Terpinyl Isobutyrate
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| Common Name | Terpinyl Isobutyrate(F08629) |
| 2D Structure | |
| FRCD ID | F08629 |
| CAS Number | 7774-65-4 |
| PubChem CID | 522673 |
| Formula | C14H24O2 |
| IUPAC Name | 2-(4-methylcyclohex-3-en-1-yl)propan-2-yl 2-methylpropanoate |
| InChI Key | SMQUXKIIXFOJKI-UHFFFAOYSA-N |
| InChI | InChI=1S/C14H24O2/c1-10(2)13(15)16-14(4,5)12-8-6-11(3)7-9-12/h6,10,12H,7-9H2,1-5H3 |
| Canonical SMILES | CC1=CCC(CC1)C(C)(C)OC(=O)C(C)C |
| Isomeric SMILES | CC1=CCC(CC1)C(C)(C)OC(=O)C(C)C |
| Wikipedia | Terpinyl Isobutyrate |
| Synonyms |
Terpinyl isobutyrate
7774-65-4
P-Menth-1-en-8-yl isobutyrate
FEMA No. 3050
alpha-terpinyl isobutyrate
EINECS 231-878-5
BRN 3129659
.alpha.-Terpinyl isobutyrate
1-Methyl-1-(4-methyl-3-cyclohexen-1-yl)ethyl 2-methylpropanoate
Propanoic acid, 2-methyl-, 1-methyl-1-(4-methyl-3-cyclohexen-1-yl)ethyl ester
|
| Classifies |
Food Additive
|
| Update Date | Nov 13, 2018 17:07 |
Chemical Taxonomy
| Kingdom | Organic compounds |
| Superclass | Lipids and lipid-like molecules |
| Class | Prenol lipids |
| Subclass | Monoterpenoids |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Menthane monoterpenoids |
| Alternative Parents | |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | P-menthane monoterpenoid - Monocyclic monoterpenoid - Carboxylic acid ester - Monocarboxylic acid or derivatives - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aliphatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as menthane monoterpenoids. These are monoterpenoids with a structure based on the o-, m-, or p-menthane backbone. P-menthane consists of the cyclohexane ring with a methyl group and a (2-methyl)-propyl group at the 1 and 4 ring position, respectively. The o- and m- menthanes are much rarer, and presumably arise by alkyl migration of p-menthanes. |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 224.344 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 4 |
| Complexity | 287 |
| Monoisotopic Mass | 224.178 |
| Exact Mass | 224.178 |
| XLogP | 3.5 |
| Formal Charge | 0 |
| Heavy Atom Count | 16 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9429 |
| Human Intestinal Absorption | HIA+ | 1.0000 |
| Caco-2 Permeability | Caco2+ | 0.7264 |
| P-glycoprotein Substrate | Non-substrate | 0.5155 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.6760 |
| Inhibitor | 0.5970 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8197 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.6558 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8647 |
| CYP450 2D6 Substrate | Non-substrate | 0.9042 |
| CYP450 3A4 Substrate | Substrate | 0.6255 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.8316 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.7372 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9325 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.5656 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.9003 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.7554 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9332 |
| Non-inhibitor | 0.8681 | |
| AMES Toxicity | Non AMES toxic | 0.9426 |
| Carcinogens | Non-carcinogens | 0.6462 |
| Fish Toxicity | High FHMT | 0.9352 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9467 |
| Honey Bee Toxicity | High HBT | 0.8786 |
| Biodegradation | Ready biodegradable | 0.7716 |
| Acute Oral Toxicity | III | 0.7462 |
| Carcinogenicity (Three-class) | Non-required | 0.4913 |
| Model | Value | Unit |
|---|---|---|
| Absorption | ||
| Aqueous solubility | -3.7837 | LogS |
| Caco-2 Permeability | 1.5843 | LogPapp, cm/s |
| Distribution | ||
| Metabolism | ||
| Excretion | ||
| Toxicity | ||
| Rat Acute Toxicity | 1.6185 | LD50, mol/kg |
| Fish Toxicity | 0.6080 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 1.1089 | pIGC50, ug/L |