Valnemulin
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Valnemulin(F06040) |
| 2D Structure | |
| FRCD ID | F06040 |
| CAS Number | 101312-92-9 |
| PubChem CID | 9850878 |
| Formula | C31H52N2O5S |
| IUPAC Name | None |
| InChI Key | LLYYNOVSVPBRGV-MVNKZKPCSA-N |
| InChI | InChI=1S/C31H52N2O5S/c1-10-29(8)15-22(38-23(35)16-39-28(6,7)17-33-27(37)24(32)18(2)3)30(9)19(4)11-13-31(20(5)26(29)36)14-12-21(34)25(30)31/h10,18-20,22,24-26,36H,1,11-17,32H2,2-9H3,(H,33,37)/t19-,20+,22-,24-,25+,26+,29-,30+,31+/m1/s1 |
| Canonical SMILES | CC1CCC23CCC(=O)C2C1(C(CC(C(C3C)O)(C)C=C)OC(=O)CSC(C)(C)CNC(=O)C(C(C)C)N)C |
| Isomeric SMILES | C[C@@H]1CC[C@@]23CCC(=O)[C@H]2[C@@]1([C@@H](C[C@@]([C@H]([C@@H]3C)O)(C)C=C)OC(=O)CSC(C)(C)CNC(=O)[C@@H](C(C)C)N)C |
| Synonyms |
DSSTox_CID_26751
Valnemulin
Econor
UNII-2AHC415BQG
2AHC415BQG
101312-92-9
Valnemulin [INN:BAN]
NCGC00167968-01
DSSTox_RID_81876
DSSTox_GSID_46751
|
| Classifies |
Predicted: Veterinary Drug
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Lipids and lipid-like molecules |
| Class | Prenol lipids |
| Subclass | Diterpenoids |
| Intermediate Tree Nodes | Mutilane diterpenoids - Mutilin derivatives |
| Direct Parent | Pleuromutilin and derivatives |
| Alternative Parents | |
| Molecular Framework | Aliphatic homopolycyclic compounds |
| Substituents | Pleuromutilin - Valine or derivatives - Alpha-amino acid amide - Alpha-amino acid or derivatives - Fatty acyl - Fatty amide - N-acyl-amine - Amino acid or derivatives - Carboxamide group - Carboxylic acid ester - Ketone - Secondary carboxylic acid amide - Secondary alcohol - Carboxylic acid derivative - Dialkylthioether - Sulfenyl compound - Monocarboxylic acid or derivatives - Thioether - Organic oxygen compound - Primary aliphatic amine - Organic nitrogen compound - Hydrocarbon derivative - Alcohol - Organic oxide - Carbonyl group - Organopnictogen compound - Amine - Organonitrogen compound - Organooxygen compound - Organosulfur compound - Primary amine - Aliphatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as pleuromutilin and derivatives. These are mutilins with a hydroxyacetate derivative attached to the C8 carbon atom of the cyclopenta[8]annulene moiety. |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 564.826 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 10 |
| Complexity | 969 |
| Monoisotopic Mass | 564.36 |
| Exact Mass | 564.36 |
| XLogP | 5.3 |
| Formal Charge | 0 |
| Heavy Atom Count | 39 |
| Defined Atom Stereocenter Count | 9 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.5311 |
| Human Intestinal Absorption | HIA+ | 0.8025 |
| Caco-2 Permeability | Caco2- | 0.7332 |
| P-glycoprotein Substrate | Substrate | 0.7811 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.6111 |
| Non-inhibitor | 0.8318 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9225 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.6984 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8547 |
| CYP450 2D6 Substrate | Non-substrate | 0.7783 |
| CYP450 3A4 Substrate | Substrate | 0.5859 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.8502 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.7735 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8930 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.6716 |
| CYP450 3A4 Inhibitor | Inhibitor | 0.5074 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.8515 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9945 |
| Non-inhibitor | 0.8548 | |
| AMES Toxicity | Non AMES toxic | 0.7832 |
| Carcinogens | Non-carcinogens | 0.9164 |
| Fish Toxicity | High FHMT | 0.9974 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9790 |
| Honey Bee Toxicity | High HBT | 0.5615 |
| Biodegradation | Not ready biodegradable | 1.0000 |
| Acute Oral Toxicity | III | 0.6307 |
| Carcinogenicity (Three-class) | Non-required | 0.6340 |
| Model | Value | Unit |
|---|---|---|
| Absorption | ||
| Aqueous solubility | -4.1742 | LogS |
| Caco-2 Permeability | 0.1472 | LogPapp, cm/s |
| Distribution | ||
| Metabolism | ||
| Excretion | ||
| Toxicity | ||
| Rat Acute Toxicity | 2.6591 | LD50, mol/kg |
| Fish Toxicity | 1.2428 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.4620 | pIGC50, ug/L |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Pig,Edible Offal | Japan | 0.05ppm | |||
| Pig,Kidney | Japan | 0.05ppm | |||
| Pig,Liver | Japan | 0.05ppm | |||
| Pig,Fat | Japan | 0.05ppm | |||
| Pig,Muscle | Japan | 0.05ppm |
References
| Title | Journal | Date | Pubmed ID |
|---|---|---|---|
| Characterization of Bacillus cereus isolates from local dairy farms in China. | FEMS Microbiol Lett | 2016 Jun | 27190168 |