Dichlormid
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Dichlormid(F06037) |
| 2D Structure | |
| FRCD ID | F06037 |
| CAS Number | 37764-25-3 |
| PubChem CID | 37829 |
| Formula | C8H11Cl2NO |
| IUPAC Name | 2,2-dichloro-N,N-bis(prop-2-enyl)acetamide |
| InChI Key | YRMLFORXOOIJDR-UHFFFAOYSA-N |
| InChI | InChI=1S/C8H11Cl2NO/c1-3-5-11(6-4-2)8(12)7(9)10/h3-4,7H,1-2,5-6H2 |
| Canonical SMILES | C=CCN(CC=C)C(=O)C(Cl)Cl |
| Isomeric SMILES | C=CCN(CC=C)C(=O)C(Cl)Cl |
| Synonyms |
Dichlormid
37764-25-3
N,N-Diallyldichloroacetamide
N,N-DIALLYL-2,2-DICHLOROACETAMIDE
Dichloromid
Compound R-25788
Stauffer R-25788
Acetamide, 2,2-dichloro-N,N-di-2-propenyl-
C8H11Cl2NO
R-25788
|
| Classifies |
Pesticide
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Carboxylic acid derivatives |
| Intermediate Tree Nodes | Carboxylic acid amides |
| Direct Parent | Tertiary carboxylic acid amides |
| Alternative Parents | |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Tertiary carboxylic acid amide - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Carbonyl group - Alkyl halide - Alkyl chloride - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as tertiary carboxylic acid amides. These are compounds containing an amide derivative of carboxylic acid, with the general structure RN(R1)C(R2)=O (R1-R2 any atom but H). |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 208.082 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 5 |
| Complexity | 170 |
| Monoisotopic Mass | 207.022 |
| Exact Mass | 207.022 |
| XLogP | 2.4 |
| Formal Charge | 0 |
| Heavy Atom Count | 12 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9960 |
| Human Intestinal Absorption | HIA+ | 0.9835 |
| Caco-2 Permeability | Caco2+ | 0.6997 |
| P-glycoprotein Substrate | Non-substrate | 0.8414 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.9138 |
| Non-inhibitor | 0.8750 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.7459 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.6022 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8293 |
| CYP450 2D6 Substrate | Non-substrate | 0.8023 |
| CYP450 3A4 Substrate | Non-substrate | 0.5800 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.6695 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.8573 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9568 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.6142 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8902 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.7622 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9658 |
| Non-inhibitor | 0.9273 | |
| AMES Toxicity | AMES toxic | 0.7886 |
| Carcinogens | Carcinogens | 0.6522 |
| Fish Toxicity | High FHMT | 0.6332 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.7752 |
| Honey Bee Toxicity | Low HBT | 0.5459 |
| Biodegradation | Not ready biodegradable | 0.9790 |
| Acute Oral Toxicity | III | 0.8199 |
| Carcinogenicity (Three-class) | Danger | 0.5312 |
| Model | Value | Unit |
|---|---|---|
| Absorption | ||
| Aqueous solubility | -1.5572 | LogS |
| Caco-2 Permeability | 1.5638 | LogPapp, cm/s |
| Distribution | ||
| Metabolism | ||
| Excretion | ||
| Toxicity | ||
| Rat Acute Toxicity | 2.0482 | LD50, mol/kg |
| Fish Toxicity | 1.5696 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 1.1885 | pIGC50, ug/L |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Corn(Maize) | Japan | 0.05ppm |