Flupyradifurone
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Flupyradifurone(F06283) |
| 2D Structure | |
| FRCD ID | F06283 |
| CAS Number | 951659-40-8 |
| PubChem CID | 16752772 |
| Formula | C12H11ClF2N2O2 |
| IUPAC Name | 3-[(6-chloropyridin-3-yl)methyl-(2,2-difluoroethyl)amino]-2H-furan-5-one |
| InChI Key | QOIYTRGFOFZNKF-UHFFFAOYSA-N |
| InChI | InChI=1S/C12H11ClF2N2O2/c13-10-2-1-8(4-16-10)5-17(6-11(14)15)9-3-12(18)19-7-9/h1-4,11H,5-7H2 |
| Canonical SMILES | C1C(=CC(=O)O1)N(CC2=CN=C(C=C2)Cl)CC(F)F |
| Isomeric SMILES | C1C(=CC(=O)O1)N(CC2=CN=C(C=C2)Cl)CC(F)F |
| Synonyms |
Flupyradifurone
951659-40-8
UNII-8H7JT159D0
8H7JT159D0
Flupyradifurone [ISO]
Flupyradifuron
Sivanto
4-[[(6-chloropyridin-3-yl)methyl](2,2-difluoroethyl)amino]furan-2(5H)-one
4-{[(6-chloropyridin-3-yl)methyl](2,2-difluoroethyl)amino}furan-2(5H)-one
SCHEMBL123283
|
| Classifies |
Pesticide
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Halopyridines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 2-halopyridines |
| Alternative Parents |
|
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Aralkylamine - 2-halopyridine - 2-furanone - Aryl chloride - Aryl halide - Heteroaromatic compound - Vinylogous amide - Alpha,beta-unsaturated carboxylic ester - Enoate ester - Dihydrofuran - Amino acid or derivatives - Tertiary aliphatic amine - Tertiary amine - Carboxylic acid ester - Lactone - Carboxylic acid derivative - Oxacycle - Azacycle - Monocarboxylic acid or derivatives - Enamine - Alkyl fluoride - Organohalogen compound - Organochloride - Organofluoride - Organonitrogen compound - Organooxygen compound - Hydrocarbon derivative - Carbonyl group - Organic oxide - Organopnictogen compound - Organic oxygen compound - Organic nitrogen compound - Amine - Alkyl halide - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as 2-halopyridines. These are organic compounds containing a pyridine ring substituted at the 2-position by a halogen atom. |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 288.679 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 5 |
| Complexity | 366 |
| Monoisotopic Mass | 288.048 |
| Exact Mass | 288.048 |
| XLogP | 2.3 |
| Formal Charge | 0 |
| Heavy Atom Count | 19 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.8812 |
| Human Intestinal Absorption | HIA+ | 0.9945 |
| Caco-2 Permeability | Caco2+ | 0.5000 |
| P-glycoprotein Substrate | Non-substrate | 0.6262 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8398 |
| Non-inhibitor | 0.9178 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.6156 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.4542 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7975 |
| CYP450 2D6 Substrate | Non-substrate | 0.7772 |
| CYP450 3A4 Substrate | Non-substrate | 0.5727 |
| CYP450 1A2 Inhibitor | Inhibitor | 0.5559 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.8118 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8426 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.6778 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8864 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.5475 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.6668 |
| Non-inhibitor | 0.8361 | |
| AMES Toxicity | Non AMES toxic | 0.5985 |
| Carcinogens | Non-carcinogens | 0.8951 |
| Fish Toxicity | High FHMT | 0.9401 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9290 |
| Honey Bee Toxicity | Low HBT | 0.7795 |
| Biodegradation | Not ready biodegradable | 1.0000 |
| Acute Oral Toxicity | III | 0.5841 |
| Carcinogenicity (Three-class) | Non-required | 0.5151 |
| Model | Value | Unit |
|---|---|---|
| Absorption | ||
| Aqueous solubility | -2.8977 | LogS |
| Caco-2 Permeability | 0.9545 | LogPapp, cm/s |
| Distribution | ||
| Metabolism | ||
| Excretion | ||
| Toxicity | ||
| Rat Acute Toxicity | 2.5191 | LD50, mol/kg |
| Fish Toxicity | 1.1410 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.5055 | pIGC50, ug/L |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Pistachios | 0120100 | European Union | 0.01* | 24/11/2016 | |
| Walnuts | 0120110 | European Union | 0.01* | 24/11/2016 | |
| Others (2) | 0120990 | European Union | 0.01* | 24/11/2016 | |
| Pome fruits | 0130000 | European Union | 0.4 | 24/11/2016 | |
| Apples (Crab apples/wild apples, Tejocotes,) | 0130010 | European Union | 0.4 | 24/11/2016 | |
| Pears (Nashi pears/Oriental pears, Wild pears, Ya pears/Chinese white pears,) | 0130020 | European Union | 0.4 | 24/11/2016 | |
| Quinces (Chinese quinces, Japanese quinces,) | 0130030 | European Union | 0.4 | 24/11/2016 | |
| Medlars | 0130040 | European Union | 0.4 | 24/11/2016 | |
| Loquats/Japanese medlars | 0130050 | European Union | 0.4 | 24/11/2016 | |
| Others (2) | 0130990 | European Union | 0.4 | 24/11/2016 | |
| Stone fruits | 0140000 | European Union | 0.01* | 24/11/2016 | |
| Apricots (Japanese apricots/Umes, Nectacots,) | 0140010 | European Union | 0.01* | 24/11/2016 | |
| Cherries (sweet) (Black cherries, Capulins, Chokecherries, Cornelian cherries/European corniols, Nanking cherries, Sour cherries/morello cherries,) | 0140020 | European Union | 0.01* | 24/11/2016 | |
| Peaches (Flat peaches/saturn peaches/paraguayas, Nectarines, Other hybrids of Persica vulgaris; syn: Prunus persica, not elsewhere mentioned,) | 0140030 | European Union | 0.01* | 24/11/2016 | |
| Rhubarbs | 0270070 | European Union | 0.01* | 24/11/2016 | |
| Plums (American plums, Beach plums, Cherry plums /myrabolans, Chickasaw plums, Chinese jujubes/red dates/Chinese dates, Damsons/ bullaces, Gages/greengages/Reine Claudes, Japanese plums, Klamath pl... | 0140040 | European Union | 0.01* | 24/11/2016 | |
| Others (2) | 0140990 | European Union | 0.01* | 24/11/2016 | |
| (a) grapes | 0151000 | European Union | 0.8 | 24/11/2016 | |
| Table grapes (Kiwiberries/dwarf kiwi (2), Schisandra berries,) | 0151010 | European Union | 0.8 | 24/11/2016 | |
| Wine grapes (Amur river grapes, Muscadine grapes,) | 0151020 | European Union | 0.8 | 24/11/2016 |
References
| Title | Journal | Date | Pubmed ID |
|---|---|---|---|
| Relative Toxicity of Two Aphicides to Hippodamia convergens (Coleoptera: Coccinellidae): Implications for Integrated Management of Sugarcane Aphid, Melanaphis sacchari (Hemiptera: Aphididae). | J Econ Entomol | 2017 Feb 1 | 28039423 |