Butyl Cinnamate
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Butyl Cinnamate(F07893) |
| 2D Structure | |
| FRCD ID | F07893 |
| CAS Number | 538-65-8 |
| PubChem CID | 5273465 |
| Formula | C13H16O2 |
| IUPAC Name | butyl (E)-3-phenylprop-2-enoate |
| InChI Key | OHHIVLJVBNCSHV-MDZDMXLPSA-N |
| InChI | InChI=1S/C13H16O2/c1-2-3-11-15-13(14)10-9-12-7-5-4-6-8-12/h4-10H,2-3,11H2,1H3/b10-9+ |
| Canonical SMILES | CCCCOC(=O)C=CC1=CC=CC=C1 |
| Isomeric SMILES | CCCCOC(=O)/C=C/C1=CC=CC=C1 |
| Wikipedia | Butyl Cinnamate |
| Synonyms |
BUTYL CINNAMATE
Eliminoxy
538-65-8
Cinnamic acid n-butyl ester
n-Butyl phenylacrylate
Butyl phenylacrylate
Cinnamic acid, butyl ester
Butyl (E)-cinnamate
Butyl 3-phenyl-2-propenoate
n-Butyl cinnamate
|
| Classifies |
Food Additive
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Phenylpropanoids and polyketides |
| Class | Cinnamic acids and derivatives |
| Subclass | Cinnamic acid esters |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Cinnamic acid esters |
| Alternative Parents | |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Cinnamic acid ester - Styrene - Fatty acid ester - Monocyclic benzene moiety - Benzenoid - Fatty acyl - Enoate ester - Alpha,beta-unsaturated carboxylic ester - Carboxylic acid ester - Monocarboxylic acid or derivatives - Carboxylic acid derivative - Hydrocarbon derivative - Organic oxide - Organooxygen compound - Organic oxygen compound - Carbonyl group - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as cinnamic acid esters. These are compound containing an ester derivative of cinnamic acid. |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 204.269 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 6 |
| Complexity | 203 |
| Monoisotopic Mass | 204.115 |
| Exact Mass | 204.115 |
| XLogP | 3.9 |
| Formal Charge | 0 |
| Heavy Atom Count | 15 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 1 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9800 |
| Human Intestinal Absorption | HIA+ | 1.0000 |
| Caco-2 Permeability | Caco2+ | 0.8530 |
| P-glycoprotein Substrate | Non-substrate | 0.6329 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8871 |
| Non-inhibitor | 0.9548 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8175 |
| Distribution | ||
| Subcellular localization | Plasma membrane | 0.6210 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7804 |
| CYP450 2D6 Substrate | Non-substrate | 0.8839 |
| CYP450 3A4 Substrate | Non-substrate | 0.6632 |
| CYP450 1A2 Inhibitor | Inhibitor | 0.8583 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.8793 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9111 |
| CYP450 2C19 Inhibitor | Inhibitor | 0.5676 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.9192 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.6060 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9072 |
| Non-inhibitor | 0.9475 | |
| AMES Toxicity | Non AMES toxic | 0.9104 |
| Carcinogens | Non-carcinogens | 0.6804 |
| Fish Toxicity | High FHMT | 0.9570 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9999 |
| Honey Bee Toxicity | High HBT | 0.7351 |
| Biodegradation | Ready biodegradable | 0.9135 |
| Acute Oral Toxicity | III | 0.9469 |
| Carcinogenicity (Three-class) | Non-required | 0.5606 |
| Model | Value | Unit |
|---|---|---|
| Absorption | ||
| Aqueous solubility | -3.8608 | LogS |
| Caco-2 Permeability | 1.7688 | LogPapp, cm/s |
| Distribution | ||
| Metabolism | ||
| Excretion | ||
| Toxicity | ||
| Rat Acute Toxicity | 1.6427 | LD50, mol/kg |
| Fish Toxicity | 0.3693 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 1.5852 | pIGC50, ug/L |