| Common Name | 2,4-Dichlorophenoxybutyric Acid(F03894) |
| FRCD ID | F03894 |
| Formula | C10H10Cl2O3 |
| InChI Key | YIVXMZJTEQBPQO-UHFFFAOYSA-N |
| InChI | InChI=1S/C10H10Cl2O3/c11-7-3-4-9(8(12)6-7)15-5-1-2-10(13)14/h3-4,6H,1-2,5H2,(H,13,14) |
| Canonical SMILES | C1=CC(=C(C=C1Cl)Cl)OCCCC(=O)O |
| Isomeric SMILES | C1=CC(=C(C=C1Cl)Cl)OCCCC(=O)O |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Chicken | 1030010 | European Union | 0.05* | 02/02/2014 | |
| Duck | 1030020 | European Union | 0.05* | 02/02/2014 | |
| Geese | 1030030 | European Union | 0.05* | 02/02/2014 | |
| Quail | 1030040 | European Union | 0.05* | 02/02/2014 | |
| Honey and other apiculture products (7) | 1040000 | European Union | 0.05* | 02/02/2014 | |
| Amphibians and Reptiles (Crocodiles, Frog legs, Snakes, Turtles, Other Amphibians and Reptiles, Other frog legs from frogs not belonging to the genus Rana,) | 1050000 | European Union | 0.05* | 02/02/2014 | |
| Terrestrial invertebrate animals (Earthworms, Insects, Snails, Other terrestrial invertebrate animals, Other edible snails not belonging to the genus Helix,) | 1060000 | European Union | 0.05* | 02/02/2014 | |
| Wild terrestrial vertebrate animals (Feathered wild game, Furred wild game, Kangaroos,) | 1070000 | European Union | 0.05* | 02/02/2014 | |
| Pig,Fat | Japan | 0.2ppm | |||
| Cattle,Fat | Japan | 0.2ppm | |||
| Milk & Dairy Produce | Britain | 0.01mg/kg | |||
| Liver And Kidney | Britain | 0.1mg/kg | |||
| All Meat Except Liver And Kidney | Britain | 0.05mg/kg | |||
| Other Cereals Do Not Include Rice | Britain | 0.05mg/kg | |||
| Rice | Britain | 0.05mg/kg | |||
| Millet | Britain | 0.05mg/kg | |||
| Buckwheat | Britain | 0.05mg/kg | |||
| Maize | Britain | 0.05mg/kg | |||
| Triticale | Britain | 0.05mg/kg | |||
| Oats | Britain | 0.05mg/kg |