Amisulbrom
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Amisulbrom(F06248) |
| 2D Structure | |
| FRCD ID | F06248 |
| CAS Number | 348635-87-0 |
| PubChem CID | 10238657 |
| Formula | C13H13BrFN5O4S2 |
| IUPAC Name | 3-(3-bromo-6-fluoro-2-methylindol-1-yl)sulfonyl-N,N-dimethyl-1,2,4-triazole-1-sulfonamide |
| InChI Key | BREATYVWRHIPIY-UHFFFAOYSA-N |
| InChI | InChI=1S/C13H13BrFN5O4S2/c1-8-12(14)10-5-4-9(15)6-11(10)20(8)25(21,22)13-16-7-19(17-13)26(23,24)18(2)3/h4-7H,1-3H3 |
| Canonical SMILES | CC1=C(C2=C(N1S(=O)(=O)C3=NN(C=N3)S(=O)(=O)N(C)C)C=C(C=C2)F)Br |
| Isomeric SMILES | CC1=C(C2=C(N1S(=O)(=O)C3=NN(C=N3)S(=O)(=O)N(C)C)C=C(C=C2)F)Br |
| Synonyms |
3-((3-Bromo-6-fluoro-2-methyl-1H-indol-1-yl)sulfonyl)-N,N-dimethyl-1H-1,2,4-triazole-1-sulfonamide
Amisulbrom
348635-87-0
UNII-RM460IQC3A
RM460IQC3A
3-[(3-bromo-6-fluoro-2-methyl-1H-indol-1-yl)sulfonyl]-N,N-dimethyl-1H-1,2,4-triazole-1-sulfonamide
3-(3-bromo-6-fluoro-2-methylindol-1-ylsulfonyl)-N,N-dimethyl-1H-1,2,4-triazole-1-sulfonamide
Amisulbrom [ISO]
Amibromdole
HSDB 8031
|
| Classifies |
Pesticide
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Organoheterocyclic compounds |
| Class | Indoles and derivatives |
| Subclass | Indoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Indoles |
| Alternative Parents | |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Indole - Aryl bromide - Aryl fluoride - Aryl halide - Benzenoid - Substituted pyrrole - Azole - Heteroaromatic compound - Pyrrole - 1,2,4-triazole - Sulfonyl - Organosulfonic acid or derivatives - Organic sulfonic acid or derivatives - Azacycle - Organosulfur compound - Organonitrogen compound - Organofluoride - Organobromide - Organohalogen compound - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Organic oxygen compound - Organic nitrogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as indoles. These are compounds containing an indole moiety, which consists of pyrrole ring fused to benzene to form 2,3-benzopyrrole. |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 466.3 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 8 |
| Rotatable Bond Count | 4 |
| Complexity | 741 |
| Monoisotopic Mass | 464.958 |
| Exact Mass | 464.958 |
| XLogP | 2.4 |
| Formal Charge | 0 |
| Heavy Atom Count | 26 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.5839 |
| Human Intestinal Absorption | HIA+ | 0.9973 |
| Caco-2 Permeability | Caco2- | 0.5425 |
| P-glycoprotein Substrate | Non-substrate | 0.7439 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.6573 |
| Non-inhibitor | 0.9035 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8883 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.4194 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7325 |
| CYP450 2D6 Substrate | Non-substrate | 0.7808 |
| CYP450 3A4 Substrate | Non-substrate | 0.5425 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.7497 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.5711 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9121 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.5000 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.9513 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.6263 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9165 |
| Non-inhibitor | 0.7913 | |
| AMES Toxicity | Non AMES toxic | 0.6130 |
| Carcinogens | Non-carcinogens | 0.7237 |
| Fish Toxicity | High FHMT | 0.9835 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.8316 |
| Honey Bee Toxicity | Low HBT | 0.7310 |
| Biodegradation | Not ready biodegradable | 0.9669 |
| Acute Oral Toxicity | III | 0.4530 |
| Carcinogenicity (Three-class) | Non-required | 0.6162 |
| Model | Value | Unit |
|---|---|---|
| Absorption | ||
| Aqueous solubility | -3.5704 | LogS |
| Caco-2 Permeability | 0.8531 | LogPapp, cm/s |
| Distribution | ||
| Metabolism | ||
| Excretion | ||
| Toxicity | ||
| Rat Acute Toxicity | 3.1036 | LD50, mol/kg |
| Fish Toxicity | 1.4267 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.6322 | pIGC50, ug/L |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Citrus fruits | 0110000 | European Union | 0.01* | 25/06/2015 | |
| Grapefruits (Natsudaidais, Shaddocks/pomelos, Sweeties/oroblancos, Tangelolos, Tangelos (except minneolas)/Ugli®, Other hybrids of Citrus paradisi, not elsewhere mentioned,) | 0110010 | European Union | 0.01* | 25/06/2015 | |
| Oranges (Bergamots, Bitter oranges/sour oranges, Blood oranges, Cara caras, Chinottos, Trifoliate oranges, Other hybrids of Citrus sinensis, not elsewhere mentioned,) | 0110020 | European Union | 0.01* | 25/06/2015 | |
| Lemons (Buddha's hands/Buddha's fingers, Citrons,) | 0110030 | European Union | 0.01* | 25/06/2015 | |
| Limes (Indian sweet limes/Palestine sweet limes, Kaffir limes, Sweet limes/mosambis, Tahiti limes, Limequats,) | 0110040 | European Union | 0.01* | 25/06/2015 | |
| Mandarins (Calamondins, Clementines, Cleopatra mandarins, Minneolas, Satsumas/clausellinas, Tangerines/dancy mandarins, Tangors, Other hybrids of Citrus reticulata, not elsewhere mentioned,) | 0110050 | European Union | 0.01* | 25/06/2015 | |
| Others (2) | 0110990 | European Union | 0.01* | 25/06/2015 | |
| Tree nuts | 0120000 | European Union | 0.01* | 25/06/2015 | |
| Almonds (Apricot kernels, Bitter almonds, Canarium nuts/galip nuts, Pili nuts, Okari nuts,) | 0120010 | European Union | 0.01* | 25/06/2015 | |
| Brazil nuts | 0120020 | European Union | 0.01* | 25/06/2015 | |
| Cashew nuts | 0120030 | European Union | 0.01* | 25/06/2015 | |
| Chestnuts | 0120040 | European Union | 0.01* | 25/06/2015 | |
| Coconuts (Areca nuts/betel nuts,) | 0120050 | European Union | 0.01* | 25/06/2015 | |
| Hazelnuts/cobnuts (Acorns, Filberts,) | 0120060 | European Union | 0.01* | 25/06/2015 | |
| Macadamias | 0120070 | European Union | 0.01* | 25/06/2015 | |
| Pecans (Hickory nuts,) | 0120080 | European Union | 0.01* | 25/06/2015 | |
| Pistachios | 0120100 | European Union | 0.01* | 25/06/2015 | |
| Walnuts | 0120110 | European Union | 0.01* | 25/06/2015 | |
| Others (2) | 0120990 | European Union | 0.01* | 25/06/2015 | |
| Pome fruits | 0130000 | European Union | 0.01* | 25/06/2015 |