Bixafen
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Bixafen(F06254) |
| 2D Structure | |
| FRCD ID | F06254 |
| CAS Number | 581809-46-3 |
| PubChem CID | 11434448 |
| Formula | C18H12Cl2F3N3O |
| IUPAC Name | N-[2-(3,4-dichlorophenyl)-4-fluorophenyl]-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide |
| InChI Key | LDLMOOXUCMHBMZ-UHFFFAOYSA-N |
| InChI | InChI=1S/C18H12Cl2F3N3O/c1-26-8-12(16(25-26)17(22)23)18(27)24-15-5-3-10(21)7-11(15)9-2-4-13(19)14(20)6-9/h2-8,17H,1H3,(H,24,27) |
| Canonical SMILES | CN1C=C(C(=N1)C(F)F)C(=O)NC2=C(C=C(C=C2)F)C3=CC(=C(C=C3)Cl)Cl |
| Isomeric SMILES | CN1C=C(C(=N1)C(F)F)C(=O)NC2=C(C=C(C=C2)F)C3=CC(=C(C=C3)Cl)Cl |
| Synonyms |
Bixafen
581809-46-3
UNII-28XK2L8M3B
28XK2L8M3B
N-(3,4-dichloro-5-fluorobiphenyl-2-yl)-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide
N-(3',4'-dichloro-5-fluorobiphenyl-2-yl)-3-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxamide
Bixafen [ISO]
bixafene
SCHEMBL68043
DTXSID6058134
|
| Classifies |
Pesticide
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Anilides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Aromatic anilides |
| Alternative Parents |
|
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Aromatic anilide - Polychlorinated biphenyl - Chlorinated biphenyl - Biphenyl - Pyrazole-4-carboxamide - 1,2-dichlorobenzene - Halobenzene - Fluorobenzene - Chlorobenzene - Aryl chloride - Aryl fluoride - Aryl halide - Azole - Heteroaromatic compound - Pyrazole - Vinylogous amide - Secondary carboxylic acid amide - Carboxamide group - Azacycle - Carboxylic acid derivative - Organoheterocyclic compound - Organonitrogen compound - Organooxygen compound - Alkyl halide - Alkyl fluoride - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Organic oxygen compound - Organic nitrogen compound - Organofluoride - Organochloride - Organohalogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as aromatic anilides. These are aromatic compounds containing an anilide group in which the carboxamide group is substituted with an aromatic group. They have the general structure RNC(=O)R', where R= benzene, and R = aryl group. |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 414.209 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 4 |
| Complexity | 530 |
| Monoisotopic Mass | 413.031 |
| Exact Mass | 413.031 |
| XLogP | 4.7 |
| Formal Charge | 0 |
| Heavy Atom Count | 27 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9936 |
| Human Intestinal Absorption | HIA+ | 1.0000 |
| Caco-2 Permeability | Caco2+ | 0.5550 |
| P-glycoprotein Substrate | Non-substrate | 0.8815 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.7351 |
| Non-inhibitor | 0.7177 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8021 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.8798 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.6810 |
| CYP450 2D6 Substrate | Non-substrate | 0.8821 |
| CYP450 3A4 Substrate | Substrate | 0.6500 |
| CYP450 1A2 Inhibitor | Inhibitor | 0.8952 |
| CYP450 2C9 Inhibitor | Inhibitor | 0.9048 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9242 |
| CYP450 2C19 Inhibitor | Inhibitor | 0.8950 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.7561 |
| CYP Inhibitory Promiscuity | High CYP Inhibitory Promiscuity | 0.9245 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9813 |
| Non-inhibitor | 0.5573 | |
| AMES Toxicity | Non AMES toxic | 0.7187 |
| Carcinogens | Non-carcinogens | 0.7057 |
| Fish Toxicity | High FHMT | 0.9970 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9390 |
| Honey Bee Toxicity | Low HBT | 0.9491 |
| Biodegradation | Not ready biodegradable | 1.0000 |
| Acute Oral Toxicity | III | 0.7444 |
| Carcinogenicity (Three-class) | Danger | 0.4348 |
| Model | Value | Unit |
|---|---|---|
| Absorption | ||
| Aqueous solubility | -3.9786 | LogS |
| Caco-2 Permeability | 1.4562 | LogPapp, cm/s |
| Distribution | ||
| Metabolism | ||
| Excretion | ||
| Toxicity | ||
| Rat Acute Toxicity | 2.1810 | LD50, mol/kg |
| Fish Toxicity | 1.1449 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.8076 | pIGC50, ug/L |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Others (2) | 0260990 | European Union | 0.01* | 05/06/2018 | |
| Stem vegetables | 0270000 | European Union | 0.01* | 05/06/2018 | |
| Asparagus (Hop sprouts,) | 0270010 | European Union | 0.01* | 05/06/2018 | |
| Cardoons (Borage stems,) | 0270020 | European Union | 0.01* | 05/06/2018 | |
| Celeries | 0270030 | European Union | 0.01* | 05/06/2018 | |
| Florence fennels | 0270040 | European Union | 0.01* | 05/06/2018 | |
| Globe artichokes (Banana flowers,) | 0270050 | European Union | 0.01* | 05/06/2018 | |
| Leeks (Kurrat/Egyptian leek,) | 0270060 | European Union | 0.01* | 05/06/2018 | |
| Rhubarbs | 0270070 | European Union | 0.01* | 05/06/2018 | |
| Bamboo shoots (European bamboo /Japanese knotweed,) | 0270080 | European Union | 0.01* | 05/06/2018 | |
| Palm hearts | 0270090 | European Union | 0.01* | 05/06/2018 | |
| Others (2) | 0270990 | European Union | 0.01* | 05/06/2018 | |
| Fungi, mosses and lichens | 0280000 | European Union | 0.01* | 05/06/2018 | |
| (b) leaves and herbs | 0632000 | European Union | 0.01* | 05/06/2018 | |
| SUGAR PLANTS | 0900000 | European Union | 0.01* | 05/06/2018 | |
| Sugar beet roots | 0900010 | European Union | 0.01* | 05/06/2018 | |
| Wild fungi (Ceps/porcino mushrooms, Chanterelles, Hedgehog mushrooms, Horns of plenty/black trumpets, Morels, Périgord black truffles, Piemont white truffles, Saint George's mushrooms, Scotch bonne... | 0280020 | European Union | 0.01* | 05/06/2018 | |
| Mosses and lichens (Icelandic mosses, Other mosses and lichens,) | 0280990 | European Union | 0.01* | 05/06/2018 | |
| Algae and prokaryotes organisms (Carrageen mosses/Irish mosses, Kombu, Spirulina, Spirulina, Other algae, Other procaryotes organisms, Rockweed /knotted kelp,) | 0290000 | European Union | 0.01* | 05/06/2018 | |
| PULSES | 0300000 | European Union | 0.01* | 05/06/2018 |