Butamifos
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Butamifos(F06206) |
| 2D Structure | |
| FRCD ID | F06206 |
| CAS Number | 36335-67-8 |
| PubChem CID | 37419 |
| Formula | C13H21N2O4PS |
| IUPAC Name | N-[ethoxy-(5-methyl-2-nitrophenoxy)phosphinothioyl]butan-2-amine |
| InChI Key | OEYOMNZEMCPTKN-UHFFFAOYSA-N |
| InChI | InChI=1S/C13H21N2O4PS/c1-5-11(4)14-20(21,18-6-2)19-13-9-10(3)7-8-12(13)15(16)17/h7-9,11H,5-6H2,1-4H3,(H,14,21) |
| Canonical SMILES | CCC(C)NP(=S)(OCC)OC1=C(C=CC(=C1)C)[N+](=O)[O-] |
| Isomeric SMILES | CCC(C)NP(=S)(OCC)OC1=C(C=CC(=C1)C)[N+](=O)[O-] |
| Synonyms |
S 28 (pesticide)
Butamifos
CREMART
Metacrefos
Kremart
Tufler
36335-67-8
Hercules 26905
Butamiphos
Butamifos [BSI:ISO]
|
| Classifies |
Pesticide
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Nitrobenzenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Nitrobenzenes |
| Alternative Parents | |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Nitrobenzene - Nitrotoluene - Phenoxy compound - Nitroaromatic compound - Toluene - Thiophosphoric acid ester - Organic thiophosphoric acid or derivatives - C-nitro compound - Organic nitro compound - Organic oxoazanium - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Allyl-type 1,3-dipolar organic compound - Organic nitrogen compound - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Organic oxide - Organopnictogen compound - Organic oxygen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as nitrobenzenes. These are compounds containing a nitrobenzene moiety, which consists of a benzene ring with a carbon bearing a nitro group. |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 332.355 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 7 |
| Complexity | 391 |
| Monoisotopic Mass | 332.096 |
| Exact Mass | 332.096 |
| XLogP | 4.7 |
| Formal Charge | 0 |
| Heavy Atom Count | 21 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 2 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Welsh(Including Leek) | Japan | 0.05ppm | |||
| Other Herbs | Japan | 0.05ppm | |||
| Other Spices | Japan | 0.05ppm | |||
| Other Fruits | Japan | 0.05ppm | |||
| Date | Japan | 0.05ppm | |||
| Kiwifruit | Japan | 0.05ppm | |||
| Grape | Japan | 0.05ppm | |||
| Other Berries | Japan | 0.05ppm | |||
| Huckleberry | Japan | 0.05ppm | |||
| Cranberry | Japan | 0.05ppm | |||
| Blueberry | Japan | 0.05ppm | |||
| Blackberry | Japan | 0.05ppm | |||
| Raspberry | Japan | 0.05ppm | |||
| Strawberry | Japan | 0.05ppm | |||
| Cherry | Japan | 0.05ppm | |||
| Mume Plum | Japan | 0.05ppm | |||
| Japanese Plum(Including Prune) | Japan | 0.05ppm | |||
| Apricot | Japan | 0.05ppm | |||
| Peach | Japan | 0.05ppm | |||
| Loquat | Japan | 0.05ppm |