| Common Name | Fipronil(F03890) |
| FRCD ID | F03890 |
| Formula | C12H4Cl2F6N4OS |
| InChI Key | ZOCSXAVNDGMNBV-UHFFFAOYSA-N |
| InChI | InChI=1S/C12H4Cl2F6N4OS/c13-5-1-4(11(15,16)17)2-6(14)8(5)24-10(22)9(7(3-21)23-24)26(25)12(18,19)20/h1-2H,22H2 |
| Canonical SMILES | C1=C(C=C(C(=C1Cl)N2C(=C(C(=N2)C#N)S(=O)C(F)(F)F)N)Cl)C(F)(F)F |
| Isomeric SMILES | C1=C(C=C(C(=C1Cl)N2C(=C(C(=N2)C#N)S(=O)C(F)(F)F)N)Cl)C(F)(F)F |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Garlic | Japan | 0.002ppm | |||
| Other Terrestrial Mammals,Edible Offal | Japan | 0.03ppm | |||
| Kidney Beans,Immature(With Pods) | Japan | 0.002ppm | |||
| Sunflower | CAC | 0.002mg/kg | |||
| Spinaches (Amaranths/Chinese spinaches/pak-khom, Amaranths/Chinese spinaches/pak-khom, Amaranths/Chinese spinaches/pak-khom, Amaranths/Chinese spinaches/pak-khom, Amaranths/Chinese spinaches/pak-khom, Bitterblad/bitawiri, Bitterleaves, Black eyed peas/cowpeas leaves, Cassava leaves, Garland chrysanthemums/tong ho, New Zealand spinaches, Oraches, Sweet potato leaves, Tannias/arrowleaf elephant ears/tajer leaves,) | 0252010 | European Union | 0.005* | 13/05/2015 | |
| FRUITS, FRESH or FROZEN; TREE NUTS | 0100000 | European Union | 0.005* | 13/05/2015 | |
| Citrus fruits | 0110000 | European Union | 0.005* | 13/05/2015 | |
| Grapefruits (Natsudaidais, Shaddocks/pomelos, Sweeties/oroblancos, Tangelolos, Tangelos (except minneolas)/Ugli®, Other hybrids of Citrus paradisi, not elsewhere mentioned,) | 0110010 | European Union | 0.005* | 13/05/2015 | |
| Oranges (Bergamots, Bitter oranges/sour oranges, Blood oranges, Cara caras, Chinottos, Trifoliate oranges, Other hybrids of Citrus sinensis, not elsewhere mentioned,) | 0110020 | European Union | 0.005* | 13/05/2015 | |
| Lemons (Buddha's hands/Buddha's fingers, Citrons,) | 0110030 | European Union | 0.005* | 13/05/2015 | |
| Limes (Indian sweet limes/Palestine sweet limes, Kaffir limes, Sweet limes/mosambis, Tahiti limes, Limequats,) | 0110040 | European Union | 0.005* | 13/05/2015 | |
| Mandarins (Calamondins, Clementines, Cleopatra mandarins, Minneolas, Satsumas/clausellinas, Tangerines/dancy mandarins, Tangors, Other hybrids of Citrus reticulata, not elsewhere mentioned,) | 0110050 | European Union | 0.005* | 13/05/2015 | |
| Others (2) | 0110990 | European Union | 0.005* | 13/05/2015 | |
| Tree nuts | 0120000 | European Union | 0.005* | 13/05/2015 | |
| Almonds (Apricot kernels, Bitter almonds, Canarium nuts/galip nuts, Pili nuts, Okari nuts,) | 0120010 | European Union | 0.005* | 13/05/2015 | |
| Brazil nuts | 0120020 | European Union | 0.005* | 13/05/2015 | |
| Cashew nuts | 0120030 | European Union | 0.005* | 13/05/2015 | |
| Chestnuts | 0120040 | European Union | 0.005* | 13/05/2015 | |
| Coconuts (Areca nuts/betel nuts,) | 0120050 | European Union | 0.005* | 13/05/2015 | |
| Hazelnuts/cobnuts (Acorns, Filberts,) | 0120060 | European Union | 0.005* | 13/05/2015 |