Penthiopyrad
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Penthiopyrad(F06315) |
| 2D Structure | |
| FRCD ID | F06315 |
| CAS Number | 183675-82-3 |
| PubChem CID | 11388558 |
| Formula | C16H20F3N3OS |
| IUPAC Name | 1-methyl-N-[2-(4-methylpentan-2-yl)thiophen-3-yl]-3-(trifluoromethyl)pyrazole-4-carboxamide |
| InChI Key | PFFIDZXUXFLSSR-UHFFFAOYSA-N |
| InChI | InChI=1S/C16H20F3N3OS/c1-9(2)7-10(3)13-12(5-6-24-13)20-15(23)11-8-22(4)21-14(11)16(17,18)19/h5-6,8-10H,7H2,1-4H3,(H,20,23) |
| Canonical SMILES | CC(C)CC(C)C1=C(C=CS1)NC(=O)C2=CN(N=C2C(F)(F)F)C |
| Isomeric SMILES | CC(C)CC(C)C1=C(C=CS1)NC(=O)C2=CN(N=C2C(F)(F)F)C |
| Synonyms |
Penthiopyrad
183675-82-3
CHEBI:83138
(rs)-n-[2-(1,3-dimethylbutyl)-3-thienyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide
Vertisan
Gaia
Penthiopyrad [ISO]
DPX-LEM 17
SCHEMBL18701
C16H20F3N3OS
|
| Classifies |
Pesticide
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Organoheterocyclic compounds |
| Class | Azoles |
| Subclass | Pyrazoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyrazoles |
| Alternative Parents | |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Pyrazole - Thiophene - Heteroaromatic compound - Carboximidic acid - Carboximidic acid derivative - Propargyl-type 1,3-dipolar organic compound - Organic 1,3-dipolar compound - Azacycle - Organic oxygen compound - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Organofluoride - Organohalogen compound - Alkyl fluoride - Alkyl halide - Organopnictogen compound - Hydrocarbon derivative - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrazoles. These are compounds containing a pyrazole ring, which is a five-member aromatic ring with two nitrogen atoms (at positions 1 and 2) and three carbon atoms. |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 359.411 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 5 |
| Complexity | 447 |
| Monoisotopic Mass | 359.128 |
| Exact Mass | 359.128 |
| XLogP | 4 |
| Formal Charge | 0 |
| Heavy Atom Count | 24 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9895 |
| Human Intestinal Absorption | HIA+ | 0.9966 |
| Caco-2 Permeability | Caco2- | 0.5448 |
| P-glycoprotein Substrate | Non-substrate | 0.8499 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.6475 |
| Inhibitor | 0.5558 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9180 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.7528 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.6892 |
| CYP450 2D6 Substrate | Non-substrate | 0.8179 |
| CYP450 3A4 Substrate | Substrate | 0.6058 |
| CYP450 1A2 Inhibitor | Inhibitor | 0.8308 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.6347 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8654 |
| CYP450 2C19 Inhibitor | Inhibitor | 0.6527 |
| CYP450 3A4 Inhibitor | Inhibitor | 0.6542 |
| CYP Inhibitory Promiscuity | High CYP Inhibitory Promiscuity | 0.5975 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9973 |
| Non-inhibitor | 0.6470 | |
| AMES Toxicity | Non AMES toxic | 0.6048 |
| Carcinogens | Non-carcinogens | 0.7646 |
| Fish Toxicity | High FHMT | 0.9969 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.8456 |
| Honey Bee Toxicity | Low HBT | 0.8167 |
| Biodegradation | Not ready biodegradable | 1.0000 |
| Acute Oral Toxicity | III | 0.5040 |
| Carcinogenicity (Three-class) | Non-required | 0.4259 |
| Model | Value | Unit |
|---|---|---|
| Absorption | ||
| Aqueous solubility | -3.3254 | LogS |
| Caco-2 Permeability | 1.0861 | LogPapp, cm/s |
| Distribution | ||
| Metabolism | ||
| Excretion | ||
| Toxicity | ||
| Rat Acute Toxicity | 2.8060 | LD50, mol/kg |
| Fish Toxicity | 1.1896 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.5636 | pIGC50, ug/L |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Peanuts/groundnuts | 0401020 | European Union | 0.05 | 11/07/2017 | |
| Rapeseeds/canola seeds (Radish seeds, Turnip rape seeds,) | 0401060 | European Union | 0.5 | 11/07/2017 | |
| Castor beans (Grape seeds, Sea buckthorn/sallow thorn seeds,) | 0401150 | European Union | 0.01* | 11/07/2017 | |
| Buckwheat and other pseudocereals (Amaranth/kiwicha, Amaranth/kiwicha, Amaranth/kiwicha, Kaniwa/canihua, Quinoa, Chia seeds,) | 0500020 | European Union | 0.01* | 11/07/2017 | |
| Rose (Almond, Bee balm, Bitter orange/sour orange, Black locust, Cat’s foot, Chrysanthemum, Cinnamon, Clary sage, Cornflower, Cowslip/primrose, Daisy, Dyer’s broom, Elder, Field poppy, Great mullei... | 0631030 | European Union | 0.02* | 11/07/2017 | |
| Strawberry (Absinth/common wormwood, Agrimony, Alfalfa/lucerne, Aloe (leaf gel), Alpine ladies mantle, Bearberry, Bilberry/European blueberry/whortleberry, Birch, Bitter orange/sour orange, Blackbe... | 0632010 | European Union | 0.02* | 11/07/2017 | |
| Black caraway/black cumin (Nigella,) | 0810020 | European Union | 0.02* | 11/07/2017 | |
| Nutmeg (Annatto, Candlenut, Wattleseeds, Calabash nutmeg,) | 0810090 | European Union | 0.02* | 11/07/2017 | |
| Liver | 1015030 | European Union | 0.01* | 11/07/2017 | |
| Edible offals (other than liver and kidney) | 1015050 | European Union | 0.01* | 11/07/2017 | |
| (f) poultry (Bobwhite quail, Chicken (including silkie chicken), Collared Dove, Duck, Geese, Green peafowl, Guinea fowl, Japanese quail, Muskovy duck, Mute swan, Partridge, Peafowl, Pheasant, Pigeo... | 1016000 | European Union | 0.01* | 11/07/2017 | |
| Rye | 0500070 | European Union | 0.1 | 11/07/2017 | |
| Poppy seeds | 0401030 | European Union | 0.01* | 11/07/2017 | |
| Sesame seeds | 0401040 | European Union | 0.01* | 11/07/2017 | |
| Sunflower seeds | 0401050 | European Union | 1.5 | 11/07/2017 | |
| Soyabeans (Moringa/drumstick tree seeds,) | 0401070 | European Union | 0.3 | 11/07/2017 | |
| Mustard seeds | 0401080 | European Union | 0.01* | 11/07/2017 | |
| Cotton seeds | 0401090 | European Union | 0.5 | 11/07/2017 | |
| Pumpkin seeds (Watermelon seeds, Other seeds of species of familia Cucurbitaceae, not elsewhere mentioned,) | 0401100 | European Union | 0.01* | 11/07/2017 | |
| Others (2) | 0401990 | European Union | 0.01* | 11/07/2017 |