Tri-Allate
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Tri-Allate(F06202) |
| 2D Structure | |
| FRCD ID | F06202 |
| CAS Number | 2303-17-5 |
| PubChem CID | 5543 |
| Formula | C10H16Cl3NOS |
| IUPAC Name | S-(2,3,3-trichloroprop-2-enyl) N,N-di(propan-2-yl)carbamothioate |
| InChI Key | MWBPRDONLNQCFV-UHFFFAOYSA-N |
| InChI | InChI=1S/C10H16Cl3NOS/c1-6(2)14(7(3)4)10(15)16-5-8(11)9(12)13/h6-7H,5H2,1-4H3 |
| Canonical SMILES | CC(C)N(C(C)C)C(=O)SCC(=C(Cl)Cl)Cl |
| Isomeric SMILES | CC(C)N(C(C)C)C(=O)SCC(=C(Cl)Cl)Cl |
| Synonyms |
Dipthal
Caswell No. 870A
triallate
Tri-allate
2303-17-5
Triallat
Triamyl
Avadex BW
Far-Go
Triallat [German]
|
| Classifies |
Pollutant
Pesticide
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Organosulfur compounds |
| Class | Thiocarbonyl compounds |
| Subclass | Thiocarbamic acid derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Thiocarbamic acid derivatives |
| Alternative Parents | |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Carbonic acid derivative - Thiocarbamic acid derivative - Vinyl chloride - Vinyl halide - Sulfenyl compound - Chloroalkene - Haloalkene - Carbonyl group - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Organic oxygen compound - Organooxygen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Organic nitrogen compound - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as thiocarbamic acid derivatives. These are organic compounds containing a functional group with the general structure OC(=S)NR2 or SC(=O)NR2. |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 304.654 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 5 |
| Complexity | 267 |
| Monoisotopic Mass | 303.002 |
| Exact Mass | 303.002 |
| XLogP | 4.4 |
| Formal Charge | 0 |
| Heavy Atom Count | 16 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9752 |
| Human Intestinal Absorption | HIA+ | 0.9925 |
| Caco-2 Permeability | Caco2+ | 0.5674 |
| P-glycoprotein Substrate | Non-substrate | 0.9058 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8211 |
| Non-inhibitor | 0.9417 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9062 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.5618 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7541 |
| CYP450 2D6 Substrate | Non-substrate | 0.8127 |
| CYP450 3A4 Substrate | Substrate | 0.5476 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.5476 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.6466 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9306 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.5629 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.9031 |
| CYP Inhibitory Promiscuity | High CYP Inhibitory Promiscuity | 0.5918 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9765 |
| Non-inhibitor | 0.8753 | |
| AMES Toxicity | AMES toxic | 0.9107 |
| Carcinogens | Carcinogens | 0.6708 |
| Fish Toxicity | High FHMT | 0.9490 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9945 |
| Honey Bee Toxicity | High HBT | 0.8313 |
| Biodegradation | Not ready biodegradable | 0.9871 |
| Acute Oral Toxicity | III | 0.8035 |
| Carcinogenicity (Three-class) | Non-required | 0.4902 |
| Model | Value | Unit |
|---|---|---|
| Absorption | ||
| Aqueous solubility | -4.6080 | LogS |
| Caco-2 Permeability | 1.5677 | LogPapp, cm/s |
| Distribution | ||
| Metabolism | ||
| Excretion | ||
| Toxicity | ||
| Rat Acute Toxicity | 2.6123 | LD50, mol/kg |
| Fish Toxicity | 1.1257 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.6870 | pIGC50, ug/L |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Green Soybeans | Japan | 0.08ppm | |||
| Lettuce(Including Cos Lettuce And Leaf Lettuce) | Japan | 0.1ppm | |||
| Welsh(Including Leek) | Japan | 0.1ppm | |||
| Japanese Radish,Leaves(Including Radish) | Japan | 0.1ppm | |||
| (c) inedible peel, large | 0163000 | European Union | 0.1* | 01/09/2008 | |
| Bananas (Cavendishes/grand nains, Cavendishes/grand nains, Cavendishes/grand nains, Dwarf bananas/lady fingers bananas, Plantains, Plantains, Plantains,) | 0163020 | European Union | 0.1* | 01/09/2008 | |
| Radishes (Black radishes/winter radishes/ 'Gros noir d'hiver', Daikon/japanese radishes, Maca roots, Small radishes, Tigernuts,) | 0213080 | European Union | 0.1* | 01/09/2008 | |
| Tomatoes (Alkekengi/Chinese lanterns/ground cherries, Cape gooseberries, Cherry tomatoes, Dwarf Cape gooseberries/strawberry tomatoes, Gojiberries/wolfberries, Gojiberries/wolfberries, Litchi tomat... | 0231010 | European Union | 0.1* | 01/09/2008 | |
| Baby leaf crops (including brassica species) (Chards/beet leaves, Escaroles/broad-leaved endives, Indian mustards/mustard greens, Lettuces, Spinaches, Other species harvested at baby leaf stage,) | 0251080 | European Union | 0.1* | 01/09/2008 | |
| Fungi, mosses and lichens | 0280000 | European Union | 0.1* | 01/09/2008 | |
| Bud spices | 0850000 | European Union | 0.1* | 01/09/2008 | |
| Cloves (Cassia buds, Cassia buds, Cassia buds,) | 0850010 | European Union | 0.1* | 01/09/2008 | |
| Goat | 1020030 | European Union | 0.05* | 01/09/2008 | |
| Horse (Species listed with code numbers 1015000-xxx,) | 1020040 | European Union | 0.05* | 01/09/2008 | |
| Lemon | Japan | 0.1ppm | |||
| FRUITS, FRESH or FROZEN; TREE NUTS | 0100000 | European Union | 0.1* | 01/09/2008 | |
| Citrus fruits | 0110000 | European Union | 0.1* | 01/09/2008 | |
| Grapefruits (Natsudaidais, Shaddocks/pomelos, Sweeties/oroblancos, Tangelolos, Tangelos (except minneolas)/Ugli®, Other hybrids of Citrus paradisi, not elsewhere mentioned,) | 0110010 | European Union | 0.1* | 01/09/2008 | |
| Roman rocket/rucola (Wall rocket,) | 0251060 | European Union | 0.1* | 01/09/2008 | |
| Lemons (Buddha's hands/Buddha's fingers, Citrons,) | 0110030 | European Union | 0.1* | 01/09/2008 |