Relevant Regulations and Standards
Carbosulfan(F03977)
| Common Name | Carbosulfan(F03977) |
| FRCD ID | F03977 |
| Formula | C20H32N2O3S |
| InChI Key | JLQUFIHWVLZVTJ-UHFFFAOYSA-N |
| InChI | InChI=1S/C20H32N2O3S/c1-6-8-13-22(14-9-7-2)26-21(5)19(23)24-17-12-10-11-16-15-20(3,4)25-18(16)17/h10-12H,6-9,13-15H2,1-5H3 |
| Canonical SMILES | CCCCN(CCCC)SN(C)C(=O)OC1=CC=CC2=C1OC(C2)(C)C |
| Isomeric SMILES | CCCCN(CCCC)SN(C)C(=O)OC1=CC=CC2=C1OC(C2)(C)C |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Mitsuba | Japan | 1ppm | |||
| Celery | Japan | 1ppm | |||
| Parsley | Japan | 1ppm | |||
| Parsnip | Japan | 1ppm | |||
| Carrot | Japan | 1ppm | |||
| Huckleberry | Japan | 0.2ppm | |||
| Cranberry | Japan | 0.2ppm | |||
| Blueberry | Japan | 0.2ppm | |||
| Blackberry | Japan | 0.2ppm | |||
| Raspberry | Japan | 0.2ppm | |||
| Cherry | Japan | 0.2ppm | |||
| Mume Plum | Japan | 0.2ppm | |||
| Milk & Dairy Produce | Britain | 0.05mg/kg | |||
| Meat, Fat & Preparations Of Meat | Britain | 0.05mg/kg | |||
| Other Cereals Do Not Include Rice | Britain | 0.05mg/kg | |||
| Rice | Britain | 0.05mg/kg | |||
| Millet | Britain | 0.05mg/kg | |||
| Buckwheat | Britain | 0.05mg/kg | |||
| Maize | Britain | 0.05mg/kg | |||
| Triticale | Britain | 0.05mg/kg |