| Honey Bee Toxicity | High HBT | 0.5140 |
| Biodegradation | Not ready biodegradable | 0.9851 |
| Acute Oral Toxicity | I | 0.8269 |
| Carcinogenicity (Three-class) | Non-required | 0.5854 |
| Model | Value | Unit |
|---|---|---|
| Absorption | ||
| Aqueous solubility | -1.8845 | LogS |
| Caco-2 Permeability | -0.5240 | LogPapp, cm/s |
| Distribution | ||
| Metabolism | ||
| Excretion | ||
| Toxicity | ||
| Rat Acute Toxicity | 3.8668 | LD50, mol/kg |
| Fish Toxicity | 1.6945 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.1106 | pIGC50, ug/L |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Pig,Edible Offal | Japan | 0.5ppm | |||
| Pig,Kidney | Japan | 0.5ppm | |||
| Pig,Liver | Japan | 0.5ppm | |||
| Pig,Fat | Japan | 0.5ppm | |||
| Pig,Muscle | Japan | 0.5ppm |