| Common Name | Pirimicarb(F04019) |
| FRCD ID | F04019 |
| Formula | C11H18N4O2 |
| InChI Key | YFGYUFNIOHWBOB-UHFFFAOYSA-N |
| InChI | InChI=1S/C11H18N4O2/c1-7-8(2)12-10(14(3)4)13-9(7)17-11(16)15(5)6/h1-6H3 |
| Canonical SMILES | CC1=C(N=C(N=C1OC(=O)N(C)C)N(C)C)C |
| Isomeric SMILES | CC1=C(N=C(N=C1OC(=O)N(C)C)N(C)C)C |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Lentils | 0300020 | European Union | 0.2 | 16/08/2016 | |
| Edible offals (other than liver and kidney) | 1013050 | European Union | 0.05 | 16/08/2016 | |
| Laurel/bay leaves (Curry leaves, Kaffir lime leaves, Siamese cassia, Wild betel leaves, Pandan leaves,) | 0256090 | European Union | 0.8 | 16/08/2016 | |
| Tarragon (Aztec sweet herb, Epazote/Mexican tea/wormseed, Hyssop, Lemongrass, Mexican oregano, Nettle, Other species of the genus Urtica, not elsewhere mentioned, Russian tarragon, Stevia,) | 0256100 | European Union | 0.8 | 16/08/2016 | |
| Others (2) | 0256990 | European Union | 0.02* | 16/08/2016 | |
| Beans (with pods) (Azuki beans, Black eyed peas/cowpeas, Broad beans/fava beans/horse beans/tic beans, Borlotti beans/cannelini beans/common beans/flageolets/French beans/slicing beans/snap beans, Ervils/lentil vetches, Guar beans, Jack beans, Lablab beans/hyacinth beans, Lima beans/butter beans, Monantha vetches, Mung beans, Rice beans, Runner beans/scarlet runner beans, Soyabeans/edamame, Stink beans, Vetches, Yardlong beans,) | 0260010 | European Union | 1.5 | 16/08/2016 | |
| Beans (without pods) (Azuki beans, Black eyed peas/cowpeas, Broad beans/fava beans/horse beans/tic beans, Borlotti beans/cannelini beans/common beans/flageolets/French beans/slicing beans/snap beans, Ervils/lentil vetches, Guar beans, Jack beans, Lablab beans/hyacinth beans, Lima beans/butter beans, Monantha vetches, Mung beans, Rice beans, Runner beans/scarlet runner beans, Soyabeans/edamame, Stink beans, Vetches, Yardlong beans,) | 0260020 | European Union | 0.7 | 16/08/2016 | |
| Peas (with pods) (Asparagus peas, Chickling vetches, Chickpeas/Bengal gram, Garden peas/green peas/mangetout/snow peas/split peas/sugar peas, Moringa/drumstick tree pods, Pigeon peas,) | 0260030 | European Union | 1.5 | 16/08/2016 | |
| Peas (without pods) (Asparagus peas, Chickling vetches, Chickpeas/Bengal gram, Garden peas/green peas/mangetout/snow peas/split peas/sugar peas, Moringa/drumstick tree pods, Pigeon peas,) | 0260040 | European Union | 0.7 | 16/08/2016 | |
| Lentils (Lupins/lupini beans, Lupins/lupini beans, Lupins/lupini beans, Lupins/lupini beans,) | 0260050 | European Union | 0.7 | 16/08/2016 | |
| Others (2) | 0260990 | European Union | 0.01* | 16/08/2016 | |
| Asparagus (Hop sprouts,) | 0270010 | European Union | 0.01* | 16/08/2016 | |
| Cardoons (Borage stems,) | 0270020 | European Union | 0.2 | 16/08/2016 | |
| Celeries | 0270030 | European Union | 0.15 | 16/08/2016 | |
| Florence fennels | 0270040 | European Union | 2 | 16/08/2016 | |
| Globe artichokes (Banana flowers,) | 0270050 | European Union | 5 | 16/08/2016 | |
| Leeks (Kurrat/Egyptian leek,) | 0270060 | European Union | 0.01* | 16/08/2016 | |
| Rhubarbs | 0270070 | European Union | 2 | 16/08/2016 | |
| Bamboo shoots (European bamboo /Japanese knotweed,) | 0270080 | European Union | 0.01* | 16/08/2016 | |
| Palm hearts | 0270090 | European Union | 0.01* | 16/08/2016 |