2-Isobutyl-3-Methylpyrazine
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | 2-Isobutyl-3-Methylpyrazine(F07409) |
| 2D Structure | |
| FRCD ID | F07409 |
| CAS Number | 13925-06-9 |
| PubChem CID | 26333 |
| Formula | C9H14N2 |
| IUPAC Name | 2-methyl-3-(2-methylpropyl)pyrazine |
| InChI Key | ZHMIODDNZRIENW-UHFFFAOYSA-N |
| InChI | InChI=1S/C9H14N2/c1-7(2)6-9-8(3)10-4-5-11-9/h4-5,7H,6H2,1-3H3 |
| Canonical SMILES | CC1=NC=CN=C1CC(C)C |
| Isomeric SMILES | CC1=NC=CN=C1CC(C)C |
| Wikipedia | 2-Isobutyl-3-Methylpyrazine |
| Synonyms |
2-Isobutyl-3-methyl-pyrazine
2-ISOBUTYL-3-METHYLPYRAZINE
13925-06-9
2-Methyl-3-(2-methylpropyl)pyrazine
Pyrazine, 2-methyl-3-(2-methylpropyl)-
2-Methyl-3-isobutylpyrazine
2-isobutyl-3-methyl pyrazine
UNII-11EP4V0M9Z
3-Methyl-2-isobutyl pyrazine
11EP4V0M9Z
|
| Classifies |
Food Additive
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Organoheterocyclic compounds |
| Class | Diazines |
| Subclass | Pyrazines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyrazines |
| Alternative Parents | |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Pyrazine - Heteroaromatic compound - Azacycle - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organonitrogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrazines. These are compounds containing a pyrazine ring, which is a six-member aromatic heterocycle, that consists of two nitrogen atoms (at positions 1 and 4) and four carbon atoms. |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 150.225 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 2 |
| Complexity | 112 |
| Monoisotopic Mass | 150.116 |
| Exact Mass | 150.116 |
| XLogP | 2 |
| Formal Charge | 0 |
| Heavy Atom Count | 11 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9798 |
| Human Intestinal Absorption | HIA+ | 0.9818 |
| Caco-2 Permeability | Caco2+ | 0.7234 |
| P-glycoprotein Substrate | Non-substrate | 0.5188 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.7554 |
| Non-inhibitor | 0.9945 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.7793 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.5859 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8276 |
| CYP450 2D6 Substrate | Non-substrate | 0.6066 |
| CYP450 3A4 Substrate | Non-substrate | 0.6472 |
| CYP450 1A2 Inhibitor | Inhibitor | 0.6497 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9314 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8408 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.8616 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.9069 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.8825 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9740 |
| Non-inhibitor | 0.9217 | |
| AMES Toxicity | Non AMES toxic | 0.8548 |
| Carcinogens | Non-carcinogens | 0.9067 |
| Fish Toxicity | High FHMT | 0.7948 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.7114 |
| Honey Bee Toxicity | Low HBT | 0.6496 |
| Biodegradation | Not ready biodegradable | 0.9812 |
| Acute Oral Toxicity | III | 0.5167 |
| Carcinogenicity (Three-class) | Non-required | 0.6382 |
| Model | Value | Unit |
|---|---|---|
| Absorption | ||
| Aqueous solubility | -1.9501 | LogS |
| Caco-2 Permeability | 1.8055 | LogPapp, cm/s |
| Distribution | ||
| Metabolism | ||
| Excretion | ||
| Toxicity | ||
| Rat Acute Toxicity | 2.3370 | LD50, mol/kg |
| Fish Toxicity | 1.3230 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 1.1119 | pIGC50, ug/L |