| Common Name | Dichlorprop(F03893) |
| FRCD ID | F03893 |
| Formula | C9H8Cl2O3 |
| InChI Key | MZHCENGPTKEIGP-UHFFFAOYSA-N |
| InChI | InChI=1S/C9H8Cl2O3/c1-5(9(12)13)14-8-3-2-6(10)4-7(8)11/h2-5H,1H3,(H,12,13) |
| Canonical SMILES | CC(C(=O)O)OC1=C(C=C(C=C1)Cl)Cl |
| Isomeric SMILES | CC(C(=O)O)OC1=C(C=C(C=C1)Cl)Cl |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Barley | Britain | 0.05mg/kg | |||
| Hop | Britain | 0.1mg/kg | |||
| Tea | Britain | 0.1mg/kg | |||
| Figs | Britain | 0.05mg/kg | |||
| Dates | Britain | 0.05mg/kg | |||
| Melons | Japan | 3ppm | |||
| Water Melon | Japan | 3ppm | |||
| Blackberries | 0153010 | European Union | 0.02* | 20/10/2017 | |
| Parsley (Root parsley leaves,) | 0256040 | European Union | 0.05* | 20/10/2017 | |
| Citrus fruits | 0110000 | European Union | 0.3 | 20/10/2017 | |
| Grapefruits (Natsudaidais, Shaddocks/pomelos, Sweeties/oroblancos, Tangelolos, Tangelos (except minneolas)/Ugli®, Other hybrids of Citrus paradisi, not elsewhere mentioned,) | 0110010 | European Union | 0.3 | 20/10/2017 | |
| Oranges (Bergamots, Bitter oranges/sour oranges, Blood oranges, Cara caras, Chinottos, Trifoliate oranges, Other hybrids of Citrus sinensis, not elsewhere mentioned,) | 0110020 | European Union | 0.3 | 20/10/2017 | |
| Lemons (Buddha's hands/Buddha's fingers, Citrons,) | 0110030 | European Union | 0.3 | 20/10/2017 | |
| Limes (Indian sweet limes/Palestine sweet limes, Kaffir limes, Sweet limes/mosambis, Tahiti limes, Limequats,) | 0110040 | European Union | 0.3 | 20/10/2017 | |
| Mandarins (Calamondins, Clementines, Cleopatra mandarins, Minneolas, Satsumas/clausellinas, Tangerines/dancy mandarins, Tangors, Other hybrids of Citrus reticulata, not elsewhere mentioned,) | 0110050 | European Union | 0.3 | 20/10/2017 | |
| Others (2) | 0110990 | European Union | 0.3 | 20/10/2017 | |
| Tree nuts | 0120000 | European Union | 0.02* | 20/10/2017 | |
| Almonds (Apricot kernels, Bitter almonds, Canarium nuts/galip nuts, Pili nuts, Okari nuts,) | 0120010 | European Union | 0.02* | 20/10/2017 | |
| Brazil nuts | 0120020 | European Union | 0.02* | 20/10/2017 | |
| Cashew nuts | 0120030 | European Union | 0.02* | 20/10/2017 |