Benzyl Nonanoate
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Benzyl Nonanoate(F07865) |
| 2D Structure | |
| FRCD ID | F07865 |
| CAS Number | 6471-66-5 |
| PubChem CID | 80960 |
| Formula | C16H24O2 |
| IUPAC Name | benzyl nonanoate |
| InChI Key | KVIQEJMWUXBBQJ-UHFFFAOYSA-N |
| InChI | InChI=1S/C16H24O2/c1-2-3-4-5-6-10-13-16(17)18-14-15-11-8-7-9-12-15/h7-9,11-12H,2-6,10,13-14H2,1H3 |
| Canonical SMILES | CCCCCCCCC(=O)OCC1=CC=CC=C1 |
| Isomeric SMILES | CCCCCCCCC(=O)OCC1=CC=CC=C1 |
| Wikipedia | Benzyl Nonanoate |
| Synonyms |
Benzyl nonanoate
6471-66-5
UNII-7MCG3KKQ5N
BENZYLPELARGONATE
7MCG3KKQ5N
Benzyl n-nonanoate
Benzyl nonan-1-oate
Benzyl nonanoate #
EINECS 229-316-9
Nonanoic acid, phenylmethyl ester
|
| Classifies |
Food Additive
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzyloxycarbonyls |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzyloxycarbonyls |
| Alternative Parents | |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Benzyloxycarbonyl - Fatty acid ester - Fatty acyl - Carboxylic acid ester - Monocarboxylic acid or derivatives - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as benzyloxycarbonyls. These are organic compounds containing a carbonyl group substituted with a benzyloxyl group. |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 248.366 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 10 |
| Complexity | 207 |
| Monoisotopic Mass | 248.178 |
| Exact Mass | 248.178 |
| XLogP | 5.1 |
| Formal Charge | 0 |
| Heavy Atom Count | 18 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9811 |
| Human Intestinal Absorption | HIA+ | 1.0000 |
| Caco-2 Permeability | Caco2+ | 0.8267 |
| P-glycoprotein Substrate | Non-substrate | 0.6205 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.9072 |
| Non-inhibitor | 0.9195 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.7811 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.4894 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8296 |
| CYP450 2D6 Substrate | Non-substrate | 0.8831 |
| CYP450 3A4 Substrate | Non-substrate | 0.6709 |
| CYP450 1A2 Inhibitor | Inhibitor | 0.7021 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.8565 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8593 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.6964 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.9181 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.7082 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.8697 |
| Non-inhibitor | 0.7819 | |
| AMES Toxicity | Non AMES toxic | 0.9775 |
| Carcinogens | Non-carcinogens | 0.7088 |
| Fish Toxicity | High FHMT | 0.9661 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9996 |
| Honey Bee Toxicity | High HBT | 0.6481 |
| Biodegradation | Ready biodegradable | 0.8908 |
| Acute Oral Toxicity | III | 0.8180 |
| Carcinogenicity (Three-class) | Non-required | 0.5750 |
| Model | Value | Unit |
|---|---|---|
| Absorption | ||
| Aqueous solubility | -4.8410 | LogS |
| Caco-2 Permeability | 1.5248 | LogPapp, cm/s |
| Distribution | ||
| Metabolism | ||
| Excretion | ||
| Toxicity | ||
| Rat Acute Toxicity | 1.4991 | LD50, mol/kg |
| Fish Toxicity | 0.4942 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 1.5081 | pIGC50, ug/L |