Benthiavalicarb
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Benthiavalicarb(F06252) |
| 2D Structure | |
| FRCD ID | F06252 |
| CAS Number | 413615-35-7 |
| PubChem CID | 20593234 |
| Formula | C15H18FN3O3S |
| IUPAC Name | [(2S)-1-[[(1R)-1-(6-fluoro-1,3-benzothiazol-2-yl)ethyl]amino]-3-methyl-1-oxobutan-2-yl]carbamic acid |
| InChI Key | VVSLYIKSEBPRSN-PELKAZGASA-N |
| InChI | InChI=1S/C15H18FN3O3S/c1-7(2)12(19-15(21)22)13(20)17-8(3)14-18-10-5-4-9(16)6-11(10)23-14/h4-8,12,19H,1-3H3,(H,17,20)(H,21,22)/t8-,12+/m1/s1 |
| Canonical SMILES | CC(C)C(C(=O)NC(C)C1=NC2=C(S1)C=C(C=C2)F)NC(=O)O |
| Isomeric SMILES | C[C@H](C1=NC2=C(S1)C=C(C=C2)F)NC(=O)[C@H](C(C)C)NC(=O)O |
| Synonyms |
benthiavalicarbe
SCHEMBL21965
Benthiavalicarb
UNII-6YZ3ZXJ6WN
6YZ3ZXJ6WN
413615-35-7
Benthiavalicarb [ISO]
DTXSID7058096
CHEBI:83601
VVSLYIKSEBPRSN-PELKAZGASA-N
|
| Classifies |
Pesticide
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives - Alpha amino acids and derivatives |
| Direct Parent | Valine and derivatives |
| Alternative Parents |
|
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Valine or derivatives - Alpha-amino acid amide - 1,3-benzothiazole - N-acyl-amine - Fatty amide - Benzenoid - Fatty acyl - Aryl fluoride - Aryl halide - Heteroaromatic compound - Thiazole - Azole - Carbamic acid derivative - Carbonic acid derivative - Carboxamide group - Carbamic acid - Secondary carboxylic acid amide - Azacycle - Organoheterocyclic compound - Organonitrogen compound - Organooxygen compound - Carbonyl group - Organic nitrogen compound - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Organic oxygen compound - Organofluoride - Organohalogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as valine and derivatives. These are compounds containing valine or a derivative thereof resulting from reaction of valine at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 339.385 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 5 |
| Complexity | 452 |
| Monoisotopic Mass | 339.105 |
| Exact Mass | 339.105 |
| XLogP | 2.8 |
| Formal Charge | 0 |
| Heavy Atom Count | 23 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.7157 |
| Human Intestinal Absorption | HIA+ | 0.9362 |
| Caco-2 Permeability | Caco2- | 0.6289 |
| P-glycoprotein Substrate | Non-substrate | 0.5495 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8272 |
| Non-inhibitor | 0.9847 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9740 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.6676 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7888 |
| CYP450 2D6 Substrate | Non-substrate | 0.7965 |
| CYP450 3A4 Substrate | Non-substrate | 0.6042 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.5707 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.6265 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9376 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.6998 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8255 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.8513 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9986 |
| Non-inhibitor | 0.8892 | |
| AMES Toxicity | Non AMES toxic | 0.8199 |
| Carcinogens | Non-carcinogens | 0.8241 |
| Fish Toxicity | High FHMT | 0.9961 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9162 |
| Honey Bee Toxicity | Low HBT | 0.5912 |
| Biodegradation | Not ready biodegradable | 1.0000 |
| Acute Oral Toxicity | III | 0.5767 |
| Carcinogenicity (Three-class) | Non-required | 0.6206 |
| Model | Value | Unit |
|---|---|---|
| Absorption | ||
| Aqueous solubility | -3.4752 | LogS |
| Caco-2 Permeability | 0.4452 | LogPapp, cm/s |
| Distribution | ||
| Metabolism | ||
| Excretion | ||
| Toxicity | ||
| Rat Acute Toxicity | 2.5646 | LD50, mol/kg |
| Fish Toxicity | 1.4290 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.4114 | pIGC50, ug/L |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Citrus fruits | 0110000 | European Union | 0.01* | 13/11/2014 | |
| Grapefruits (Natsudaidais, Shaddocks/pomelos, Sweeties/oroblancos, Tangelolos, Tangelos (except minneolas)/Ugli®, Other hybrids of Citrus paradisi, not elsewhere mentioned,) | 0110010 | European Union | 0.01* | 13/11/2014 | |
| Oranges (Bergamots, Bitter oranges/sour oranges, Blood oranges, Cara caras, Chinottos, Trifoliate oranges, Other hybrids of Citrus sinensis, not elsewhere mentioned,) | 0110020 | European Union | 0.01* | 13/11/2014 | |
| Lemons (Buddha's hands/Buddha's fingers, Citrons,) | 0110030 | European Union | 0.01* | 13/11/2014 | |
| Limes (Indian sweet limes/Palestine sweet limes, Kaffir limes, Sweet limes/mosambis, Tahiti limes, Limequats,) | 0110040 | European Union | 0.01* | 13/11/2014 | |
| Mandarins (Calamondins, Clementines, Cleopatra mandarins, Minneolas, Satsumas/clausellinas, Tangerines/dancy mandarins, Tangors, Other hybrids of Citrus reticulata, not elsewhere mentioned,) | 0110050 | European Union | 0.01* | 13/11/2014 | |
| Others (2) | 0110990 | European Union | 0.01* | 13/11/2014 | |
| Tree nuts | 0120000 | European Union | 0.02* | 13/11/2014 | |
| Almonds (Apricot kernels, Bitter almonds, Canarium nuts/galip nuts, Pili nuts, Okari nuts,) | 0120010 | European Union | 0.02* | 13/11/2014 | |
| Brazil nuts | 0120020 | European Union | 0.02* | 13/11/2014 | |
| Cashew nuts | 0120030 | European Union | 0.02* | 13/11/2014 | |
| Chestnuts | 0120040 | European Union | 0.02* | 13/11/2014 | |
| Coconuts (Areca nuts/betel nuts,) | 0120050 | European Union | 0.02* | 13/11/2014 | |
| Hazelnuts/cobnuts (Acorns, Filberts,) | 0120060 | European Union | 0.02* | 13/11/2014 | |
| Macadamias | 0120070 | European Union | 0.02* | 13/11/2014 | |
| Pecans (Hickory nuts,) | 0120080 | European Union | 0.02* | 13/11/2014 | |
| Pistachios | 0120100 | European Union | 0.02* | 13/11/2014 | |
| Walnuts | 0120110 | European Union | 0.02* | 13/11/2014 | |
| Others (2) | 0120990 | European Union | 0.02* | 13/11/2014 | |
| Pome fruits | 0130000 | European Union | 0.01* | 13/11/2014 |