Bensultap
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Bensultap(F06196) |
| 2D Structure | |
| FRCD ID | F06196 |
| CAS Number | 17606-31-4 |
| PubChem CID | 87176 |
| Formula | C17H21NO4S4 |
| IUPAC Name | 1,3-bis(benzenesulfonylsulfanyl)-N,N-dimethylpropan-2-amine |
| InChI Key | YFXPPSKYMBTNAV-UHFFFAOYSA-N |
| InChI | InChI=1S/C17H21NO4S4/c1-18(2)15(13-23-25(19,20)16-9-5-3-6-10-16)14-24-26(21,22)17-11-7-4-8-12-17/h3-12,15H,13-14H2,1-2H3 |
| Canonical SMILES | CN(C)C(CSS(=O)(=O)C1=CC=CC=C1)CSS(=O)(=O)C2=CC=CC=C2 |
| Isomeric SMILES | CN(C)C(CSS(=O)(=O)C1=CC=CC=C1)CSS(=O)(=O)C2=CC=CC=C2 |
| Synonyms |
Victenon
Nereistoxin dibenzenesulfonate
ZZ-Doricida
Bensultap [BSI:ISO]
Bensultap
17606-31-4
Bancol
Ruban
ZZ-Doricida Insecticide
UNII-145Q2E77PJ
|
| Classifies |
Pesticide
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzenesulfonyl compounds |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzenesulfonyl compounds |
| Alternative Parents | |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Benzenesulfonyl group - Sulfonyl - Tertiary aliphatic amine - Tertiary amine - Sulfenyl compound - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organosulfur compound - Organonitrogen compound - Amine - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as benzenesulfonyl compounds. These are aromatic compounds containing a benzenesulfonyl group, which consists of a monocyclic benzene moiety that carries a sulfonyl group. |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 431.598 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 9 |
| Complexity | 558 |
| Monoisotopic Mass | 431.035 |
| Exact Mass | 431.035 |
| XLogP | 3.4 |
| Formal Charge | 0 |
| Heavy Atom Count | 26 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9122 |
| Human Intestinal Absorption | HIA+ | 0.9522 |
| Caco-2 Permeability | Caco2- | 0.5556 |
| P-glycoprotein Substrate | Non-substrate | 0.6080 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.7159 |
| Non-inhibitor | 0.9677 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.5822 |
| Distribution | ||
| Subcellular localization | Lysosome | 0.4652 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.6474 |
| CYP450 2D6 Substrate | Non-substrate | 0.7843 |
| CYP450 3A4 Substrate | Non-substrate | 0.5242 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.6648 |
| CYP450 2C9 Inhibitor | Inhibitor | 0.5594 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8655 |
| CYP450 2C19 Inhibitor | Inhibitor | 0.6667 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.6736 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.5242 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9190 |
| Non-inhibitor | 0.7832 | |
| AMES Toxicity | Non AMES toxic | 0.7088 |
| Carcinogens | Carcinogens | 0.5858 |
| Fish Toxicity | High FHMT | 0.9257 |
| Tetrahymena Pyriformis Toxicity | Low TPT | 0.5614 |
| Honey Bee Toxicity | High HBT | 0.6032 |
| Biodegradation | Not ready biodegradable | 0.9049 |
| Acute Oral Toxicity | III | 0.7719 |
| Carcinogenicity (Three-class) | Non-required | 0.6425 |
| Model | Value | Unit |
|---|---|---|
| Absorption | ||
| Aqueous solubility | -3.6589 | LogS |
| Caco-2 Permeability | 0.8510 | LogPapp, cm/s |
| Distribution | ||
| Metabolism | ||
| Excretion | ||
| Toxicity | ||
| Rat Acute Toxicity | 2.5607 | LD50, mol/kg |
| Fish Toxicity | 1.4058 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | -0.0097 | pIGC50, ug/L |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Welsh Onion | Korea | 0.5ppm | |||
| Rice | Korea | 0.05ppm |