2-Ethyl-3,5-Dimethylpyrazine
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | 2-Ethyl-3,5-Dimethylpyrazine(F06807) |
| 2D Structure | |
| FRCD ID | F06807 |
| CAS Number | 55031-15-7 |
| PubChem CID | 26334 |
| Formula | C8H12N2 |
| IUPAC Name | 2-ethyl-3,5-dimethylpyrazine |
| InChI Key | JZBCTZLGKSYRSF-UHFFFAOYSA-N |
| InChI | InChI=1S/C8H12N2/c1-4-8-7(3)10-6(2)5-9-8/h5H,4H2,1-3H3 |
| Canonical SMILES | CCC1=NC=C(N=C1C)C |
| Isomeric SMILES | CCC1=NC=C(N=C1C)C |
| Wikipedia | 2-Ethyl-3,5-Dimethylpyrazine |
| Synonyms |
2-Ethyl-3,5-dimethyl pyrazine
2-ETHYL-3,5-DIMETHYLPYRAZINE
13925-07-0
3,5-Dimethyl-2-ethylpyrazine
Pyrazine, 2-ethyl-3,5-dimethyl-
FEMA 3150
2,6-Dimethyl-3-ethylpyrazine
3-Ethyl-2,6-dimethylpyrazine
27043-05-6
Pyrazine, 2,6-dimethyl-3-ethyl-
|
| Classifies |
Food Additive
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Organoheterocyclic compounds |
| Class | Diazines |
| Subclass | Pyrazines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyrazines |
| Alternative Parents | |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Pyrazine - Heteroaromatic compound - Azacycle - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organonitrogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrazines. These are compounds containing a pyrazine ring, which is a six-member aromatic heterocycle, that consists of two nitrogen atoms (at positions 1 and 4) and four carbon atoms. |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 136.198 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Complexity | 103 |
| Monoisotopic Mass | 136.1 |
| Exact Mass | 136.1 |
| XLogP | 1.5 |
| Formal Charge | 0 |
| Heavy Atom Count | 10 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9745 |
| Human Intestinal Absorption | HIA+ | 0.9837 |
| Caco-2 Permeability | Caco2+ | 0.7242 |
| P-glycoprotein Substrate | Non-substrate | 0.5288 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.7711 |
| Non-inhibitor | 1.0000 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8033 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.5339 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8467 |
| CYP450 2D6 Substrate | Non-substrate | 0.7120 |
| CYP450 3A4 Substrate | Non-substrate | 0.7246 |
| CYP450 1A2 Inhibitor | Inhibitor | 0.7412 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9129 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8631 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.8288 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8809 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.7911 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9651 |
| Non-inhibitor | 0.9315 | |
| AMES Toxicity | Non AMES toxic | 0.9131 |
| Carcinogens | Non-carcinogens | 0.8646 |
| Fish Toxicity | Low FHMT | 0.5157 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.8857 |
| Honey Bee Toxicity | Low HBT | 0.6455 |
| Biodegradation | Not ready biodegradable | 0.9850 |
| Acute Oral Toxicity | II | 0.7215 |
| Carcinogenicity (Three-class) | Non-required | 0.6265 |
| Model | Value | Unit |
|---|---|---|
| Absorption | ||
| Aqueous solubility | -1.4179 | LogS |
| Caco-2 Permeability | 1.7928 | LogPapp, cm/s |
| Distribution | ||
| Metabolism | ||
| Excretion | ||
| Toxicity | ||
| Rat Acute Toxicity | 2.4438 | LD50, mol/kg |
| Fish Toxicity | 1.8955 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.7126 | pIGC50, ug/L |