Copper Nonylphenolsulfonate
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Copper Nonylphenolsulfonate(F06046) |
| 2D Structure | |
| FRCD ID | F06046 |
| CAS Number | |
| PubChem CID | 129646666 |
| Formula | C15H23CuO4S |
| IUPAC Name | copper(1+);3-hydroxy-2-nonylbenzenesulfonate |
| InChI Key | HOYUBCPKRPGOGK-UHFFFAOYSA-M |
| InChI | InChI=1S/C15H24O4S.Cu/c1-2-3-4-5-6-7-8-10-13-14(16)11-9-12-15(13)20(17,18)19;/h9,11-12,16H,2-8,10H2,1H3,(H,17,18,19);/q;+1/p-1 |
| Canonical SMILES | CCCCCCCCCC1=C(C=CC=C1S(=O)(=O)[O-])O.[Cu+] |
| Isomeric SMILES | CCCCCCCCCC1=C(C=CC=C1S(=O)(=O)[O-])O.[Cu+] |
| Synonyms |
copper nonylphenolsulfonate
|
| Classifies |
Pesticide
|
| Update Date | Nov 13, 2018 17:07 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 362.951 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 8 |
| Complexity | 334 |
| Monoisotopic Mass | 362.061 |
| Exact Mass | 362.061 |
| Formal Charge | 0 |
| Heavy Atom Count | 21 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 2 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Lettuce(Including Cos Lettuce And Leaf Lettuce) | Japan | 10ppm | |||
| Other Legumes/Pulses | Japan | 0.04ppm | |||
| Kale | Japan | 10ppm | |||
| Other Herbs | Japan | 10ppm | |||
| Other Spices | Japan | 10ppm | |||
| Hop | Japan | 0.04ppm | |||
| Cacao Beans | Japan | 0.04ppm | |||
| Coffee Beans | Japan | 0.04ppm | |||
| Tea | Japan | 0.04ppm | |||
| Other Vegetables | Japan | 10ppm | |||
| Other Mushrooms | Japan | 10ppm | |||
| Shiitake Mushroom | Japan | 10ppm | |||
| Button Mushroom | Japan | 10ppm | |||
| Green Soybeans | Japan | 10ppm | |||
| Kidney Beans,Immature(With Pods) | Japan | 10ppm | |||
| Peas,Immature(With Pods) | Japan | 10ppm | |||
| Ginger | Japan | 10ppm | |||
| Okra | Japan | 10ppm | |||
| Bamboo Shoots | Japan | 10ppm | |||
| Spinach | Japan | 10ppm |