Imazamox-Ammonium
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Imazamox-Ammonium(F06069) |
| 2D Structure | |
| FRCD ID | F06069 |
| CAS Number | 247057-22-3 |
| PubChem CID | 18772481 |
| Formula | C15H22N4O4 |
| IUPAC Name | azanium;5-(methoxymethyl)-2-(4-methyl-5-oxo-4-propan-2-yl-1H-imidazol-2-yl)pyridine-3-carboxylate |
| InChI Key | GNZZHGJSMCDMBU-UHFFFAOYSA-N |
| InChI | InChI=1S/C15H19N3O4.H3N/c1-8(2)15(3)14(21)17-12(18-15)11-10(13(19)20)5-9(6-16-11)7-22-4;/h5-6,8H,7H2,1-4H3,(H,19,20)(H,17,18,21);1H3 |
| Canonical SMILES | CC(C)C1(C(=O)NC(=N1)C2=NC=C(C=C2C(=O)[O-])COC)C.[NH4+] |
| Isomeric SMILES | CC(C)C1(C(=O)NC(=N1)C2=NC=C(C=C2C(=O)[O-])COC)C.[NH4+] |
| Synonyms |
Imazamox-ammonium
Imazamox-ammonium [ISO]
SCHEMBL18784071
247057-22-3
|
| Classifies |
Pesticide
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives |
| Direct Parent | Alpha amino acids and derivatives |
| Alternative Parents |
|
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Alpha-amino acid or derivatives - Pyridine carboxylic acid - Pyridine carboxylic acid or derivatives - Imidazolyl carboxylic acid derivative - Imidazolinone - Pyridine - 2-imidazoline - Heteroaromatic compound - Quaternary ammonium salt - Carboxylic acid salt - Amidine - Carboxylic acid amidine - Carboxylic acid - Dialkyl ether - Ether - Azacycle - Organoheterocyclic compound - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Carboximidamide - Organic oxide - Hydrocarbon derivative - Organic nitrogen compound - Organonitrogen compound - Organooxygen compound - Organic oxygen compound - Organic salt - Amine - Carbonyl group - Organic zwitterion - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as alpha amino acids and derivatives. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon), or a derivative thereof. |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 322.365 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 4 |
| Complexity | 486 |
| Monoisotopic Mass | 322.164 |
| Exact Mass | 322.164 |
| Formal Charge | 0 |
| Heavy Atom Count | 23 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 2 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Other Poultry,Eggs | Japan | 0.01ppm | |||
| Chicken,Eggs | Japan | 0.01ppm | |||
| Other Poultry Animals,Edible Offal | Japan | 0.01ppm | |||
| Chicken,Edible Offal | Japan | 0.01ppm | |||
| Other Poultry Animals,Kidney | Japan | 0.01ppm | |||
| Chicken,Kidney | Japan | 0.01ppm | |||
| Other Poultry Animals,Liver | Japan | 0.01ppm | |||
| Chicken,Liver | Japan | 0.01ppm | |||
| Other Poultry Animals,Fat | Japan | 0.01ppm | |||
| Chicken,Fat | Japan | 0.01ppm | |||
| Other Poultry Animals,Muscle | Japan | 0.01ppm | |||
| Chicken,Muscle | Japan | 0.01ppm | |||
| Milk | Japan | 0.03ppm | |||
| Other Terrestrial Mammals,Edible Offal | Japan | 0.03ppm | |||
| Pig,Edible Offal | Japan | 0.05ppm | |||
| Other Terrestrial Mammals,Kidney | Japan | 0.03ppm | |||
| Pig,Kidney | Japan | 0.05ppm | |||
| Cattle,Kidney | Japan | 0.03ppm | |||
| Other Terrestrial Mammals,Liver | Japan | 0.03ppm | |||
| Pig,Liver | Japan | 0.05ppm |