Cyflufenamid
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Cyflufenamid(F06055) |
| 2D Structure | |
| FRCD ID | F06055 |
| CAS Number | 180409-60-3 |
| PubChem CID | 9844539 |
| Formula | C20H17F5N2O2 |
| IUPAC Name | N-[(cyclopropylmethoxyamino)-[2,3-difluoro-6-(trifluoromethyl)phenyl]methylidene]-2-phenylacetamide |
| InChI Key | ACMXQHFNODYQAT-UHFFFAOYSA-N |
| InChI | InChI=1S/C20H17F5N2O2/c21-15-9-8-14(20(23,24)25)17(18(15)22)19(27-29-11-13-6-7-13)26-16(28)10-12-4-2-1-3-5-12/h1-5,8-9,13H,6-7,10-11H2,(H,26,27,28) |
| Canonical SMILES | C1CC1CONC(=NC(=O)CC2=CC=CC=C2)C3=C(C=CC(=C3F)F)C(F)(F)F |
| Isomeric SMILES | C1CC1CONC(=NC(=O)CC2=CC=CC=C2)C3=C(C=CC(=C3F)F)C(F)(F)F |
| Synonyms |
CHEBI:81797
(N(Z))-N-(((Cyclopropylmethoxy)amino)(2,3-difluoro-6-(trifluoromethyl)phenyl)methylene)benzeneacetamide
Cyflufenamid
180409-60-3
UNII-79ID05OQ82
79ID05OQ82
Cyflufenamid [ISO]
[N(Z)]-N-[[(cyclopropylmethoxy)amino][2,3-difluoro-6-(trifluoromethyl)phenyl]methylene]benzeneacetamide
N-[(Z)-N-(cyclopropylmethoxy)-C-[2,3-difluoro-6-(trifluoromethyl)phenyl]carbonimidoyl]-2-phenylacetamide
SCHEMBL21751
|
| Classifies |
Pesticide
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Trifluoromethylbenzenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Trifluoromethylbenzenes |
| Alternative Parents | |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Trifluoromethylbenzene - Fluorobenzene - Halobenzene - Aryl fluoride - Aryl halide - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Alkyl fluoride - Organooxygen compound - Organonitrogen compound - Organofluoride - Organohalogen compound - Hydrocarbon derivative - Organopnictogen compound - Organic oxygen compound - Organic nitrogen compound - Alkyl halide - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as trifluoromethylbenzenes. These are organofluorine compounds that contain a benzene ring substituted with one or more trifluoromethyl groups. |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 412.36 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 7 |
| Complexity | 588 |
| Monoisotopic Mass | 412.121 |
| Exact Mass | 412.121 |
| XLogP | 5.3 |
| Formal Charge | 0 |
| Heavy Atom Count | 29 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9870 |
| Human Intestinal Absorption | HIA+ | 0.9954 |
| Caco-2 Permeability | Caco2- | 0.5497 |
| P-glycoprotein Substrate | Non-substrate | 0.6412 |
| P-glycoprotein Inhibitor | Inhibitor | 0.5771 |
| Non-inhibitor | 0.8993 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.7387 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.8739 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7199 |
| CYP450 2D6 Substrate | Non-substrate | 0.7878 |
| CYP450 3A4 Substrate | Non-substrate | 0.5082 |
| CYP450 1A2 Inhibitor | Inhibitor | 0.6897 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.5476 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.7947 |
| CYP450 2C19 Inhibitor | Inhibitor | 0.6845 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.7512 |
| CYP Inhibitory Promiscuity | High CYP Inhibitory Promiscuity | 0.8816 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9718 |
| Non-inhibitor | 0.5690 | |
| AMES Toxicity | Non AMES toxic | 0.5416 |
| Carcinogens | Non-carcinogens | 0.7021 |
| Fish Toxicity | High FHMT | 0.6838 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9966 |
| Honey Bee Toxicity | Low HBT | 0.8096 |
| Biodegradation | Not ready biodegradable | 0.9954 |
| Acute Oral Toxicity | III | 0.5939 |
| Carcinogenicity (Three-class) | Non-required | 0.5257 |
| Model | Value | Unit |
|---|---|---|
| Absorption | ||
| Aqueous solubility | -3.8889 | LogS |
| Caco-2 Permeability | 1.1714 | LogPapp, cm/s |
| Distribution | ||
| Metabolism | ||
| Excretion | ||
| Toxicity | ||
| Rat Acute Toxicity | 2.7007 | LD50, mol/kg |
| Fish Toxicity | 1.2164 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.8310 | pIGC50, ug/L |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Melons (Kiwanos/horned melons,) | 0233010 | European Union | 0.04 | 23/02/2017 | |
| SUGAR PLANTS | 0900000 | European Union | 0.02* | 23/02/2017 | |
| Others (2) | 0220990 | European Union | 0.02* | 23/02/2017 | |
| Sweet peppers/bell peppers (Chili peppers,) | 0231020 | European Union | 0.04 | 23/02/2017 | |
| Aubergines/eggplants (Antroewas/African eggplants/gboma, Ethiopian eggplants/gilo', Pepinos, Thorn apples, Turkey berries/devil's figs/pea eggplants/pea aubergines, Kangaroo apples/poroporo,) | 0231030 | European Union | 0.02* | 23/02/2017 | |
| Okra/lady's fingers | 0231040 | European Union | 0.02* | 23/02/2017 | |
| Others (2) | 0231990 | European Union | 0.02* | 23/02/2017 | |
| Cucumbers (Armenian cucumbers, Dosakayi/Indian curry cucumbers,) | 0232010 | European Union | 0.04 | 23/02/2017 | |
| Gherkins (Bur gherkins,) | 0232020 | European Union | 0.08 | 23/02/2017 | |
| Courgettes (Angled luffas/teroi, Bottle gourds/calabashes/lauki, Chayotes/christophines, Ivy gourds, Pointed gourds/parwals, Snake gourds, Sopropos/bitter melons/balsam pears, Summer squashes/zucch... | 0232030 | European Union | 0.05 | 23/02/2017 | |
| Others (2) | 0232990 | European Union | 0.02* | 23/02/2017 | |
| (c) cucurbits with inedible peel | 0233000 | European Union | 0.04 | 23/02/2017 | |
| Pumpkins (Butternut squashes, Winter melons/winter gourds/white gourds, Winter squashes/red kuri squashes/marrows (late varieties),) | 0233020 | European Union | 0.04 | 23/02/2017 | |
| Watermelons | 0233030 | European Union | 0.04 | 23/02/2017 | |
| Others (2) | 0233990 | European Union | 0.04 | 23/02/2017 | |
| (d) sweet corn (Baby corn,) | 0234000 | European Union | 0.02* | 23/02/2017 | |
| (e) other fruiting vegetables | 0239000 | European Union | 0.02* | 23/02/2017 | |
| Brassica vegetables (excluding brassica roots and brassica baby leaf crops) | 0240000 | European Union | 0.02* | 23/02/2017 | |
| (a) flowering brassica | 0241000 | European Union | 0.02* | 23/02/2017 | |
| Broccoli (Calabrese, Chinese broccoli/kai-lan, Choi sum/tsoi sam, Rapini/broccoletti/broccoli raab,) | 0241010 | European Union | 0.02* | 23/02/2017 |