Flusulfamide
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Flusulfamide(F06129) |
| 2D Structure | |
| FRCD ID | F06129 |
| CAS Number | 106917-52-6 |
| PubChem CID | 86268 |
| Formula | C13H7Cl2F3N2O4S |
| IUPAC Name | 4-chloro-N-(2-chloro-4-nitrophenyl)-3-(trifluoromethyl)benzenesulfonamide |
| InChI Key | GNVDAZSPJWCIQZ-UHFFFAOYSA-N |
| InChI | InChI=1S/C13H7Cl2F3N2O4S/c14-10-3-2-8(6-9(10)13(16,17)18)25(23,24)19-12-4-1-7(20(21)22)5-11(12)15/h1-6,19H |
| Canonical SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Cl)NS(=O)(=O)C2=CC(=C(C=C2)Cl)C(F)(F)F |
| Isomeric SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Cl)NS(=O)(=O)C2=CC(=C(C=C2)Cl)C(F)(F)F |
| Synonyms |
4-Chloro-N-(2-chloro-4-nitrophenyl)-3-(trifluoromethyl)benzenesulfonamide
Flusulfamide
106917-52-6
Nebijin
Flusulfamide [ISO]
MTF 651
UNII-LKO7028G4U
LKO7028G4U
CHEBI:81801
Benzenesulfonamide, 4-chloro-N-(2-chloro-4-nitrophenyl)-3-(trifluoromethyl)-
|
| Classifies |
Pesticide
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Sulfanilides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Sulfanilides |
| Alternative Parents |
|
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Benzenesulfonamide - Trifluoromethylbenzene - Sulfanilide - Benzenesulfonyl group - Nitrobenzene - Nitroaromatic compound - Chlorobenzene - Halobenzene - Aryl chloride - Aryl halide - Organosulfonic acid amide - Organic sulfonic acid or derivatives - Organosulfonic acid or derivatives - Aminosulfonyl compound - Sulfonyl - C-nitro compound - Organic nitro compound - Organic 1,3-dipolar compound - Allyl-type 1,3-dipolar organic compound - Propargyl-type 1,3-dipolar organic compound - Organic oxoazanium - Organosulfur compound - Organochloride - Organofluoride - Organohalogen compound - Alkyl halide - Alkyl fluoride - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Organic oxygen compound - Organic nitrogen compound - Organonitrogen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as sulfanilides. These are organic aromatic compounds containing a sulfanilide moiety, with the general structure RS(=O)(=O)NC1=CC=CC=C1. |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 415.164 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 8 |
| Rotatable Bond Count | 3 |
| Complexity | 594 |
| Monoisotopic Mass | 413.946 |
| Exact Mass | 413.946 |
| XLogP | 4.4 |
| Formal Charge | 0 |
| Heavy Atom Count | 25 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Lettuce(Including Cos Lettuce And Leaf Lettuce) | Japan | 0.1ppm | |||
| Other Herbs | Japan | 0.1ppm | |||
| Other Spices | Japan | 0.1ppm | |||
| Other Vegetables | Japan | 0.1ppm | |||
| Ginger | Japan | 0.1ppm | |||
| Bamboo Shoots | Japan | 0.1ppm | |||
| Spinach | Japan | 0.1ppm | |||
| Other Umbelliferous Vegetables | Japan | 0.1ppm | |||
| Mitsuba | Japan | 0.1ppm | |||
| Celery | Japan | 0.1ppm | |||
| Parsley | Japan | 0.1ppm | |||
| Parsnip | Japan | 0.1ppm | |||
| Carrot | Japan | 0.1ppm | |||
| Other Liliaceous Vegetables | Japan | 0.1ppm | |||
| Multiplying Onion | Japan | 0.1ppm | |||
| Asparagus | Japan | 0.1ppm | |||
| Nira | Japan | 0.1ppm | |||
| Welsh(Including Leek) | Japan | 0.1ppm | |||
| Other Composite Vegetables | Japan | 0.1ppm | |||
| Shungiku | Japan | 0.1ppm |