Relevant Regulations and Standards
Diazinon(F03312)
| Common Name | Diazinon(F03312) |
| FRCD ID | F03312 |
| Formula | C12H21N2O3PS |
| InChI Key | FHIVAFMUCKRCQO-UHFFFAOYSA-N |
| InChI | InChI=1S/C12H21N2O3PS/c1-6-15-18(19,16-7-2)17-11-8-10(5)13-12(14-11)9(3)4/h8-9H,6-7H2,1-5H3 |
| Canonical SMILES | CCOP(=S)(OCC)OC1=NC(=NC(=C1)C)C(C)C |
| Isomeric SMILES | CCOP(=S)(OCC)OC1=NC(=NC(=C1)C)C(C)C |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| (g) other farmed terrestrial animals (Alpaca, Bactrian camel, Capybara, Cottontail/American rabbit, Dromedary, Eland, Elk/moose, Emu, Fallow deer, Guinea pig, Hare (farmed), Llama, Nandu/greater rhea, Ostrich, Peccari (collared), Rabbit, Red deer, Reindeer, Roe deer, Other farmed terrestrial animals,) | 1017000 | European Union | 0.01* | 26/04/2013 | |
| Kidney | 1013040 | European Union | 0.03 | 26/04/2013 | |
| Wild fungi (Ceps/porcino mushrooms, Chanterelles, Hedgehog mushrooms, Horns of plenty/black trumpets, Morels, Périgord black truffles, Piemont white truffles, Saint George's mushrooms, Scotch bonnet mushrooms, Summer truffles, Other wild fungi, Other species of genus Tuber, not elsewhere mentioned,) | 0280020 | European Union | 0.01* | 26/04/2013 | |
| Others (2) | 1013990 | European Union | 0.01* | 26/04/2013 | |
| Others (2) | 0251990 | European Union | 0.01* | 26/04/2013 | |
| (b) spinaches and similar leaves | 0252000 | European Union | 0.01* | 26/04/2013 | |
| Purslanes (Agretti, Glassworts/samphires, Rock samphires, Sea asters, Sea lavenders, Winter purslanes/miner's lettuces, Karkallas/Hottentot figs/Iceplant leaves,) | 0252020 | European Union | 0.01* | 26/04/2013 | |
| Chards/beet leaves (Beetroot leaves, Swiss chards,) | 0252030 | European Union | 0.01* | 26/04/2013 | |
| Others (2) | 0252990 | European Union | 0.01* | 26/04/2013 | |
| (c) grape leaves and similar species (Climbing wattle/acacia shoots, Malabar nightshades,) | 0253000 | European Union | 0.01* | 26/04/2013 | |
| (d) watercresses (Morning glory/Chinese convolvolus/water convolvolus/kangkung, Water clovers, Water mimosas,) | 0254000 | European Union | 0.01* | 26/04/2013 | |
| (e) witloofs/Belgian endives (Dandelion leaves (forced),) | 0255000 | European Union | 0.01* | 26/04/2013 | |
| (f) herbs and edible flowers | 0256000 | European Union | 0.02* | 26/04/2013 | |
| Chervil | 0256010 | European Union | 0.02* | 26/04/2013 | |
| Chives (Chinese chives/oriental garlic/garlic chives, Ramson/wild garlic/bear's garlic,) | 0256020 | European Union | 0.02* | 26/04/2013 | |
| Celery leaves (Angelica (leaves and stems), Burnet, Caraway leaves, Coriander leaves, Culantro/false coriander leaves, Dill leaves, Fennel leaves, Fenugreek leaves, Herb of grace/rue, Lovage leaves, Pimpernel/greater burnet-saxifrage, Salad burnet/lady's mantle, Sorrel/dock, Sorrel/dock, Sorrel/dock, Sorrel/dock, Sweet cicely,) | 0256030 | European Union | 0.02* | 26/04/2013 | |
| Parsley (Root parsley leaves,) | 0256040 | European Union | 0.02* | 26/04/2013 | |
| Sage (Borage, Curry herb, Greek sage, Jamé's sage/Mexican sage, Other species and hybrids of genus Salvia, not elsewhere mentioned,) | 0256050 | European Union | 0.02* | 26/04/2013 | |
| Rosemary (Santolina/green lavander cotton, Green santolina,) | 0256060 | European Union | 0.02* | 26/04/2013 | |
| Thyme (Creeping thyme, Cretan oregano/Turkish oregano, Lemon savory, Lemon thyme/citrus thyme, Marjoram, Mastic thyme, Oregano, Summer savory, Syrian oregano/bible hyssop/za'atar, Winter savory,) | 0256070 | European Union | 0.02* | 26/04/2013 |