Relevant Regulations and Standards
Imidacloprid(F03889)
| Common Name | Imidacloprid(F03889) |
| FRCD ID | F03889 |
| Formula | C9H10ClN5O2 |
| InChI Key | YWTYJOPNNQFBPC-UHFFFAOYSA-N |
| InChI | InChI=1S/C9H10ClN5O2/c10-8-2-1-7(5-12-8)6-14-4-3-11-9(14)13-15(16)17/h1-2,5H,3-4,6H2,(H,11,13) |
| Canonical SMILES | C1CN(C(=N1)N[N+](=O)[O-])CC2=CN=C(C=C2)Cl |
| Isomeric SMILES | C1CN(C(=N1)N[N+](=O)[O-])CC2=CN=C(C=C2)Cl |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Mango | Japan | 1ppm | |||
| Guava | Japan | 1ppm | |||
| Pineapple | Japan | 1ppm | |||
| Pear | Japan | 1ppm | |||
| Japanese Pear | Japan | 1ppm | |||
| Apple | Japan | 0.5ppm | |||
| Melons | CAC | 0. 2mg/kg | |||
| Pepper | CAC | 1mg/kg | |||
| Watermelons | 0233030 | European Union | 0.2 | 05/06/2014 | |
| Citrus fruits | 0110000 | European Union | 1 | 05/06/2014 | |
| Grapefruits (Natsudaidais, Shaddocks/pomelos, Sweeties/oroblancos, Tangelolos, Tangelos (except minneolas)/Ugli®, Other hybrids of Citrus paradisi, not elsewhere mentioned,) | 0110010 | European Union | 1 | 05/06/2014 | |
| Dates (Açaí berries, Awara palm fruits, Doum palm fruits,) | 0161010 | European Union | 0.05* | 05/06/2014 | |
| Lemons (Buddha's hands/Buddha's fingers, Citrons,) | 0110030 | European Union | 1 | 05/06/2014 | |
| Limes (Indian sweet limes/Palestine sweet limes, Kaffir limes, Sweet limes/mosambis, Tahiti limes, Limequats,) | 0110040 | European Union | 1 | 05/06/2014 | |
| Mandarins (Calamondins, Clementines, Cleopatra mandarins, Minneolas, Satsumas/clausellinas, Tangerines/dancy mandarins, Tangors, Other hybrids of Citrus reticulata, not elsewhere mentioned,) | 0110050 | European Union | 1 | 05/06/2014 | |
| Others (2) | 0110990 | European Union | 1 | 05/06/2014 | |
| Tree nuts | 0120000 | European Union | 0.05* | 05/06/2014 | |
| Almonds (Apricot kernels, Bitter almonds, Canarium nuts/galip nuts, Pili nuts, Okari nuts,) | 0120010 | European Union | 0.05* | 05/06/2014 | |
| Brazil nuts | 0120020 | European Union | 0.05* | 05/06/2014 | |
| Cashew nuts | 0120030 | European Union | 0.05* | 05/06/2014 |