1-(3-(Methylthio)-Butyryl)-2,6,6-Trimethylcyclohexene
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | 1-(3-(Methylthio)-Butyryl)-2,6,6-Trimethylcyclohexene(F07193) |
| 2D Structure | |
| FRCD ID | F07193 |
| CAS Number | 68697-67-6 |
| PubChem CID | 20332432 |
| Formula | C14H24OS |
| IUPAC Name | 3-methylsulfanyl-1-(2,6,6-trimethylcyclohexen-1-yl)butan-1-one |
| InChI Key | NCSINGBYRFXOMK-UHFFFAOYSA-N |
| InChI | InChI=1S/C14H24OS/c1-10-7-6-8-14(3,4)13(10)12(15)9-11(2)16-5/h11H,6-9H2,1-5H3 |
| Canonical SMILES | CC1=C(C(CCC1)(C)C)C(=O)CC(C)SC |
| Isomeric SMILES | CC1=C(C(CCC1)(C)C)C(=O)CC(C)SC |
| Wikipedia | 1-(3-(Methylthio)-Butyryl)-2,6,6-Trimethylcyclohexene |
| Synonyms |
(+/-)-1-(3-(Methylthio)-butyryl)-2,6,6-trimethylcyclohexene
68697-67-6
FEMA No. 4569
1-(3-(Methylthio)-butyryl)-2,6,6-trimethylcyclohexene
SCHEMBL10807261
1-(3-(Methylthio)-butyryl)-2,6,6-trimethylcyclohexene, (+/-)-
1-Butanone, 3-(methylthio)-1-(2,6,6-trimethyl-1-cyclohexen-1-yl)-
3-(Methylthio)-1-(2,6,6-trimethyl-1-cyclohexen-1-yl)-1-butanone
1-(3-(methyl thio)-butyryl)-2,6,6-trimethyl cyclohexene
1-(3-(methyl thio)butyryl)-2,6,6-trimethyl cyclohexene
|
| Classifies |
Food Additive
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Carbonyl compounds |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Ketones |
| Alternative Parents | |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Ketone - Dialkylthioether - Sulfenyl compound - Thioether - Organic oxide - Hydrocarbon derivative - Organosulfur compound - Aliphatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as ketones. These are organic compounds in which a carbonyl group is bonded to two carbon atoms R2C=O (neither R may be a hydrogen atom). Ketones that have one or more alpha-hydrogen atoms undergo keto-enol tautomerization, the tautomer being an enol. |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 240.405 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 4 |
| Complexity | 302 |
| Monoisotopic Mass | 240.155 |
| Exact Mass | 240.155 |
| XLogP | 3.7 |
| Formal Charge | 0 |
| Heavy Atom Count | 16 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9660 |
| Human Intestinal Absorption | HIA+ | 0.9955 |
| Caco-2 Permeability | Caco2+ | 0.7266 |
| P-glycoprotein Substrate | Non-substrate | 0.5922 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.5843 |
| Inhibitor | 0.5459 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.7739 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.4313 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8159 |
| CYP450 2D6 Substrate | Non-substrate | 0.8354 |
| CYP450 3A4 Substrate | Substrate | 0.6283 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.6593 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.8302 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9378 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.8290 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.9615 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.6179 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.8840 |
| Non-inhibitor | 0.8546 | |
| AMES Toxicity | Non AMES toxic | 0.8697 |
| Carcinogens | Non-carcinogens | 0.7509 |
| Fish Toxicity | High FHMT | 0.9297 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9727 |
| Honey Bee Toxicity | High HBT | 0.8669 |
| Biodegradation | Not ready biodegradable | 0.6481 |
| Acute Oral Toxicity | III | 0.6731 |
| Carcinogenicity (Three-class) | Non-required | 0.6027 |
| Model | Value | Unit |
|---|---|---|
| Absorption | ||
| Aqueous solubility | -3.0788 | LogS |
| Caco-2 Permeability | 1.8996 | LogPapp, cm/s |
| Distribution | ||
| Metabolism | ||
| Excretion | ||
| Toxicity | ||
| Rat Acute Toxicity | 2.0010 | LD50, mol/kg |
| Fish Toxicity | 0.7490 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.5919 | pIGC50, ug/L |