Flucycloxuron
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Flucycloxuron(F06278) |
| 2D Structure | |
| FRCD ID | F06278 |
| CAS Number | |
| PubChem CID | 6537963 |
| Formula | C25H20ClF2N3O3 |
| IUPAC Name | N-[[4-[[(E)-[(4-chlorophenyl)-cyclopropylmethylidene]amino]oxymethyl]phenyl]carbamoyl]-2,6-difluorobenzamide |
| InChI Key | PCKNFPQPGUWFHO-UQRQXUALSA-N |
| InChI | InChI=1S/C25H20ClF2N3O3/c26-18-10-8-17(9-11-18)23(16-6-7-16)31-34-14-15-4-12-19(13-5-15)29-25(33)30-24(32)22-20(27)2-1-3-21(22)28/h1-5,8-13,16H,6-7,14H2,(H2,29,30,32,33)/b31-23+ |
| Canonical SMILES | C1CC1C(=NOCC2=CC=C(C=C2)NC(=O)NC(=O)C3=C(C=CC=C3F)F)C4=CC=C(C=C4)Cl |
| Isomeric SMILES | C1CC1/C(=N\OCC2=CC=C(C=C2)NC(=O)NC(=O)C3=C(C=CC=C3F)F)/C4=CC=C(C=C4)Cl |
| Synonyms |
Flucycloxuron
Andalin
Flucycloxuron [ISO]
(E)-flucycloxuron
UBI-A 1335
OMS 3041
Flucycloxuron,(E)-isomer
UNII-V8H544MV3H
PH 70-23
DU 319722
|
| Classifies |
Pesticide
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | N-phenylureas |
| Intermediate Tree Nodes | N-acyl-phenylureas |
| Direct Parent | N-benzoyl-N'-phenylureas |
| Alternative Parents |
|
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | N-benzoyl-n'-phenylurea - Halobenzoic acid or derivatives - 2-halobenzoic acid or derivatives - Benzoic acid or derivatives - Benzoyl - Chlorobenzene - Fluorobenzene - Halobenzene - Aryl chloride - Aryl fluoride - Aryl halide - Vinylogous halide - Urea - Carbonic acid derivative - Carboxylic acid derivative - Organic nitrogen compound - Organohalogen compound - Organochloride - Organofluoride - Organonitrogen compound - Organooxygen compound - Carbonyl group - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Organic oxygen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as n-benzoyl-n'-phenylureas. These are n-acyl-phenylureas that have the acyl group substituted by a phenyl group. |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 483.9 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 7 |
| Complexity | 725 |
| Monoisotopic Mass | 483.116 |
| Exact Mass | 483.116 |
| XLogP | 6.1 |
| Formal Charge | 0 |
| Heavy Atom Count | 34 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 1 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9798 |
| Human Intestinal Absorption | HIA+ | 0.9925 |
| Caco-2 Permeability | Caco2- | 0.5458 |
| P-glycoprotein Substrate | Non-substrate | 0.6958 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.5423 |
| Non-inhibitor | 0.8444 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.7244 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.9002 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.6606 |
| CYP450 2D6 Substrate | Non-substrate | 0.8227 |
| CYP450 3A4 Substrate | Non-substrate | 0.5642 |
| CYP450 1A2 Inhibitor | Inhibitor | 0.7008 |
| CYP450 2C9 Inhibitor | Inhibitor | 0.5162 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8404 |
| CYP450 2C19 Inhibitor | Inhibitor | 0.6896 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.7878 |
| CYP Inhibitory Promiscuity | High CYP Inhibitory Promiscuity | 0.6652 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9406 |
| Non-inhibitor | 0.8429 | |
| AMES Toxicity | Non AMES toxic | 0.5816 |
| Carcinogens | Non-carcinogens | 0.5058 |
| Fish Toxicity | High FHMT | 0.9653 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9979 |
| Honey Bee Toxicity | Low HBT | 0.8860 |
| Biodegradation | Not ready biodegradable | 0.9880 |
| Acute Oral Toxicity | III | 0.7726 |
| Carcinogenicity (Three-class) | Non-required | 0.5986 |
| Model | Value | Unit |
|---|---|---|
| Absorption | ||
| Aqueous solubility | -4.5805 | LogS |
| Caco-2 Permeability | 1.1832 | LogPapp, cm/s |
| Distribution | ||
| Metabolism | ||
| Excretion | ||
| Toxicity | ||
| Rat Acute Toxicity | 2.0170 | LD50, mol/kg |
| Fish Toxicity | 0.8710 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.9305 | pIGC50, ug/L |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Lemons (Buddha's hands/Buddha's fingers, Citrons,) | 0110030 | European Union | 0.01* | 30/12/2015 | |
| Limes (Indian sweet limes/Palestine sweet limes, Kaffir limes, Sweet limes/mosambis, Tahiti limes, Limequats,) | 0110040 | European Union | 0.01* | 30/12/2015 | |
| Pine nut kernels (Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels ... | 0120090 | European Union | 0.02* | 30/12/2015 | |
| Elderberries (Bayberries, Buffalo berries, Che berries, Dwarf elderberries, Guelder rose berries, Hawberries, Midland hawberries, Phalsa fruits, Riberries, Rowan berries, Saskatoons/saskatoons berr... | 0154080 | European Union | 0.01* | 30/12/2015 | |
| Salsifies (Burdocks, Rampion roots, Scorzonera/black salsifies, Skirrets, Spanish salsifies,) | 0213090 | European Union | 0.01* | 30/12/2015 | |
| Tomatoes (Alkekengi/Chinese lanterns/ground cherries, Cape gooseberries, Cherry tomatoes, Dwarf Cape gooseberries/strawberry tomatoes, Gojiberries/wolfberries, Gojiberries/wolfberries, Litchi tomat... | 0231010 | European Union | 0.01* | 30/12/2015 | |
| Baby leaf crops (including brassica species) (Chards/beet leaves, Escaroles/broad-leaved endives, Indian mustards/mustard greens, Lettuces, Spinaches, Other species harvested at baby leaf stage,) | 0251080 | European Union | 0.01* | 30/12/2015 | |
| Spinaches (Amaranths/Chinese spinaches/pak-khom, Amaranths/Chinese spinaches/pak-khom, Amaranths/Chinese spinaches/pak-khom, Amaranths/Chinese spinaches/pak-khom, Amaranths/Chinese spinaches/pak-kh... | 0252010 | European Union | 0.01* | 30/12/2015 | |
| Cultivated fungi (Common mushrooms/button mushrooms/champignons mushrooms, Corn smuts/ Mexican truffles, Enokitake/winter mushrooms, Fusarium venenatum, Horse mushrooms, Jew's ears/hirneola, Nameko... | 0280010 | European Union | 0.01* | 30/12/2015 | |
| Rose (Almond, Bee balm, Bitter orange/sour orange, Black locust, Cat’s foot, Chrysanthemum, Cinnamon, Clary sage, Cornflower, Cowslip/primrose, Daisy, Dyer’s broom, Elder, Field poppy, Great mullei... | 0631030 | European Union | 0.05* | 30/12/2015 | |
| Strawberry (Absinth/common wormwood, Agrimony, Alfalfa/lucerne, Aloe (leaf gel), Alpine ladies mantle, Bearberry, Bilberry/European blueberry/whortleberry, Birch, Bitter orange/sour orange, Blackbe... | 0632010 | European Union | 0.05* | 30/12/2015 | |
| Flower pistil spices | 0860000 | European Union | 0.05* | 30/12/2015 | |
| Sugar canes (Agave leaves, Sweet sorghum canes,) | 0900020 | European Union | 0.01* | 30/12/2015 | |
| (b) bovine (American buffalo, Banteng, Buffalo, European buffalo/wisent, Gayal, Yak (domestic), Zebu, Hybrids of genera Bison, Bos, Bubalus and Poëphagus,) | 1012000 | European Union | 0.01* | 30/12/2015 | |
| (f) poultry (Bobwhite quail, Chicken (including silkie chicken), Collared Dove, Duck, Geese, Green peafowl, Guinea fowl, Japanese quail, Muskovy duck, Mute swan, Partridge, Peafowl, Pheasant, Pigeo... | 1016000 | European Union | 0.01* | 30/12/2015 | |
| Geese | 1030030 | European Union | 0.01* | 30/12/2015 | |
| Others (2) (Emu, Nandu/greater rhea, Ostrich, Other eggs producer birds,) | 1030990 | European Union | 0.01* | 30/12/2015 | |
| Horseradishes (Dandelion roots, Gentiana roots, East Indian galangal/aromatic ginger/sand galangal, Fingerroot, Galangal roots, Galangal roots, Galangal roots, Galangal roots, Ginger roots, Greater... | 0213040 | European Union | 0.01* | 30/12/2015 | |
| Fungi, mosses and lichens | 0280000 | European Union | 0.01* | 30/12/2015 | |
| Citrus fruits | 0110000 | European Union | 0.01* | 30/12/2015 |