Alpha-Trenbolone
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Alpha-Trenbolone(F06213) |
| 2D Structure | |
| FRCD ID | F06213 |
| CAS Number | 80657-17-6 |
| PubChem CID | 149836 |
| Formula | C18H22O2 |
| IUPAC Name | (8S,13S,14S,17R)-17-hydroxy-13-methyl-2,6,7,8,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-one |
| InChI Key | MEHHPFQKXOUFFV-XDNAFOTISA-N |
| InChI | InChI=1S/C18H22O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h8-10,15-17,20H,2-7H2,1H3/t15-,16+,17-,18+/m1/s1 |
| Canonical SMILES | CC12C=CC3=C4CCC(=O)C=C4CCC3C1CCC2O |
| Isomeric SMILES | C[C@]12C=CC3=C4CCC(=O)C=C4CC[C@H]3[C@@H]1CC[C@H]2O |
| Synonyms |
Epitrenbolone
17alpha-Hydroxytrenbolone
17alpha-Trenbolone
17-alpha-Trenbolone
UNII-K7IGB634GT
80657-17-6
CCRIS 1653
K7IGB634GT
Estra-4,9,11-trien-3-one, 17-hydroxy-, (17-alpha)-
17|A-Trenbolone
|
| Classifies |
Illegal Additives
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Lipids and lipid-like molecules |
| Class | Steroids and steroid derivatives |
| Subclass | Estrane steroids |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Estrogens and derivatives |
| Alternative Parents | |
| Molecular Framework | Aliphatic homopolycyclic compounds |
| Substituents | Estrogen-skeleton - 3-oxosteroid - Hydroxysteroid - 17-hydroxysteroid - Oxosteroid - Cyclohexenone - Cyclic alcohol - Cyclic ketone - Ketone - Secondary alcohol - Organic oxygen compound - Hydrocarbon derivative - Organic oxide - Carbonyl group - Alcohol - Organooxygen compound - Aliphatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as estrogens and derivatives. These are steroids with a structure containing a 3-hydroxylated estrane. |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 270.372 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Complexity | 566 |
| Monoisotopic Mass | 270.162 |
| Exact Mass | 270.162 |
| XLogP | 1.9 |
| Formal Charge | 0 |
| Heavy Atom Count | 20 |
| Defined Atom Stereocenter Count | 4 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9471 |
| Human Intestinal Absorption | HIA+ | 1.0000 |
| Caco-2 Permeability | Caco2+ | 0.8508 |
| P-glycoprotein Substrate | Substrate | 0.6368 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.5527 |
| Non-inhibitor | 0.9359 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.6812 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.7478 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7785 |
| CYP450 2D6 Substrate | Non-substrate | 0.8979 |
| CYP450 3A4 Substrate | Substrate | 0.7316 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.8508 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9383 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9467 |
| CYP450 2C19 Inhibitor | Inhibitor | 0.5308 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.9361 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.8733 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.8470 |
| Non-inhibitor | 0.7260 | |
| AMES Toxicity | Non AMES toxic | 0.9132 |
| Carcinogens | Non-carcinogens | 0.9551 |
| Fish Toxicity | High FHMT | 0.9716 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.8784 |
| Honey Bee Toxicity | High HBT | 0.8393 |
| Biodegradation | Not ready biodegradable | 0.9303 |
| Acute Oral Toxicity | III | 0.5654 |
| Carcinogenicity (Three-class) | Warning | 0.4218 |
| Model | Value | Unit |
|---|---|---|
| Absorption | ||
| Aqueous solubility | -4.2398 | LogS |
| Caco-2 Permeability | 1.7869 | LogPapp, cm/s |
| Distribution | ||
| Metabolism | ||
| Excretion | ||
| Toxicity | ||
| Rat Acute Toxicity | 1.6357 | LD50, mol/kg |
| Fish Toxicity | 0.6516 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.5219 | pIGC50, ug/L |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Cattle,Liver | Japan | 0.01ppm |
References
| Title | Journal | Date | Pubmed ID |
|---|---|---|---|
| Development of a rapid method for the analysis of trenbolone, nortestosterone, and zeranol in bovine liver using liquid chromatography tandem mass spectrometry. | Anal Bioanal Chem | 2015 Jun | 25450054 |