Benfuresate
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Benfuresate(F06225) |
| 2D Structure | |
| FRCD ID | F06225 |
| CAS Number | 68505-69-1 |
| PubChem CID | 3034378 |
| Formula | C12H16O4S |
| IUPAC Name | (3,3-dimethyl-2H-1-benzofuran-5-yl) ethanesulfonate |
| InChI Key | QGQSRQPXXMTJCM-UHFFFAOYSA-N |
| InChI | InChI=1S/C12H16O4S/c1-4-17(13,14)16-9-5-6-11-10(7-9)12(2,3)8-15-11/h5-7H,4,8H2,1-3H3 |
| Canonical SMILES | CCS(=O)(=O)OC1=CC2=C(C=C1)OCC2(C)C |
| Isomeric SMILES | CCS(=O)(=O)OC1=CC2=C(C=C1)OCC2(C)C |
| Synonyms |
Benfuresate
UNII-5E3V59Y698
Cyperal
68505-69-1
Benfuresate [ISO]
2,3-Dihydro-3,3-dimethyl-5-benzofurylethanesulphonate
EINECS 270-925-4
NC 20484
CHEBI:81756
QGQSRQPXXMTJCM-UHFFFAOYSA-N
|
| Classifies |
Pesticide
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Organoheterocyclic compounds |
| Class | Coumarans |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Coumarans |
| Alternative Parents | |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Coumaran - Alkyl aryl ether - Benzenoid - Organosulfonic acid ester - Sulfonic acid ester - Organic sulfonic acid or derivatives - Sulfonyl - Organosulfonic acid or derivatives - Ether - Oxacycle - Organic oxygen compound - Hydrocarbon derivative - Organosulfur compound - Organooxygen compound - Organic oxide - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as coumarans. These are compounds containing the coumaran skeleton, which consists of a benzene ring fused to a 2,3-dihydrofuran ring. |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 256.316 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 3 |
| Complexity | 369 |
| Monoisotopic Mass | 256.077 |
| Exact Mass | 256.077 |
| XLogP | 2.7 |
| Formal Charge | 0 |
| Heavy Atom Count | 17 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9431 |
| Human Intestinal Absorption | HIA+ | 1.0000 |
| Caco-2 Permeability | Caco2- | 0.6250 |
| P-glycoprotein Substrate | Non-substrate | 0.5871 |
| P-glycoprotein Inhibitor | Inhibitor | 0.7147 |
| Non-inhibitor | 0.9304 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8868 |
| Distribution | ||
| Subcellular localization | Lysosome | 0.4766 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8346 |
| CYP450 2D6 Substrate | Non-substrate | 0.8059 |
| CYP450 3A4 Substrate | Substrate | 0.5710 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.5361 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.6745 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8953 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.6712 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8662 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.5556 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.5905 |
| Non-inhibitor | 0.6751 | |
| AMES Toxicity | AMES toxic | 0.5953 |
| Carcinogens | Carcinogens | 0.7043 |
| Fish Toxicity | High FHMT | 0.9318 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.8529 |
| Honey Bee Toxicity | High HBT | 0.8591 |
| Biodegradation | Not ready biodegradable | 0.6741 |
| Acute Oral Toxicity | III | 0.7723 |
| Carcinogenicity (Three-class) | Non-required | 0.5280 |
| Model | Value | Unit |
|---|---|---|
| Absorption | ||
| Aqueous solubility | -3.4419 | LogS |
| Caco-2 Permeability | 0.6799 | LogPapp, cm/s |
| Distribution | ||
| Metabolism | ||
| Excretion | ||
| Toxicity | ||
| Rat Acute Toxicity | 2.1041 | LD50, mol/kg |
| Fish Toxicity | 1.0355 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.3593 | pIGC50, ug/L |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Cotton Seeds | Japan | 0.1ppm | |||
| Rice(Brown Rice) | Japan | 0.1ppm | |||
| Rice | Korea | 00.1ppm |