Saflufenacil
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Saflufenacil(F06120) |
| 2D Structure | |
| FRCD ID | F06120 |
| CAS Number | 372137-35-4 |
| PubChem CID | 11571392 |
| Formula | C17H17ClF4N4O5S |
| IUPAC Name | 2-chloro-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]-N-[methyl(propan-2-yl)sulfamoyl]benzamide |
| InChI Key | GNHDVXLWBQYPJE-UHFFFAOYSA-N |
| InChI | InChI=1S/C17H17ClF4N4O5S/c1-8(2)25(4)32(30,31)23-15(28)9-5-12(11(19)6-10(9)18)26-14(27)7-13(17(20,21)22)24(3)16(26)29/h5-8H,1-4H3,(H,23,28) |
| Canonical SMILES | CC(C)N(C)S(=O)(=O)NC(=O)C1=CC(=C(C=C1Cl)F)N2C(=O)C=C(N(C2=O)C)C(F)(F)F |
| Isomeric SMILES | CC(C)N(C)S(=O)(=O)NC(=O)C1=CC(=C(C=C1Cl)F)N2C(=O)C=C(N(C2=O)C)C(F)(F)F |
| Synonyms |
UNII-189U20M808
2-chloro-5-(3,6-dihydro-3-methyl-2,6-dioxo-4-(trifluoromethyl)-1(2H)-pyrimidinyl)-4-fluoro-N-((methyl(1-methylethyl)amino)sulfonyl)benzamide
Saflufenacil
372137-35-4
189U20M808
Kixor
Kixor Herbicide
Saflufenacil [ISO]
2-Chloro-5-[3,6-dihydro-3-methyl-2,6-dioxo-4-(trifluoromethyl)-1(2H)-pyrimidinyl]-4-fluoro-N-{[methyl(1-methylethyl)amino]sulfonyl}benzamide
SCHEMBL712168
|
| Classifies |
Pesticide
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzoic acids and derivatives |
| Intermediate Tree Nodes | Halobenzoic acids and derivatives |
| Direct Parent | 4-halobenzoic acids and derivatives |
| Alternative Parents |
|
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 4-halobenzoic acid or derivatives - 2-halobenzoic acid or derivatives - Benzoyl - Chlorobenzene - Fluorobenzene - Halobenzene - Pyrimidone - Aryl chloride - Aryl fluoride - Aryl halide - Hydropyrimidine - Pyrimidine - Heteroaromatic compound - Organic sulfuric acid or derivatives - Vinylogous amide - Vinylogous halide - Urea - Lactam - Carboxylic acid derivative - Azacycle - Organoheterocyclic compound - Organonitrogen compound - Organohalogen compound - Alkyl halide - Organochloride - Alkyl fluoride - Hydrocarbon derivative - Organofluoride - Organic oxide - Organopnictogen compound - Organic oxygen compound - Organooxygen compound - Organic nitrogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as 4-halobenzoic acids and derivatives. These are benzoic acids or derivatives carrying a halogen atom at the 4-position of the benzene ring. |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 500.85 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 10 |
| Rotatable Bond Count | 5 |
| Complexity | 921 |
| Monoisotopic Mass | 500.054 |
| Exact Mass | 500.054 |
| XLogP | 2.1 |
| Formal Charge | 0 |
| Heavy Atom Count | 32 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.7373 |
| Human Intestinal Absorption | HIA+ | 0.9923 |
| Caco-2 Permeability | Caco2- | 0.5497 |
| P-glycoprotein Substrate | Non-substrate | 0.8359 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.7227 |
| Non-inhibitor | 0.9729 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9315 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.6285 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.5504 |
| CYP450 2D6 Substrate | Non-substrate | 0.8138 |
| CYP450 3A4 Substrate | Non-substrate | 0.5056 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.7694 |
| CYP450 2C9 Inhibitor | Inhibitor | 0.5000 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9033 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.6800 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.6838 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.6179 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9706 |
| Non-inhibitor | 0.7222 | |
| AMES Toxicity | Non AMES toxic | 0.7170 |
| Carcinogens | Non-carcinogens | 0.5676 |
| Fish Toxicity | High FHMT | 0.9766 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9207 |
| Honey Bee Toxicity | Low HBT | 0.8912 |
| Biodegradation | Not ready biodegradable | 0.9920 |
| Acute Oral Toxicity | III | 0.6760 |
| Carcinogenicity (Three-class) | Non-required | 0.6077 |
| Model | Value | Unit |
|---|---|---|
| Absorption | ||
| Aqueous solubility | -3.8932 | LogS |
| Caco-2 Permeability | 1.1428 | LogPapp, cm/s |
| Distribution | ||
| Metabolism | ||
| Excretion | ||
| Toxicity | ||
| Rat Acute Toxicity | 2.3116 | LD50, mol/kg |
| Fish Toxicity | 1.5260 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.6507 | pIGC50, ug/L |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Loquats | Canada | 0.03mg/kg | |||
| Almonds | Canada | 0.03mg/kg | |||
| Apples | Canada | 0.03mg/kg | |||
| Apricots | Canada | 0.03mg/kg | |||
| Asian Pears | Canada | 0.03mg/kg | |||
| Australian Desert Limes | Canada | 0.03mg/kg | |||
| Australian Finger Limes | Canada | 0.03mg/kg | |||
| Australian Round Limes | Canada | 0.03mg/kg | |||
| Barley | Canada | 0.03mg/kg | |||
| Beechnuts | Canada | 0.03mg/kg | |||
| Black Walnuts | Canada | 0.03mg/kg | |||
| Brazil Nuts | Canada | 0.03mg/kg | |||
| Brown River Finger Limes | Canada | 0.03mg/kg | |||
| Buckwheat | Canada | 0.03mg/kg | |||
| Butternuts | Canada | 0.03mg/kg | |||
| Calamondins | Canada | 0.03mg/kg | |||
| Cashew Nuts | Canada | 0.03mg/kg | |||
| Chestnuts | Canada | 0.03mg/kg | |||
| Chinquapins | Canada | 0.03mg/kg | |||
| Citrus Citrons | Canada | 0.03mg/kg |
References
| Title | Journal | Date | Pubmed ID |
|---|---|---|---|
| Synthesis, Herbicidal Activity, and QSAR of Novel N-Benzothiazolyl-pyrimidine-2,4-diones as Protoporphyrinogen Oxidase Inhibitors. | J Agric Food Chem | 2016 Jan 27 | 26728549 |
| Bases for interactions between saflufenacil and glyphosate in plants. | J Agric Food Chem | 2010 Jun 23 | 20481603 |