Relevant Regulations and Standards
Dicofol(F03386)
| Common Name | Dicofol(F03386) |
| FRCD ID | F03386 |
| Formula | C14H9Cl5O |
| InChI Key | UOAMTSKGCBMZTC-UHFFFAOYSA-N |
| InChI | InChI=1S/C14H9Cl5O/c15-11-5-1-9(2-6-11)13(20,14(17,18)19)10-3-7-12(16)8-4-10/h1-8,20H |
| Canonical SMILES | C1=CC(=CC=C1C(C2=CC=C(C=C2)Cl)(C(Cl)(Cl)Cl)O)Cl |
| Isomeric SMILES | C1=CC(=CC=C1C(C2=CC=C(C=C2)Cl)(C(Cl)(Cl)Cl)O)Cl |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Cherries | CAC | 5 mg/kg | |||
| Coconuts (Areca nuts/betel nuts,) | 0120050 | European Union | 0.05* | 26/04/2013 | |
| Macadamias | 0120070 | European Union | 0.05* | 26/04/2013 | |
| Pecans (Hickory nuts,) | 0120080 | European Union | 0.05* | 26/04/2013 | |
| Pistachios | 0120100 | European Union | 0.05* | 26/04/2013 | |
| Walnuts | 0120110 | European Union | 0.05* | 26/04/2013 | |
| Others (2) | 0120990 | European Union | 0.05* | 26/04/2013 | |
| Pome fruits | 0130000 | European Union | 0.02* | 26/04/2013 | |
| Apples (Crab apples/wild apples, Tejocotes,) | 0130010 | European Union | 0.02* | 26/04/2013 | |
| Pears (Nashi pears/Oriental pears, Wild pears, Ya pears/Chinese white pears,) | 0130020 | European Union | 0.02* | 26/04/2013 | |
| Quinces (Chinese quinces, Japanese quinces,) | 0130030 | European Union | 0.02* | 26/04/2013 | |
| Medlars | 0130040 | European Union | 0.02* | 26/04/2013 | |
| Loquats/Japanese medlars | 0130050 | European Union | 0.02* | 26/04/2013 | |
| Others (2) | 0130990 | European Union | 0.02* | 26/04/2013 | |
| Stone fruits | 0140000 | European Union | 0.02* | 26/04/2013 | |
| Apricots (Japanese apricots/Umes, Nectacots,) | 0140010 | European Union | 0.02* | 26/04/2013 | |
| Cherries (sweet) (Black cherries, Capulins, Chokecherries, Cornelian cherries/European corniols, Nanking cherries, Sour cherries/morello cherries,) | 0140020 | European Union | 0.02* | 26/04/2013 | |
| Peaches (Flat peaches/saturn peaches/paraguayas, Nectarines, Other hybrids of Persica vulgaris; syn: Prunus persica, not elsewhere mentioned,) | 0140030 | European Union | 0.02* | 26/04/2013 | |
| Plums (American plums, Beach plums, Cherry plums /myrabolans, Chickasaw plums, Chinese jujubes/red dates/Chinese dates, Damsons/ bullaces, Gages/greengages/Reine Claudes, Japanese plums, Klamath plums, Mirabelles, Plumcots, Prunus Nadia®, Sloes/blackthorne berries,) | 0140040 | European Union | 0.02* | 26/04/2013 | |
| Others (2) | 0140990 | European Union | 0.02* | 26/04/2013 |